Concept explainers
Interpretation:
The enthalpy change for the given reaction is to be calculated with the help of thermochemical data.
Concept introduction:
Hess’s Law states that the change in enthalpy for a
The enthalpy change for a reaction is a state function. It depends upon the initial and final states of the system and not on the path followed.
If any reaction is reversed, then the sign of enthalpy change will also reverse. If enthalpy change is positive, then it will become negative and vice versa.
If any reaction is multiplied or divided any number, then its enthalpy change is also multiply and divides by the same number.
Want to see the full answer?
Check out a sample textbook solutionChapter 5 Solutions
CHEMISTRY(LOOSELEAF W/CODE)- CUSTOM
- Hydrogen peroxide, H2O2, is a colorless liquid whose solutions are used as a bleach and an antiseptic. H2O2 can be prepared in a process whose overall change is H2(g)+O2(g)H2O2(l) Calculate the enthalpy change using the following data: H2O2(l)H2O(l)+12O2(g);H=98.0kJ2H2(g)+O2(g)2H2O(l);H=571.6kJarrow_forwardIs the following reaction the appropriate one to use in determining the enthalpy of formation of methane, CH4(g)? Why or why not? C(g)+4H(g)CH4(g)arrow_forward9.74 Without looking up any numerical data or doing calculations, predict whether the following enthalpy changes should he positive, negative, or zero. (a) Hf for H2(g) (b) Hf for O(g) (c) Hfusion for H2O (d) Hcombusion for C3H8(g)arrow_forward
- Given the following (hypothetical) thermochemical equations: A+B2C;H=447kJA+3D2E;H=484kJ2D+B2F;H=429kJ Calculate H, in kJ, for the equation 4E+5B4C+6Farrow_forwardA 10.00-g sample of acetic acid, HC2H3O2, was burned in a bomb calorimeter in an excess of oxygen. HC2H3O2(l)+2O2(g)2CO2(g)+2H2O(l) The temperature of the calorimeter rose from 25.00C to 35.84C. If the heat capacity of the calorimeter and its contents is 13.43 kJ/C, what is the enthalpy change for the reaction?arrow_forwardThe process of dissolving ammonium nitrate, NH4NO3, in water is an endothermic process. What is the sign of q? If you were to add some ammonium nitrate to water in a flask, would you expect the flask to feel warm or cool?arrow_forward
- The head of a strike anywhere match contains tetraphosphorus trisulfide, P4S3. In an experiment, a student burned this compound in an excess of oxygen and found that it evolved 3651 kJ of heat per mole of P4S3 at a constant pressure of 1 atm. She wrote the following thermochemical equation: P4S3(s)+8O2(g)P4O10(s)+3SO2(g);H=3651kJ Calculate the standard enthalpy of formation of P4S3, using this students result and the following standard enthalpies of formation: P4O10(s), 3009.9 kJ/mol; SO2(g), 296.8 kJ/mol. How does this value compare with the value given in Appendix C?arrow_forwardColorless nitric oxide, NO, combines with oxygen to form nitrogen dioxide, NO2, a brown gas. 2NO(g)+O2(g)2NO2(g);H=114kJ What is the enthalpy change per gram of nitric oxide?arrow_forwardNitrogen gas is confined in a cylinder with a movable piston under a constant pressure of 9.95 104 Pa. When 695 J of energy in the form of heat is transferred from the gas to the surroundings, its volume decreases by 1.88 L. What is the change in internal energy of the gas?arrow_forward
- Give the definition of the standard enthalpy of formation for a substance. Write separate reactions for the formation of NaCl, H2O , C6H12O6, and PbSO4 that have H values equal to Hf for each compound.arrow_forwardWhich of the following substances have an enthalpy of formation equal to zero? a. Cl2(g) b. H2(g) c. N2(l) d. Cl(g)arrow_forwardA sample of ethanol, C2H5OH, weighing 2.84 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 33.73C. If the heat capacity of the calorimeter and contents was 9.63 kJ/C, what is the value of q for burning 1.00 mol of ethanol at constant volume and 25.00C? The reaction is C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) Is q equal to U or H?arrow_forward
- Chemistry for Engineering StudentsChemistryISBN:9781337398909Author:Lawrence S. Brown, Tom HolmePublisher:Cengage LearningGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage Learning
- Chemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry by OpenStax (2015-05-04)ChemistryISBN:9781938168390Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark BlaserPublisher:OpenStax