Describe in words how you would do each of the following preparations. Then give the molecular equation for each preparation.
- a CuCl2(s) from CuSO4(s)
- b Ca(C2H3O2)2(s) from CaCO3(s)
- c NaNO3(s) from Na2SO3(s)
- d MgCl2(s) from Mg(OH)2(s)
(a)
Interpretation:
Preparations of each of the given compound has to be explained and the molecular equations for each reaction has to be found.
Concept introduction:
A chemical equation is the figurative representation of chemical reaction. In a chemical equation the reactants are in the left side and the products are in the right side. A balanced chemical equation serves as an easy tool for understanding a chemical reaction. There are mainly three types of chemical equations, molecular equations, complete ionic equation and net ionic equation.
In molecular equations the reactants and products are represented as molecular substances, even though they exist as ions in solution phase. The molecular equation for the reaction between
This equation is helpful in understanding the reactants and products involved in the reaction.
In complete ionic equations the electrolytes are represented as its ions. Soluble compounds exist as ions in solution. Complete ionic equation is helpful in understanding the reaction at ionic level. The complete ionic equation for the reaction between
The solid
In net ionic equations the ions that are common in the reactant and product sides( Spectator ions) are cancelled. These spectator ions are not participating in the chemical reactions. The net ionic equation for the reaction between
Answer to Problem 4.103QP
The molecular equation
Explanation of Solution
In order to prepare
The molecular equation for the reaction is given below.
(b)
Interpretation:
Preparations of each of the given compound has to be explained and the molecular equations for each reaction has to be found.
Concept introduction:
A chemical equation is the figurative representation of chemical reaction. In a chemical equation the reactants are in the left side and the products are in the right side. A balanced chemical equation serves as an easy tool for understanding a chemical reaction. There are mainly three types of chemical equations, molecular equations, complete ionic equation and net ionic equation.
In molecular equations the reactants and products are represented as molecular substances, even though they exist as ions in solution phase. The molecular equation for the reaction between
This equation is helpful in understanding the reactants and products involved in the reaction.
In complete ionic equations the electrolytes are represented as its ions. Soluble compounds exist as ions in solution. Complete ionic equation is helpful in understanding the reaction at ionic level. The complete ionic equation for the reaction between
The solid
In net ionic equations the ions that are common in the reactant and product sides( Spectator ions) are cancelled. These spectator ions are not participating in the chemical reactions. The net ionic equation for the reaction between
Answer to Problem 4.103QP
The molecular equation
Explanation of Solution
In order to prepare calcium acetate
The molecular equation for the reaction is given below.
(c)
Interpretation:
Preparations of each of the given compound has to be explained and the molecular equations for each reaction has to be found.
Concept introduction:
A chemical equation is the figurative representation of chemical reaction. In a chemical equation the reactants are in the left side and the products are in the right side. A balanced chemical equation serves as an easy tool for understanding a chemical reaction. There are mainly three types of chemical equations, molecular equations, complete ionic equation and net ionic equation.
In molecular equations the reactants and products are represented as molecular substances, even though they exist as ions in solution phase. The molecular equation for the reaction between
This equation is helpful in understanding the reactants and products involved in the reaction.
In complete ionic equations the electrolytes are represented as its ions. Soluble compounds exist as ions in solution. Complete ionic equation is helpful in understanding the reaction at ionic level. The complete ionic equation for the reaction between
The solid
In net ionic equations the ions that are common in the reactant and product sides( Spectator ions) are cancelled. These spectator ions are not participating in the chemical reactions. The net ionic equation for the reaction between
Answer to Problem 4.103QP
The molecular equation
Explanation of Solution
In order to prepare
The molecular equation for the reaction is given below.
(d)
Interpretation:
Preparations of each of the given compound has to be explained and the molecular equations for each reaction has to be found.
Concept introduction:
A chemical equation is the figurative representation of chemical reaction. In a chemical equation the reactants are in the left side and the products are in the right side. A balanced chemical equation serves as an easy tool for understanding a chemical reaction. There are mainly three types of chemical equations, molecular equations, complete ionic equation and net ionic equation.
In molecular equations the reactants and products are represented as molecular substances, even though they exist as ions in solution phase. The molecular equation for the reaction between
This equation is helpful in understanding the reactants and products involved in the reaction.
In complete ionic equations the electrolytes are represented as its ions. Soluble compounds exist as ions in solution. Complete ionic equation is helpful in understanding the reaction at ionic level. The complete ionic equation for the reaction between
The solid
In net ionic equations the ions that are common in the reactant and product sides( Spectator ions) are cancelled. These spectator ions are not participating in the chemical reactions. The net ionic equation for the reaction between
Answer to Problem 4.103QP
The molecular equation
Explanation of Solution
In order to prepare
The molecular equation for the reaction is given below.
Want to see more full solutions like this?
Chapter 4 Solutions
Student Solutions Manual for Ebbing/Gammon's General Chemistry, 11th
Additional Science Textbook Solutions
Chemistry: Matter and Change
Chemistry: An Introduction to General, Organic, and Biological Chemistry (13th Edition)
Thermodynamics, Statistical Thermodynamics, & Kinetics
Introductory Chemistry (6th Edition)
General Chemistry: Atoms First
- Twenty-five mL of a 0.388 M solution of Na2SO4 is mixed with 35.3 mL of 0.229 M Na2SO4. What is the molarity of the resulting solution? Assume that the volumes are additive.arrow_forwardWrite a balanced equation for the reaction of hydroiodic acid, HI, with calcium hydroxide, Ca(OH)2. Then, write the balanced complete ionic equation and the net ionic equation for this neutralization reaction.arrow_forwardDisulfur dichloride, S2Cl2, is used to vulcanize rubber. It can be made by treating molten sulfur with gaseous chlorine. S8() + 4 Cl2(g) 4 S2Cl2(g) Complete this table of reaction quantities for the production of 103.5 g S2Cl2.arrow_forward
- Balance each of the following equations, and then write the net ionic equation. Show states for all reactants and products (s, . g, aq). (a) the reaction of sodium hydroxide and iron(II) chloride to give iron(II) hydroxide and sodium chloride (b) the reaction of barium chloride with sodium carbonate to give barium carbonate and sodium chloride (c) the reaction of ammonia with phosphoric acidarrow_forwardIn a common experiment in the general chemistry laboratory, magnesium metal is heated in air to produce MgO. MgO is a white solid, but in these experiments it often looks gray, due to small amounts of Mg3N2, a compound formed as some of the magnesium reacts with nitrogen. Write a balanced equation for each reaction.arrow_forwardWhat is the molarity of a solution of strontium chloride that is prepared by dissolving 4.11 g SrCl2 in enough water to form 1.00-L solution? What is the molarity of each ion in the solution?arrow_forward
- 3.14 A number of compounds are used in cement, and reactions among them occur when water is added. In one, CaO reacts with Al2O3 and water to form Ca3Al2(OH)12. Write a bal- anced chemical equation for this process.arrow_forwardVitamin C, ascorbic acid (C6HgO6)(molar mass 176.1 g/mol), is a reducing agent. One way to determine the ascorbic acid content of a sample is to mix the acid with an excess of iodine, C6HgO6(aq) + I2(aq) + H2O(l) C6HgO6(aq) + 2 H3O+(aq) + 2 I(aq) and then titrate the iodine that did not react with the ascorbic acid with sodium thiosulfate. The balanced, net ionic equation for the reaction occurring in this titration is I2(aq) + 2 S2O32(aq)2 I(aq) + S4O62(aq) Suppose 50.00 mL of 0.0520 M I2 was added to the sample containing ascorbic acid. After the ascorbic acid/I2, reaction was complete, the I2 not used in this reaction required 20.30 mL of 0.196 M Na2S2O3 for titration to the equivalence point. Calculate the mass of ascorbic acid in the unknown sample.arrow_forward(a) Butane gas, C4H10, can burn completely in air [use O2(g) as the other reactant] to give carbon dioxide gas and water vapor. Write a balanced equation for this combustion reaction. (b) Write a balanced chemical equation for the complete combustion of C3H7BO3, a gasoline additive. The products of combustion are CO2(g), H2O(g), and B2O3(s).arrow_forward
- Iron oxide ores, commonly a mixture of FeO and Fe2O3, are given the general formula Fe3O4. They yield elemental iron when heated to a very high temperature with either carbon monoxide or elemental hydrogen. Balance the following equations for these processes: Fe3O4(s)+H2(g)Fe(s)+H2O(g)Fe3O4(s)+CO(g)Fe(s)+CO2(g)arrow_forwardOne of the ways to remove nitrogen monoxide gas, a serious source of air pollution, from smokestack emissions is by reaction with ammonia gas, NH3. The products of the reaction, N2 and H2O, are not toxic. Write the balanced equation for this reaction. Assign an oxidation number to each element in the reactants and products, and indicate which element is oxidized and which is reduced.arrow_forwardOne of relatively few reactions that takes place directly between two solids at room temperature is Ba(OH)2+8H2O(s)+NH4SCN(s)Ba(SCN)2(s)+H2O(l)+NH3(g) In this equation, the 8H2O in Ba(OH)2 8H2O indicates the presence of eight water molecules. This compound is called barium hydroxide octahydrate. a. Balance the equation. b. What mass of ammonium thiocyanate (NH4SCN) must be used if it is to react completely with 6.5 g barium hydroxide octahydrate?arrow_forward
- Chemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningChemistry for Engineering StudentsChemistryISBN:9781337398909Author:Lawrence S. Brown, Tom HolmePublisher:Cengage Learning
- Chemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage Learning