(a)
Interpretation: Standard enthalpy of the reaction and change in standard entropy of the given reaction are to be determined and the temperature at which the change in standard Gibb’s energy is zero, is to be calculated.
Concept introduction: The standard enthalpy of the reaction is calculated by the formula,
The change in standard Gipp’s free energy of the reaction is calculated as,
To determine: Standard enthalpy of the reaction and change in standard entropy of the given reaction.
(a)
Answer to Problem 87CWP
Standard enthalpy of the reaction and change in standard entropy of the given reaction is
Explanation of Solution
Hydrogen gas is produced by reacting graphite with water.
The standard enthalpy of formation of
The standard enthalpy of formation of
The standard enthalpy of formation of
The standard enthalpy of the reaction is calculated by the formula,
Therefore, the above equation becomes,
Substitute the value of
Therefore, the standard enthalpy of the reaction is
The standard entropy of
The standard entropy of
The standard entropy of
The standard entropy of
The standard entropy change of the reaction is calculated by the formula,
Therefore, the above equation becomes,
Substitute the value of
Therefore, the standard entropy change of the reaction is
(b)
Interpretation: Standard enthalpy of the reaction and change in standard entropy of the given reaction are to be determined and the temperature at which the change in standard Gibb’s energy is zero, is to be calculated.
Concept introduction: The standard enthalpy of the reaction is calculated by the formula,
The change in standard Gipp’s free energy of the reaction is calculated as,
To determine: The temperature at which the change in standard Gipp’s energy of the given reaction is zero.
(b)
Answer to Problem 87CWP
The temperature at which the change in standard Gipp’s energy of the given reaction is zero is
Explanation of Solution
Given
The change in standard Gipp’s energy of the given reaction is zero.
Standard enthalpy of the reaction and change in standard entropy of the given reaction is
The change in standard Gipp’s free energy of the reaction is calculated as,
Substitute the value of
Therefore, the temperature at which the change in standard Gipp’s energy of the given reaction is zero is
Want to see more full solutions like this?
Chapter 20 Solutions
CHEMISITRY W/OWL PKG LOOSELEAF
- Cells use the hydrolysis of adenosine triphosphate, abbreviated as ATP, as a source of energy. Symbolically, this reaction can be written as ATP(aq)+H2O(l)ADP(aq)+H2PO4(aq) where ADP represents adenosine diphosphate. For this reaction, G =30.5 kJ/mol. a. Calculate K at 25C. b. If all the free energy from the metabolism of glucose C6H12O6(s)+6O2(g)6CO2(g)+6H2O(l) goes into forming ATP from ADP, how many ATP molecules can be produced for every molecule of glucose?arrow_forwardThe decomposition of diamond to graphite [C(diamond) C(graphite)] is thermodynamically favored, but occurs slowly at room temperature. a. Use fG values from Appendix L to calculate rG and Keq for the reaction under standard conditions and 298.15 K. b. Use fH and S values from Appendix L to estimate rG and Keq for the reaction at 1000 K. Assume that enthalpy and entropy values are valid at these temperatures. Does heating shift the equilibrium toward the formation of diamond or graphite? c. Why is the formation of diamond favored at high pressures? d. The phase diagram shows that diamond is thermodynamically favored over graphite at 20,000 atmospheres pressure (about 2 GPa) at room temperature. Why is this conversion actually done at much higher temperatures and pressures?arrow_forwardFor the reaction NO(g)+NO2(g)N2O3(g) , use tabulated thermodynamic data to calculate H and S. Then use those values to answer the following questions. (a) Is this reaction spontaneous at 25°C? Explain your answer. (b) If the reaction is not spontaneous at 25°C, will it become spontaneous at higher temperatures or lower temperatures? (c) To show that your prediction is accurate, choose a temperature that corresponds to your prediction in part (b) and calculate G . (Assume that both enthalpy and entropy are independent of temperature.)arrow_forward
- What is the third law of thermodynamics? What are standard entropy values, S, and how are these S values (listed in Appendix 4) used to calculate S for a reaction? How would you use Hesss law to calculate S for a reaction? What does the superscript indicate? Predicting the sign of S for a reaction is an important skill to master. For a gas-phase reaction, what do you concentrate on to predict the sign of S? For a phase change, what do you concentrate on to predict the sign of S? That is, how are Ssolid, Sliquid, and Sgas related to one another? When a solute dissolves in water, what is usually the sign of S for this process?arrow_forwardWhat is the standard free energy change, G, for a reaction? What is the standard free energy of formation, Gf for a substance? How are Gf values used to calculate Grxn? How can you use Hesss law to calculate Grxn? How can you use H and S values to calculate Grxn? Of the functions H, S, and G, which depends most strongly on temperature? When G is calculated at temperatures other than 25Cwhat assumptions are generally made concerning H and S?arrow_forwardYeast can produce ethanol by the fermentation of glucose (C6H12O6), which is the basis for the production of most alcoholic beverages. C6H12O6(aq) 2 C2H5OH() + 2 CO2(g) Calculate rH, rS, and rG for the reaction at 25 C. Is the reaction product- or reactant-favored at equilibrium? In addition to the thermodynamic values in Appendix L, you will need the following data for C6H12O6(aq): fH = 1260.0 kl/mol; S = 289 J/K mol; and fG = 918.8 kl/mol.arrow_forward
- Consider the reaction of 1 mol H2(g) at 25C and 1 atm with 1 mol Br2(l) at the same temperature and pressure to produce gaseous HBr at these conditions. If this reaction is run in a controlled way to generate work, what is the maximum useful work that can be obtained? How much entropy is produced in this case?arrow_forwardThe combustion of acetylene, C2H2, is a spontaneous reaction given by the equation 2C2H2(g)+5O2(g)4CO2(g)+2H2O(l) As expected for a combustion, the reaction is exothermic. What is the sign of H? What do you expect for the sign of S? Explain the spontaneity of the reaction in terms of the enthalpy and entropy changes.arrow_forwardThe molecular scale pictures below show snapshots of a strong acid at three different instants after it is added to water. Place the three pictures in the correct order so that they show the progress of the spontaneous process that takes place as the acid dissolves in the water. Explain your answer in terms of entropyarrow_forward
- Solid NH4NO3 is placed in a beaker containing water at 25 C. When the solid has completely dissolved, the temperature of the solution is 23.5 C. (a) Was the process exothermic or endothermic? (b) Was the process spontaneous? (c) Did the entropy of the system increase? (d) Did the entropy of the universe increase?arrow_forwardWhich of the following processes are spontaneous? a. A house is built. b. A satellite is launched into orbit. c. A satellite falls back to the earth. d. The kitchen gets cluttered.arrow_forwardUsing values of fH and S, calculate the standard molar free energy of formation, fG, for each of the following compounds: (a) CS2(g) (b) NaOH(s) (c) ICl(g) Compare your calculated values of fG with those listed in Appendix L Which of these formation reactions are predicted to be product-favored at equilibrium at 25 C?arrow_forward
- ChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning
- Chemistry for Engineering StudentsChemistryISBN:9781337398909Author:Lawrence S. Brown, Tom HolmePublisher:Cengage LearningChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage Learning