(a)
Interpretation: The reason behind the given carboxylic acids cannot be prepared by a malonic ester synthesis has to be explained.
Concept introduction: Malonic ester synthesis is used to prepare carboxylic acids of the desired length. The malonic ester is reacted with an alkoxide base which removes a alpha hydrogen.
The anion so formed is reacted with an
(b)
Interpretation: The reason behind the given carboxylic acids cannot be prepared by a malonic ester synthesis has to be explained.
Concept introduction: Malonic ester synthesis is used to prepare carboxylic acids of the desired length. The malonic ester is reacted with an alkoxide base which removes a alpha hydrogen.
The anion so formed is reacted with an alkyl halide. The anion abstracts the alkyl group from the alkyl halide. On heating, decarboxylation takes place which gives the desired carboxylic acid.
(c)
Interpretation: The reason behind the given carboxylic acids cannot be prepared by a malonic ester synthesis has to be explained.
Concept introduction: Malonic ester synthesis is used to prepare carboxylic acids of the desired length. The malonic ester is reacted with an alkoxide base which removes a alpha hydrogen.
The anion so formed is reacted with an alkyl halide. The anion abstracts the alkyl group from the alkyl halide. On heating, decarboxylation takes place which gives the desired carboxylic acid.
Want to see the full answer?
Check out a sample textbook solutionChapter 17 Solutions
EBK ORGANIC CHEMISTRY
- Identify all carbonyl compounds that can undergo nucleophilic addition reactions from the following:arrow_forwardWhat reactions and reagents can be used to make phenol from benzene if electrophilic aromatic substitution reactions are excluded and benzene is the only source of carbon?arrow_forwardHow to prepare the following compound by the synthesis of malonic acidarrow_forward
- Explain why carboxylic acids do not undergo nucleophilic acyl substitution reactions with amines.arrow_forwardRank the following three carboxylic acids in order of increasing acidity. COOH COOH сон CH,0 O,N A B benzoic acid p-methoxybenzoic acid pnitrobenzoic acidarrow_forwardDescribe how the following compounds could be prepared from cyclohexanone using an enamine intermediate:arrow_forward
- Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l). The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 8.50 gof butanoic acid and excess ethanol? Express your answer in grams to three significant figures.arrow_forwardEthyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.50 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%yield? Express your answer in grams to three significant figures.arrow_forwardEthyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) a) Given 7.70 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100% yield? b) A chemist ran the reaction and obtained 5.25 g of ethyl butyrate. What was the percent yield? c) The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.70 g of butanoic acid and excess ethanol?arrow_forward
- Introduction to General, Organic and BiochemistryChemistryISBN:9781285869759Author:Frederick A. Bettelheim, William H. Brown, Mary K. Campbell, Shawn O. Farrell, Omar TorresPublisher:Cengage Learning