Concept explainers
Interpretation:
The standard enthalpy of formation of benzene and acetylene, and hence, the enthalpy change for the formation of benzene from acetylene are to be calculated.
Concept introduction:
The standard enthalpy for a reaction is the amount of enthalpy that occursunderstandard conditions
The standard enthalpy of a reaction is determined by using the equation given below:
Here, the
The value of the enthalpy of formation of an element is zero at its most stable state.
Answer to Problem 102AP
Solution:
Explanation of Solution
Given information:
The given reaction is as follows:
The reaction for the combustion of acetylene isas follows:
The reaction for the combustion of benzene isas follows:
From appendix 2,
The oxygen gas is in its most stable form, so its enthalpy of formation is zero.
Calculate the standard enthalpy for the combustion of acetylene as follows:
Substitute
Rearrange the above equation for
Calculate the standard enthalpy for thecombustion of benzene as follows:
Substitute
Rearrange the above equation for
Calculate the enthalpy of the reaction for the formation of benzene from acetylene as follows:
Substitute
Theenthalpy change for theformation of benzene from acetylene is
Want to see more full solutions like this?
Chapter 5 Solutions
Connect 2-Year Access Card for Chemistry
- Another reaction that is used to propel rockets is N2O4(l)+2N2H4(l)3N2(g)+4H2O(g) This reaction has the advantage that neither product is toxic, so no dangerous pollution is released. When the reaction consumes 10.0 g liquid N2O4, it releases 124 kJ of heat. (a) Is the sign of the enthalpy change positive or negative? (b) What is the value of H for the chemical equation if it is understood to be written in molar quantities?arrow_forwardMethanol (CH3OH) has also been proposed as an alternative fuel. Calculate the standard enthalpy of combustion per gram of liquid methanol, and compare this answer to that for ethanol in Exercise 87.arrow_forwardEthylene glycol, HOCH2CH2OH, is used as antifreeze. It is produced from ethylene oxide, C2H4O, by the reaction C2H4O(g)+H2O(l)HOCH2CH2OH(l) Use Hesss law to obtain the enthalpy change for this reaction from the following enthalpy changes: 2C2H4O(g)+5O2(g)4CO2(g)+4H2O(l);H=2612.2kJHOCH2CH2OH(l)+52O2(g)2CO2(g)+3H2O(l);H=1189.8kJarrow_forward
- White phosphorus, P4, ignites in air to produce P4O10. When 3.56 g P4 is burned, 85.8 kJ of thermal energy is evolved at constant pressure. Calculate the combustion enthalpy of P4.arrow_forwardA piece of titanium metal with a mass of 20.8 g is heated in boiling water to 99.5 C and then dropped into a coffee-cup calorimeter containing 75.0 g of water at 21.7 C. When thermal equilibrium is reached, the final temperature is 24.3 C. Calculate the specific heat capacity of titanium.arrow_forwardThe combustion of ethane, C2H6, has an enthalpy change of 2857.3 kJ for the reaction as written below. Calculate H for the combustion of 15.0 g of C2H6. 2 C2H6(g) + 7 O2(g) 4 CO2(g) + 6 H2O(g) rH=2857.3kJ/mol-rxnarrow_forward
- The head of a strike anywhere match contains tetraphosphorus trisulfide, P4S3. In an experiment, a student burned this compound in an excess of oxygen and found that it evolved 3651 kJ of heat per mole of P4S3 at a constant pressure of 1 atm. She wrote the following thermochemical equation: P4S3(s)+8O2(g)P4O10(s)+3SO2(g);H=3651kJ Calculate the standard enthalpy of formation of P4S3, using this students result and the following standard enthalpies of formation: P4O10(s), 3009.9 kJ/mol; SO2(g), 296.8 kJ/mol. How does this value compare with the value given in Appendix C?arrow_forwardChloroform, CHCl3, is formed from methane and chlorine in the following reaction. CH4(g) + 3 Cl2(g) 3 HCl(g) + CHCl3(g) Calculate rH, the enthalpy change for this reaction, using the enthalpies of formation of CO2(g), H2O(), CHCI3(g) (fH = 103.1 kJ/mol), and the enthalpy changes for the following reactions: CH4(g) + 2 O2(g) 2 H2O() + CO2(g) rH = 890.4 kJ/mol-rxn 2 HCl(g) H2(g) + Cl2(g) rH = +184.6 kJ/mol-ransarrow_forwardHydrogen sulfide, H2S, is a poisonous gas with the odor of rotten eggs. The reaction for the formation of H2S from the elements is H2(g)+18S3(rhombic)H2S(g) Use Hesss law to obtain the enthalpy change for this reaction from the following enthalpy changes: H2S(g)+32O2(g)H2O(g)+SO2(g);H=518kJH2(g)+12O2(g)H2O(g);H=242kJ18S8(rhombic)+O2(g)SO2(g);H=297kJarrow_forward
- Calculate the standard enthalpy of combustion for benzene, C6H6. C6H6() + 15/2 O2(g) 6 CO2(g) + 3 H2O() rH = ? The enthalpy of formation of benzene is known [rH[C6H6()] = +49.0 kJ/mol], and other values needed can be found in Appendix L.arrow_forwardA sample of benzene, C6H6, weighing 3.51 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 37.18C. If the heat capacity of the calorimeter and contents was 12.05 kJ/C, what is the value of q for burning 1.00 mol of benzene at constant volume and 25.00C? The reaction is C6H6(l)+152O2(g)6CO2(g)+3H2O(l) Is q equal to U or H?arrow_forwardThe standard molar enthalpy of formation of diborane, B2H6(g), cannot be determined directly because the compound cannot be prepared by the reaction of boron and hydrogen. It can be calculated from other enthalpy changes, however. The following enthalpy changes can be measured. 4 B(s) + 3 O2(g) 2 B2O3(s) rH = 2543.8 kJ/mol-rxn H2(g) + O2(g) H2O(g) rH = 241.8 kl/mol-rxn B2H6(g) + 3 O2(g) B2O3(s) + 3 H2O(g) rH = 2032.9 kJ/mol-rxn (a) Show how these equations can be added together to give the equation for the formation of B2H6(g) from B(s) and H2(g) in their standard states. Assign enthalpy changes to each reaction. (b) Calculate fH for B2H6(g). (c) Draw an energy level diagram that shows how the various enthalpies in this problem are related. (d) Is the formation of B2H6(g) from its elements exo- or endothermic?arrow_forward
- Chemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning
- ChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage Learning