Concept explainers
The so-called hydrogen economy is based on hydrogen produced from water using solar energy. The gas is then burned as a fuel:
A primary advantage of hydrogen as a fuel is that it is nonpolluting, A major disadvantage is that it is a gas and therefore is harder to store than liquids. Calculate the number of moles of
Want to see the full answer?
Check out a sample textbook solutionChapter 5 Solutions
ALEKS 360-ACCESS (18 WEEKS)
Additional Science Textbook Solutions
Organic Chemistry
Chemistry & Chemical Reactivity
General Chemistry: Atoms First
Chemistry & Chemical Reactivity
Organic Chemistry
Chemistry: The Molecular Nature of Matter
- The first step in the preparation of lead from its ore (galena, PbS) consists of roasting the ore. PbS(s)+32O2(g)SO2(g)+PbO(s) Calculate the standard enthalpy change for this reaction, using enthalpies of formation (see Appendix C).arrow_forwardThe Romans used calcium oxide, CaO, to produce a strong mortar to build stone structures. Calcium oxide was mixed with water to give Ca(OH)2, which reacted slowly with CO2 in the air to give CaCO3. Ca(OH)2(s) + CO2(g) CaCO3(s) + H2O(g) (a) Calculate the standard enthalpy change for this reaction. (b) How much energy is evolved or absorbed as heat if 1.00 kg of Ca(OH)2 reacts with a stoichiometric amount of CO2?arrow_forwardThe enthalpy change for the following reaction is 393.5 kJ. C(s,graphite)+O2(g)CO2(g) (a) Is energy released from or absorbed by the system in this reaction? (b) What quantities of reactants and products are assumed? (c) Predict the enthalpy change observed when 3.00 g carbon burns in an excess of oxygen.arrow_forward
- Niagara Falls has a height of 167 ft (American Falls). What is the potential energy in joules of 1.00 lb of water at the top of the falls if we take water at the bottom to have a potential energy of zero? What would be the speed of this water at the bottom of the falls if we neglect friction during the descent of the water?arrow_forwardIs the following reaction the appropriate one to use in determining the enthalpy of formation of methane, CH4(g)? Why or why not? C(g)+4H(g)CH4(g)arrow_forwardCompounds with carboncarbon double bonds, such as ethylene, C2H4, add hydrogen in a reaction called hydrogenation. C2H4(g)+H2(g)C2H6(g) Calculate the enthalpy change for this reaction, using the following combustion data: C2H4(g)+3O2(g)2CO2(g)+2H2O(l);H=1411kJC2H6(g)+72O2(g)2CO2(g)+3H2O(l);H=1560kJH2(g)+12O2(g)H2O(l);H=286kJarrow_forward
- High-quality audio amplifiers generate large amounts of heat. To dissipate the heat and prevent damage to the electronic components, heat-radiating metal fins are used. Would it be better to make these fins out of iron or aluminum? Why? (See Table 7- l for specific heat capacities.)arrow_forwardHydrogen sulfide gas is a poisonous gas with the odor of rotten eggs. It occurs in natural gas and is produced during the decay of organic matter, which contains sulfur. The gas burns in oxygen as follows: 2H2S(g)+3O2(g)2H2O(l)+2SO2(g) Calculate the standard enthalpy change for this reaction using standard enthalpies of formation.arrow_forward9.41 Under what conditions does the enthalpy change equal the heat of a process?arrow_forward
- General Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage Learning
- Chemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning