Concept explainers
Consider the combustion of propane:
a. Balance the reaction.
b. Divide all coefficients by the coefficient on propane, so that you have the reaction for the combustion of 1 mol of propane.
c. ∆Hrxn for the combustion of one mole of propane is −2219 kJ. What mass of propane would you need to burn to generate 5. 0MJ of heat?
d. If propane costs about $0.67/L and has a density of 2.01 g/cm3, how much would it cost to generate 5.0 MJ of heat by burning propane?
Want to see the full answer?
Check out a sample textbook solutionChapter 8 Solutions
EBK INTRODUCTORY CHEMISTRY
- The formation of aluminum oxide from its elements is highly exothermic. If 2.70 g Al metal is burned in pure O2 to give A12O3, calculate how much thermal energy is evolved in the process (at constant pressure).arrow_forwardWhen 1.000 g of gaseous butane, C4H10, is burned at 25C and 1.00 atm pressure, H2O(l) and CO2(g) are formed with the evolution of 49.50 kJ of heat. a Calculate the molar enthalpy of formation of butane. (Use enthalpy of formation data for H2O and CO2.) b Gf of butane is 17.2 kJ/mol. What is G for the combustion of 1 mol butane? c From a and b, calculate S for the combustion of 1 mol butane.arrow_forwardNitromethane, CH3NO2, can be used as a fuel. When the liquid is burned, the (unbalanced) reaction is mainly CH3NO2(l) + O2(g) CO2(g) + N2(g) + H2O(g) a. The standard enthalpy change of reaction (Hvan ) for the balanced reaction (with lowest whole-number coefficients) is 1288.5 kJ. Calculate Hf0 for nitromethane. b. A 15.0-L flask containing a sample of nitromethane is filled with O2 and the flask is heated to 100.C. At this temperature, and after the reaction is complete, the total pressure of all the gases inside the flask is 950. torr. If the mole fraction of nitrogen (nitrogen) is 0.134 after the reaction is complete, what mass of nitrogen was produced?arrow_forward
- In the reaction of two moles of gaseous hydrogen and one mole of gaseous oxygen to form two moles of gaseous water vapor, two moles of products are formed from three moles of reactants. If this reaction is done at 1.01 104 Pa (and at 0 C), the volume is reduced by 22.4 L. (a) In this reaction, how much work is done on the system (H2, O2, H2O) by the surroundings? (b) The enthalpy change for this reaction is 483.6 kJ. Use this value, along with the answer to (a), to calculate rU, the change in internal energy in the system.arrow_forwardConsider the reaction 2HCl(aq)+Ba(OH)2(aq)BaCl2(aq)+2H2O(l)H=118KJ Calculate the heat when 100.0 rnL of 0.500 M HCl is mixed with 300.0 mL of 0.100 M Ba(OH)2 Assuming that the temperature of both solutions was initially 25.0C and that the final mixture has a mass of 400.0 g and a specific heat capacity of 4.18 J/C g, calculate the final temperature of the mixture.arrow_forwardA balloon expands from 0.75 L to 1.20 L as it is heated under a constant pressure of 1.01 105 Pa. Calculate the work (in J) done by the balloon on the environment.arrow_forward
- A beaker of water at 40C (on the left in the drawing) and a beaker of ice water at 0°C are placed side by side in an insulated container. After some time has passed, the temperature of the water in the beaker on the left is 30°C and the temperature of the ice water is still 0°C. Describe what is happening in each beaker (a) on the molecular level and (b) in terms of the second law of thermodynamicsarrow_forwardGasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.arrow_forward9.42 Why is enthalpy generally more useful than internal energy in the thermodynamics of real world systems?arrow_forward
- A piece of titanium metal with a mass of 20.8 g is heated in boiling water to 99.5 C and then dropped into a coffee-cup calorimeter containing 75.0 g of water at 21.7 C. When thermal equilibrium is reached, the final temperature is 24.3 C. Calculate the specific heat capacity of titanium.arrow_forwardA typical fat in the body is glyceryl trioleate, C57H104O6. When it is metabolized in the body, it combines with oxygen to produce carbon dioxide, water, and 3.022104 kJ of heat per mole of fat. (a) Write a balanced thermochemical equation for the metabolism of fat. (b) How many kilojoules of energy must be evolved in the form of heat if you want to get rid of five pounds of this fat by combustion? (c) How many nutritional calories is this? (1 nutritional calories =1103 calories)arrow_forward
- ChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning
- Chemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage Learning