Concept explainers
Use standard enthalpies of formation in Appendix L to calculate enthalpy changes for the following:
(a) 0.054 g of sulfur burns, forming SO2(g)
(b) 0.20 mol of HgO(s) decomposes to Hg(ℓ) and O2(g)
(c) 2.40 g of NH3(g) is formed from N2(g) and excess H2(g)
(d) 1.05 × 10–2 mol of carbon is oxidized to CO2(g)
(a)
Interpretation:
The enthalpy change for the formation the following reaction has to be determined.
Concept Introduction:
If a reaction proceeds in two or more other reaction,
The change in enthalpy,
Answer to Problem 58PS
The enthalpy change for the formation is
Explanation of Solution
Given mass is
The enthalpy of formation is
The change in enthalpy,
So, the enthalpy change for the formation is
(b)
Interpretation:
The enthalpy change for the formation the following reaction has to be determined.
Concept Introduction:
If a reaction proceeds in two or more other reaction,
Answer to Problem 58PS
The enthalpy change for the formation is
Explanation of Solution
Given mass is
The enthalpy of formation is
The change in enthalpy,
So, the change in enthalpy is
(c)
Interpretation:
The enthalpy change for the formation the following reaction has to be determined.
Concept Introduction:
If a reaction proceeds in two or more other reaction,
Answer to Problem 58PS
The change in enthalpy is
Explanation of Solution
Given mass is
The enthalpy of formation is
The change in enthalpy,
Energy change =
So, the change in enthalpy is
(d)
Interpretation:
The enthalpy change for the formation the following reaction has to be determined.
Concept Introduction:
If a reaction proceeds in two or more other reaction,
Answer to Problem 58PS
The change in enthalpy is
Explanation of Solution
Given mass is
The enthalpy of formation is
The change in enthalpy,
Energy change =
So, the change in enthalpy is
Want to see more full solutions like this?
Chapter 5 Solutions
Bundle: Chemistry & Chemical Reactivity, 9th + OWLv2 6-Months Printed Access Card
- When 2.50 g of methane burns in oxygen, 125 kJ of heat is produced. What is the enthalpy of combustion per mole of methane under these conditions?arrow_forwardGive the definition of the standard enthalpy of formation for a substance. Write separate reactions for the formation of NaCl, H2O , C6H12O6, and PbSO4 that have H values equal to Hf for each compound.arrow_forwardCalcium oxide, CaO, is prepared by heating calcium carbonate (from limestone and seashells). CaCO3(s)CaO(s)+CO2(g) Calculate the standard enthalpy of reaction, using enthalpies of formation. The Hf of CaO(s) is 635 kJ/mol. Other values are given in Table 6.2.arrow_forward
- Another reaction that is used to propel rockets is N2O4(l)+2N2H4(l)3N2(g)+4H2O(g) This reaction has the advantage that neither product is toxic, so no dangerous pollution is released. When the reaction consumes 10.0 g liquid N2O4, it releases 124 kJ of heat. (a) Is the sign of the enthalpy change positive or negative? (b) What is the value of H for the chemical equation if it is understood to be written in molar quantities?arrow_forwardWhat is the difference between the enthalpy of reaction and the enthalpy of formation? For what chemical reaction(s) are the two quantities the same?arrow_forwardHydrogen peroxide, H2O2, is a colorless liquid whose solutions are used as a bleach and an antiseptic. H2O2 can be prepared in a process whose overall change is H2(g)+O2(g)H2O2(l) Calculate the enthalpy change using the following data: H2O2(l)H2O(l)+12O2(g);H=98.0kJ2H2(g)+O2(g)2H2O(l);H=571.6kJarrow_forward
- 9.32 The material typically used to heat metal radiators is water. If a boiler generates water at 79.5°C, what mass of water was needed to provide the heat required in the previous problem? Water has a specific heat of 4.184Jg1 C1 .arrow_forwardIs the following reaction the appropriate one to use in determining the enthalpy of formation of methane, CH4(g)? Why or why not? C(g)+4H(g)CH4(g)arrow_forwardThe head of a strike anywhere match contains tetraphosphorus trisulfide, P4S3. In an experiment, a student burned this compound in an excess of oxygen and found that it evolved 3651 kJ of heat per mole of P4S3 at a constant pressure of 1 atm. She wrote the following thermochemical equation: P4S3(s)+8O2(g)P4O10(s)+3SO2(g);H=3651kJ Calculate the standard enthalpy of formation of P4S3, using this students result and the following standard enthalpies of formation: P4O10(s), 3009.9 kJ/mol; SO2(g), 296.8 kJ/mol. How does this value compare with the value given in Appendix C?arrow_forward
- Sodium carbonate, Na2CO3, is used to manufacture glass. It is obtained from sodium hydrogen carbonate, NaHCO3, by heating. 2NaHCO3(s)Na2CO3(s)+H2O(g)+CO2(g) Calculate the standard enthalpy of reaction, using enthalpies of formation (Table 6.2).arrow_forwardA 10.00-g sample of acetic acid, HC2H3O2, was burned in a bomb calorimeter in an excess of oxygen. HC2H3O2(l)+2O2(g)2CO2(g)+2H2O(l) The temperature of the calorimeter rose from 25.00C to 35.84C. If the heat capacity of the calorimeter and its contents is 13.43 kJ/C, what is the enthalpy change for the reaction?arrow_forwardEthylene glycol, HOCH2CH2OH, is used as antifreeze. It is produced from ethylene oxide, C2H4O, by the reaction C2H4O(g)+H2O(l)HOCH2CH2OH(l) Use Hesss law to obtain the enthalpy change for this reaction from the following enthalpy changes: 2C2H4O(g)+5O2(g)4CO2(g)+4H2O(l);H=2612.2kJHOCH2CH2OH(l)+52O2(g)2CO2(g)+3H2O(l);H=1189.8kJarrow_forward
- Chemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage Learning
- Chemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage LearningChemistry for Engineering StudentsChemistryISBN:9781337398909Author:Lawrence S. Brown, Tom HolmePublisher:Cengage LearningChemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage Learning