Interpretation:
The equilibrium temperature for the given transition should be calculated.
Concept introduction:
The mathematical expression for the standard entropy value at room temperature is:
Where, n and p represents the coefficients of reactants and products in the balanced chemical equation.
The mathematical expression for the standard enthalpy change value at room temperature is:
Where, n and p represents the coefficients of reactants and products in the balanced chemical equation.
Spontaneity depends upon the temperature and also depends upon the sign of free energy change.
The mathematical expression for
If both
When the magnitude of
Therefore, reaction is non- spontaneous at low temperature and spontaneous at high temperature.
Want to see the full answer?
Check out a sample textbook solutionChapter 16 Solutions
Owlv2, 4 Terms (24 Months) Printed Access Card For Masterton/hurley's Chemistry: Principles And Reactions, 8th
- Consider the Haber process: N2(g)+3H2(g)2NH3(g);H=91.8kJ The density of ammonia at 25C and 1.00 atm is 0.696 g/L. The density of nitrogen, N2, is 1.145 g/L, and the molar heat capacity is 29.12 J/(mol C). (a) How much heat is evolved in the production of 1.00 L of ammonia at 25C and 1.00 atm? (b) What percentage of this heat is required to heat the nitrogen required for this reaction (0.500 L) from 25C to 400C, the temperature at which the Haber process is run?arrow_forwardUsing values of fH and S, calculate the standard molar free energy of formation, fG, for each of the following: (a) Ca(OH)2(s) (b) Cl(g) (c) Na2CO3(s) Compare your calculated values of fG with those listed in Appendix L. Which of these formation reactions are predicted to be product-favored at equilibrium at 25 C?arrow_forwardIs the formation of ozone (O3(g)) from oxygen (O2(g)) spontaneous at room temperature under standard state conditions?arrow_forward
- Thermodynamics provides a way to interpret everyday occurrences. If you live in northern climates, one common experience is that during early winter, snow falls but then melts when it hits the ground. Both the formation and the melting happen spontaneously. How can thermodynamics explain both of these seemingly opposed events?arrow_forwardUse the values of Hf in Appendix 4 to calculate H for the following reactions. (See Exercise 77 .) a. b. SiCl4(l)+2H2O(l)SiO2(s)+4HCl(aq) c. MgO(s)+H2O(l)Mg(OH)2(s)arrow_forwardA green plant synthesizes glucose by photosynthesis, as shown in the reaction: 6CO2(g) + 6H2O(l) C6H12O6(s) + 6O2(g) Animals use glucose as a source of energy: C6H12O6(s) + 6O2(g) 6CO2(g) + 6HO2(l) If we were to assume that both of these processes occur to the same extent in a cyclic process, what thermodynamic property must have a nonzero value?arrow_forward
- From the data given in Appendix I, determine the standard enthalpy change and the standard free energy change for each of the following reactions: (a) BF3(g)+3H2O(l)B(OH)3(s)+3HF(g) (b) BCl3(g)+3H2O(l)B(OH)3+3HCl(g) (c) B2H6(g)+6H2O(l)2B(OH)3(s)+6H2(g)arrow_forwardThe Ostwald process for the commercial production of nitric acid involves three steps: 4NH3(g)+5O2(g)825CPt4NO(g)+6H2O(g)2NO(g)+O2(g)2NO2(g)3NO2(g)+H2O(l)2HNO3(l)+NO(g) a. Calculate H, S,G and K (at 298 K) for each of the three steps in the Ostwald process (see Appendix 4). b. Calculate the equilibrium constant for the first step at 825C, assuming H and S do not depend on temperature. c. Is there a thermodynamic reason for the high temperature in the first step, assuming standard conditions?arrow_forwardThe combustion of methane can be represented as follows: a. Use the information given above to determine the value of H for the combustion of methane to form CO2(g) and 2H2O(l). b. What is Hf for an element in its standard state? Why is this? Use the figure above to support your answer. c. How does H for the reaction CO2(g) + 2H2O (1) CH4(g) + O2(g) compare to that of the combustion of methane? Why is this?arrow_forward
- Chemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage Learning
- Chemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage LearningChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage Learning