Concept explainers
4.29 When Al(OH)3 reacts with sulfuric acid, the following reaction occurs:
If
Interpretation:
Mass of aluminium sulfate that can be formed should be determined.
Concept introduction:
- The maximum yield is obtained by reacting all the limiting reactant
Given:
Answer to Problem 4.29PAE
Solution:
Explanation of Solution
Use the given amounts to identify the limiting reactant. Then calculate the total amount of possible iron yield.
Step 1: Balance Reaction
Reaction is already balanced
Step 2: Change all mass units to mol units
Step 3: Relate stoichiometry
Step 4: Actual Ratio
Since ratio is smaller than the required, the limiting reactant is sulfuric acid.
Step 4: Calculate Yield
The maximum amount of product is always equal to the yield of the limiting reactant
Want to see more full solutions like this?
Chapter 4 Solutions
CHEM FOR ENG >I<>CUSTOM<
- 4.84 Aluminum chloride (AlCl3) is used as a catalyst in the production of polyisobutylene, which is used in automobile tires. Scrap aluminum metal reacts with chlorine gas (Cl2) to produce AlCl3. Suppose that 2.70 g of Al and 7.10 g of Cl2 are mixed. What is the maximum mass of AlCl3 that could be formed?arrow_forwardCopper metal reacts with mine acid. Assume that the reaction is 3Cu(s)+8HNO3(aq)3Cu(NO3)2(aq)+2NO(g)+4H2O(l) If 5.58 g Cu(NO3)2 is eventually obtained, how many grams of nitrogen monoxide, NO, would have formed?arrow_forwardCalcium carbide, CaC2, used to produce acetylene, C2H2, is prepared by heating calcium oxide, CaO, and carbon, C, to high temperature. CaO(s)+3C(s)CaC2(s)+CO(g) If a mixture contains 8.49 kg of each reactant, how many grams of calcium carbide can be prepared?arrow_forward
- Nitrobenzene, C6H5NO2, an important raw material for the dye industry, is prepared from benzene, C6H6, and nitric acid, HNO3. C6H6(l)+HNO3(l)C6H5NO2(l)+H2O(l) When 21.6 g of benzene and an excess of HNO3 are used, what is the theoretical yield of nitrobenzene? If 30.0 g of nitrobenzene is recovered, what is the percentage yield?arrow_forwardMethyl salicylate (oil of wintergreen) is prepared by heating salicylic acid, C7H6O3, with methanol, CH3OH. C7H6O3+CH3OHC8H8O3+H2O In an experiment, 2.50 g of salicylic acid is reacted with 10.31 g of methanol. The yield of methyl salicylate, C8H8O3, is 1.27 g. What is the percentage yield?arrow_forward4.12 In petroleum refining, hydrocarbons are often manipulated by reacting them with H2(g). If hexene, C6H12, is reacted with hydrogen to form hexane, C6H14, how many moles of hydrogen are needed to react with 453 moles of hexene?arrow_forward
- Zinc acetate is sometimes prescribed by physicians for the treatment of Wilsons disease, which is a genetically caused condition wherein copper accumulates to toxic levels in the body. If you were to analyze a sample of zinc acetate and find that it contains 3.33 1023 acetate ions, how many grams of zinc acetate must be present in the sample?arrow_forwardBacterial digestion is an economical method of sewage treatment. The reaction is an intermediate step in the conversion of the nitrogen in organic compounds into nitrate ions. What mass of bacterial tissue is produced in a treatment plant for every 1.0 104 kg of wastewater containing 3.0% NH4+ ions by mass? Assume that 95% of the ammonium ions are consumed by the bacteria.arrow_forward3.111 The chlorophyll molecule responsible for photosynthesis in plants contains 2.72% Mg by mass. There is only one Mg atom per chlorophyll molecule. How can you determine the molar mass of chlorophyll based on this information?arrow_forward
- When dinitrogen pentoxide, N2O5, a white solid, is heated, it decomposes to nitrogen dioxide and oxygen. 2N2O5(s)4NO2(g)+O2(g) If a sample of N2O5 produces 1.381 g O2, how many grams of NO2 are formed?arrow_forwardThe reaction of methane and water is one way to prepare hydrogen for use as a fuel: CH4(g) + H2O(g) CO(g) + 3 H2(g) If you begin with 995 g of CH4 and 2510 g of water, (a) Which reactant is the limiting reactant? (b) What is the maximum mass of H2 that can be prepared? (c) What mass of the excess reactant remains when the reaction is completed?arrow_forwardPenicillin V was treated chemically to convert sulfur to barium sulfate, BaSO4. An 8.19-mg sample of penicillin V gave 5.46 mg BaSO4. What is the percentage of sulfur in penicillin V? If there is one sulfur atom in the molecule, what is the molecular weight?arrow_forward
- ChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning
- General Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry for Engineering StudentsChemistryISBN:9781337398909Author:Lawrence S. Brown, Tom HolmePublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage Learning