The dissociation of molecular iodine into iodine atoms is represented as
I2(g) ⇄ 2I(g)
At 1000 K, the equilibrium constant Kc for the reaction is 3.80 × 10−5. Suppose you start with 0.0456 mole of I2 in a 2.30-L flask at 1000 K. What are the concentrations of the gases at equilibrium?
Interpretation:
The equilibrium concentration
Concept Introduction:
Equilibrium concentration: If Kc and the initial concentration for a reaction and calculate for both equilibrium concentration, and using the (ICE) chart and equilibrium constant and derived changes in respective reactants and products.
Equilibrium constant: Concentration of the products to the respective molar concentration of reactants it is called equilibrium constant. If the K value is less than one the reaction will move to the left side and the K values is higher (or) greater than one the reaction will move to the right side of reaction.
Heterogeneous equilibrium: This equilibrium reaction does not depend on the amounts of pure solid and liquid present, in other words heterogeneous equilibrium, substances are in different phases.
Kp and Kc: This equilibrium constants of gaseous mixtures, these difference between the two constants is that Kc is defined by molar concentrations, whereas Kp is defined by the partial pressures of the gasses inside a closed system.
Vaporized equilibrium: This conversion of liquid in gaseous phase is known as vaporization process. At starting the rate of condensation is less than the rate of evaporation but as evaporation continues the concentration of gaseous molecule in the vapour phase increase.
Answer to Problem 15.60QP
The equilibrium concentration
Explanation of Solution
To find: The each reactant product equilibrium concentration should be identified given the gas phase reaction.
Write and Analyze the given gas phase chemical equilibrium reaction.
The given equilibrium reaction has a homogenous process, then the equilibrium constant can also be represented by Kp, were the Kp represents partial pressure. Then the product molecule partial pressure
To find: Calculate equilibrium concentration (Kp) values for given the statement of equilibrium reaction.
Calculate and analyze the (Kp) values at
We derived here (Kp) values of (I2) dissociation reaction
First we derived the initial concentration of (I2) is
We consider the equilibrium expression in terms of the equilibrium concentration.
The obtained second (x) values are negative concentration, this physically impossible so we omitted this values. First (x) value is correct one.
The given iodine dissociation equilibrium reaction the respective reactant to give the two moles of products in the gas phase and this equilibrium reaction expression contains single conditions like gases phase, the equilibrium constant can also be represented by Kp, were the “P” partial pressure. The each molar concentration values are Kp derived given the gas phase reaction at
The molar concentration (M) values are derived given the iodine
Want to see more full solutions like this?
Chapter 15 Solutions
CHEM: ATOM FIRST V. 1 W/ACCESS >C<
- Cyclohexane, C6H12, a hydrocarbon, can isomerize or change into methylcyclopentane, a compound of the same formula (C5H9CH3) but with a different molecular structure. sssss The equilibrium constant has been estimated to be 0.12 at 25 C. If you had originally placed 0.045 mol of cyclohexane in a 2.8-L flask, what would be the concentrations of cyclohexane and methylcyclopentane when equilibrium is established?arrow_forwardThe equilibrium constant for the dissociation of iodine molecules to iodine atoms I2(g) 2 I(g) is 3.76 103 at 1000 K. Suppose 0.105 mol of I2 is placed in a 12.3-L flask at 1000 K. What are the concentrations of I2 and I when the system comes to equilibrium?arrow_forwardDinitrogen tetroxide, N2O4, is a colorless gas (boiling point, 21C), which dissociates to give nitrogen dioxide, NO2 a reddish brown gas. N2O4(g)2NO2(g) The equilibrium constant Kc at 25C is 0.125. What percentage of dinitrogen tetroxidc is dissociated when 0.0400 mol N2O4 is placed in a 1.00-L flask at 25C?arrow_forward
- Fluorine, F2, dissociates into atoms on heating. 12F2(g)F(g) The value of Kp at 842C is 7.55 102 What is the value of Kc at this temperature?arrow_forwardConsider the equilibrium N2(g)+O2(g)2NO(g) At 2300 K the equilibrium constant Kc = 1.7 103. If 0.15 mol NO(g) is placed into an empty, sealed 10.0-L flask and heated to 2300 K, calculate the equilibrium concentrations of all three substances at this temperature.arrow_forwardFor the reaction N2(g)+3H2(g)2NH3(g) show that Kc = Kp(RT)2 Do not use the formula Kp = Kc(RT)5n given in the text. Start from the fact that Pi = [i]RT, where Pi is the partial pressure of substance i and [i] is its molar concentration. Substitute into Kc.arrow_forward
- Phosphorus pentachloride, PCl5, decomposes on heating to give phosphorus trichloride, PCl5, and chlorine. PCl5(g)PCl3(g)+Cl2(g) A closed 2.90-L vessel initially contains 0.0564 mol PCl5. What is the total pressure at 250C when equilibrium is achieved? The value of Kc at 250C is 4.15 102.arrow_forwardAt 2300 K the equilibrium constant for the formation of NO(g) is 1.7 103. N2(g) + O2(g) 2 NO(g) (a) Analysis shows that the concentrations of N2 and O2 are both 0.25 M, and that of NO is 0.0042 M under certain conditions. Is the system at equilibrium? (b) If the system is not at equilibrium, in which direction does the reaction proceed? (c) When the system is at equilibrium, what are the equilibrium concentrations?arrow_forwardThe equilibrium constant, Kc, for the reaction N2O4(g) 2 NO2(g) at 25 C is 5.9 103. Suppose 15.6 g of N2O4 placed in a 5.000-L flask at 25 C. Calculate the following; (a) the amount of NO2 (mol) present at equilibrium; (b) the percentage of the original N2O4 that is dissociated.arrow_forward
- Sulfuryl chloride is used in organic chemistry as a chlorinating agent. At moderately high temperatures it decomposes as follows: SO2Cl2(g)SO2(g)+Cl2(g) with Kc = 0.045 at 650 K. a A sample of 8.25 g of SO2Cl2 is placed in a 1.00-L reaction vessel and heated to 650 K. What are the equilibrium concentrations of all of the species? b What fraction of SO2Cl2 has decomposed? c If 5 g of chlorine is inserted into the reaction vessel, what qualitative effect would this have on the fraction of SO2Cl2 that has decomposed?arrow_forwardGaseous acetic acid molecules have a certain tendency to form dimers. (A dimer is a molecule formed by the association of two identical, simpler molecules.) The equilibrium constant Kc at 25C for this reaction is 3.2 104. a If the initial concentration of CH3COOH monomer (the simpler molecule) is 4.0 104 M, what are the concentrations of monomer and dimer when the system comes to equilibrium? (The simpler quadratic equation is obtained by assuming that all of the acid molecules have dimerized and then some of it dissociates to monomer.) b Why do acetic acid molecules dimerize? What type of structure would you draw for the dimer? c As the temperature increases would you expect the percentage of dimer to increase or decrease? Why?arrow_forwardThe following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?arrow_forward
- Chemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry for Engineering StudentsChemistryISBN:9781337398909Author:Lawrence S. Brown, Tom HolmePublisher:Cengage Learning
- Chemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage Learning