Concept explainers
Interpretation:
The heat formedfrommethane as well as water gas combustionis to be compared. To check whether methane is preferred over water gas as a fuel ornot, the reason for the preference of methane over water gas is to be explained.
Concept introduction:
The standard enthalpy for a reaction is the change in enthalpy that occurs under standard conditions, that is, under room temperature and pressure (
The standard enthalpy of the reaction is to be determined using the equation given below:
Here, the
The value of enthalpy of formation of an element is zero at its most stable state.
Answer to Problem 82AP
Solution: Methane is preferred over water gas.
Methane is preferred because it is a natural gas and nontoxic in nature.
Explanation of Solution
Given information:
One mole of water gas, which is equal to
The combustion of methane is expressed as
From appendix 2,
The enthalpy of formation of oxygen gas is zero because it is in itsmost stable form.
Calculate the standard enthalpy of reactionas follows:
Substitute
The heat produced by water gas can be calculated from combustion of
The combustion of
From appendix 2,
Here, the enthalpy of formation is also the enthalpy of the reaction as reactants are in their most stable state and have the enthalpy of formation equal to zero.
Substitute
The combustion of
From appendix 2,
The enthalpy of formation of oxygen gas is zero because it is in its most stable form.
Calculate the standard enthalpy of reaction for the combustion of
Substitute
The total heat produced during the combustion of one mole of water gas can be calculated as
It is clear from the values that the combustion of 1mole of methane produces more heat as compared to the combustion of1 mole of water gas that has half mole of each
Other reasons for the preference of methane over water gas are as follows:
Methane gas is easier to obtain than water gas because it can be organically obtained.
Water gas contains
Therefore, methane is preferred over water gas.
Methane is preferred over water gasbecause methane gas organically obtained, it produces more heat in combustion and nontoxic. On the other hand, water gas contains toxic
Want to see more full solutions like this?
Chapter 5 Solutions
Package: Loose Leaf Chemistry With Connect 1-semester Access Card
- The enthalpy change for the following reaction is 393.5 kJ. C(s,graphite)+O2(g)CO2(g) (a) Is energy released from or absorbed by the system in this reaction? (b) What quantities of reactants and products are assumed? (c) Predict the enthalpy change observed when 3.00 g carbon burns in an excess of oxygen.arrow_forwardThe Romans used calcium oxide, CaO, to produce a strong mortar to build stone structures. Calcium oxide was mixed with water to give Ca(OH)2, which reacted slowly with CO2 in the air to give CaCO3. Ca(OH)2(s) + CO2(g) CaCO3(s) + H2O(g) (a) Calculate the standard enthalpy change for this reaction. (b) How much energy is evolved or absorbed as heat if 1.00 kg of Ca(OH)2 reacts with a stoichiometric amount of CO2?arrow_forwardGasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.arrow_forward
- Indicate which state function is equal to heat, q, for each process described. a. The ignition of a sample in a bomb calorimeter, an unyielding, heavy metal chamberin which samples are burned for heat content analysis b.The melting of an icecube in a cup c.The cooling down ofthe inside of arefrigerator d.A fire in a fireplacearrow_forwardIn a coffee-cup calorimeter, 150.0 mL of 0.50 M HCI is added to 50.0 mL of 1.00 M NaOH to make 200.0 g solution at an initial temperature of 48.2C. If the enthalpy of neutralization for the reaction between a strong acid and a strong base is 56 kJ/mol, calculate the final temperature of the calorimeter contents. Assume the specific heat capacity of the solution is 4.184 J/g C and assume no heat Joss to the surroundings.arrow_forwardAssume 200. mL of 0.400 M HCl is mixed with 200. mL of 0.400 M NaOH in a coffee-cup calorimeter The temperature of the solutions before mixing was 25.10 C; after mixing and allowing the reaction to occur, the temperature is 27.78 C. What is the enthalpy change when one mole of acid is neutralized? (Assume that the densities of all solutions are 1.00 g/mL and their specific heat capacities are 4.20 J/g K.)arrow_forward
- Methanol (CH3OH) has also been proposed as an alternative fuel. Calculate the standard enthalpy of combustion per gram of liquid methanol, and compare this answer to that for ethanol in Exercise 87.arrow_forwardChloroform, CHCl3, is formed from methane and chlorine in the following reaction. CH4(g) + 3 Cl2(g) 3 HCl(g) + CHCl3(g) Calculate rH, the enthalpy change for this reaction, using the enthalpies of formation of CO2(g), H2O(), CHCI3(g) (fH = 103.1 kJ/mol), and the enthalpy changes for the following reactions: CH4(g) + 2 O2(g) 2 H2O() + CO2(g) rH = 890.4 kJ/mol-rxn 2 HCl(g) H2(g) + Cl2(g) rH = +184.6 kJ/mol-ransarrow_forwardAt 298 K, the standard enthalpies of formation for C2H2(g) and C6H6(l) are 227 kJ/mol and 49 kJ/mol, respectively. a. Calculate H for C6H6(l)3C2H2(g) b. Both acetylene (C2H2) and benzene (C6H6) can be used as fuels. Which compound would liberate more energy per gram when combusted in air?arrow_forward
- General Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage Learning
- Chemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage LearningChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage Learning