Interpretation:
The energy change in the given reaction under the given conditions is to be calculated.
Concept Introduction:
Sign of heat is positive, if heat is absorbed by the system, and negative if heat is released by the system.
Sign of work done is negative, if work is done by the system, and positive if work is done on the system.
The work done is calculated by the formula as:
Here,
The conversion of work done from
The energy change of the system is calculated by the formula as:
Here,
Want to see the full answer?
Check out a sample textbook solutionChapter 5 Solutions
CHEMISTRY >CUSTOM<
- Gasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.arrow_forwardIs the following reaction the appropriate one to use in determining the enthalpy of formation of methane, CH4(g)? Why or why not? C(g)+4H(g)CH4(g)arrow_forwardThe Romans used calcium oxide, CaO, to produce a strong mortar to build stone structures. Calcium oxide was mixed with water to give Ca(OH)2, which reacted slowly with CO2 in the air to give CaCO3. Ca(OH)2(s) + CO2(g) CaCO3(s) + H2O(g) (a) Calculate the standard enthalpy change for this reaction. (b) How much energy is evolved or absorbed as heat if 1.00 kg of Ca(OH)2 reacts with a stoichiometric amount of CO2?arrow_forward
- White phosphorus, P4, ignites in air to produce P4O10. When 3.56 g P4 is burned, 85.8 kJ of thermal energy is evolved at constant pressure. Calculate the combustion enthalpy of P4.arrow_forwardNitrogen gas (2.75 L) is confined in a cylinder under constant atmospheric pressure (1.01 105 pascals). The volume of gas decreases to 2.10 L when 485 J of energy is transferred as heat to the surroundings. What is the change in internal energy of the gas?arrow_forwardAnother reaction that is used to propel rockets is N2O4(l)+2N2H4(l)3N2(g)+4H2O(g) This reaction has the advantage that neither product is toxic, so no dangerous pollution is released. When the reaction consumes 10.0 g liquid N2O4, it releases 124 kJ of heat. (a) Is the sign of the enthalpy change positive or negative? (b) What is the value of H for the chemical equation if it is understood to be written in molar quantities?arrow_forward
- As the gas trapped in a cylinder with a movable piston cools, 1.34 kJ of work is done on the gas by the surroundings. If the gas is at a constant pressure of 1.33 105 Pa, what is the change of volume (in L) of the gas?arrow_forwardWhen solid iron burns in oxygen gas (at constant pressure) to produce Fe2O3(s), 1651 kJ of heat is released for every 4 mol of iron burned. How much heat is released when 10.3 g Fe2O3(s) is produced (at constant pressure)? What additional information would you need to calculate the heat released to produce this much Fe2O3(s) if you burned iron in ozone gas, O3(g), instead of O2(g)?arrow_forwardThe head of a strike anywhere match contains tetraphosphorus trisulfide, P4S3. In an experiment, a student burned this compound in an excess of oxygen and found that it evolved 3651 kJ of heat per mole of P4S3 at a constant pressure of 1 atm. She wrote the following thermochemical equation: P4S3(s)+8O2(g)P4O10(s)+3SO2(g);H=3651kJ Calculate the standard enthalpy of formation of P4S3, using this students result and the following standard enthalpies of formation: P4O10(s), 3009.9 kJ/mol; SO2(g), 296.8 kJ/mol. How does this value compare with the value given in Appendix C?arrow_forward
- The enthalpy change for the following reaction is 393.5 kJ. C(s,graphite)+O2(g)CO2(g) (a) Is energy released from or absorbed by the system in this reaction? (b) What quantities of reactants and products are assumed? (c) Predict the enthalpy change observed when 3.00 g carbon burns in an excess of oxygen.arrow_forwardThe decomposition of ozone, O3, to oxygen, O2, is an exothermic reaction. What is the sign of q? If you were to touch a flask in which ozone is decomposing to oxygen, would you expect the flask to feel warm or cool?arrow_forwardUnder what circumstances is the heat of a process equal to the enthalpy change for the process?arrow_forward
- General Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage Learning
- Chemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage Learning