Concept explainers
Ethyl alcohol, C2H5OH, is the intoxicating agent in liquor. Burning 1.00 g of ethyl alcohol in an excess of oxygen at 23.28°C and constant volume releases 29.52 kJ of heat. When 7.40 g of ethyl alcohol is burned in oxygen under the same conditions in a bomb calorimeter, the temperature of the bomb and water rises from 23.28°C to 48.04°C. The bomb holds 0.750 kg of water.
(a) What is q for the combustion of the ethyl alcohol in the bomb calorimeter?
(b) What is qH2O?
(c) What is qcal?
(d) What is the heat capacity of the calorimeter?
(a)
Interpretation:
To determine q for the combustion of ethyl alcohol in bomb calorimeter.
Concept introduction:
In a bomb calorimeter, heat given off by the reaction is absorbed by the calorimeter (including metal bomb and water). Therefore,
Heat absorbed by bomb calorimeter can be calculated by using below formula:
Heat absorbed by water can be calculated by using below formula:
Answer to Problem 16QAP
q for combustion of 7.40 g of ethyl alcohol is -218.44 kJ.
Explanation of Solution
According to question:
Combustion of 1 g of ethyl alcohol releases 29.52 kJ energy.
Therefore,
q for combustion of 7.40 g of ethyl alcohol is -218.44 kJ.
Here negative sign indicates that energy is released.
(b)
Interpretation:
To determine qH2O in the given experiment.
Concept introduction:
In a bomb calorimeter, heat given off by the reaction is absorbed by the calorimeter (including metal bomb and water). Therefore,
Heat absorbed by bomb calorimeter can be calculated by using below formula:
Heat absorbed by water can be calculated by using below formula:
Answer to Problem 16QAP
qH2O is 77.62 kJ.
Explanation of Solution
According to question:
Mass of water = 0.750 kg = 750 g
Initial temperature = 23.28 °C
Final temperature = 48.04 °C
Change in temperature = 48.04 - 23.28 = 24.76 °C
Specific heat of water = 4.18 J/g°C
As we know:
Plugging values, we get:
Thus,qH2O is 77.62 kJ.
(c)
Interpretation:
To determine qcalorimeter in the given experiment.
Concept introduction:
In a bomb calorimeter, heat given off by the reaction is absorbed by the calorimeter (including metal bomb and water). Therefore,
Answer to Problem 16QAP
qcalorimeter is 140.82 kJ.
Explanation of Solution
Here we have:
qH2O = 77.62 kJ.
qreaction = -218.44 kJ. (enthalpy of reaction)
As we know:
Plugging values, we get:
Thus, qcalorimeter is 140.82 kJ.
(d)
Interpretation:
To determine the heat capacity of calorimeter in the given experiment.
Concept introduction:
Heat absorbed by bomb calorimeter can be calculated by using below formula:
Answer to Problem 16QAP
Heat capacity of bomb calorimeter is 5.68 kJ/°C
Explanation of Solution
Here we have:
qcalorimeter = 140.82 kJ.
Change in temperature = 24.76°C
As we know:
Plugging values, we get:
Thus, heat capacity of bomb calorimeter is 5.68 kJ/°C
Want to see more full solutions like this?
Chapter 8 Solutions
PRINCIPLES+REACTIONS
- A 10.00-g sample of acetic acid, HC2H3O2, was burned in a bomb calorimeter in an excess of oxygen. HC2H3O2(l)+2O2(g)2CO2(g)+2H2O(l) The temperature of the calorimeter rose from 25.00C to 35.84C. If the heat capacity of the calorimeter and its contents is 13.43 kJ/C, what is the enthalpy change for the reaction?arrow_forwardWhen solid iron burns in oxygen gas (at constant pressure) to produce Fe2O3(s), 1651 kJ of heat is released for every 4 mol of iron burned. How much heat is released when 10.3 g Fe2O3(s) is produced (at constant pressure)? What additional information would you need to calculate the heat released to produce this much Fe2O3(s) if you burned iron in ozone gas, O3(g), instead of O2(g)?arrow_forwardA 0.470-g sample of magnesium reacts with 200 g dilute HCl in a coffee-cup calorimeter to form MgCl2(aq) and H2(g). The temperature increases by 10.9 C as the magnesium reacts. Assume that the mixture has the same specific heat as water and a mass of 200 g. (a) Calculate the enthalpy change for the reaction. Is the process exothermic or endothermic? (b) Write the chemical equation and evaluate H.arrow_forward
- Isooctane is a primary component of gasoline and gives gasoline its octane rating. Burning 1.00 mL of isooctane (d=0.688g/mL) releases 33.0 kJ of heat. When 10.00 mL of isooctane are burned in a bomb calorimeter, the temperature in the bomb and water rises from 23.2C to 66.5C. The bomb contains 1.00 kg of water. What is the heat capacity of the calorimeter?arrow_forwardSalicylic acid, C7H6O3, is one of the starting materials in the manufacture of aspirin. When 1.00 g of salicylic acid burns in a bomb calorimeter, the temperature of the bomb and water goes from 23.11C to 28.91C. The calorimeter and water absorb 21.9 kJ of heat. How much heat is given off when one mole of salicylic acid burns?arrow_forwardIn a bomb calorimeter, the reaction vessel is surrounded by water that must be added for each experiment. Since the amount of water is not constant from experiment to experiment, the mass of water must be measured in each case. The heat capacity of the calorimeter is broken down into two parts: the water and the calorimeter components. If a calorimeter contains 1.00 kg water and has a total heat capacity of 10.84 kJ/C, what is the heat capacity of the calorimeter components?arrow_forward
- In a coffee-cup calorimeter, 150.0 mL of 0.50 M HCI is added to 50.0 mL of 1.00 M NaOH to make 200.0 g solution at an initial temperature of 48.2C. If the enthalpy of neutralization for the reaction between a strong acid and a strong base is 56 kJ/mol, calculate the final temperature of the calorimeter contents. Assume the specific heat capacity of the solution is 4.184 J/g C and assume no heat Joss to the surroundings.arrow_forwardGasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.arrow_forwardA bomb calorimetric experiment was run to determine the enthalpy of combustion of ethanol. The reaction is C2H5OH() + 3 O2(g) 2 CO2(g) + 3 H2O() The bomb had a heat capacity of 550 J/K, and the calorimeter contained 650 g of water. Burning 4.20 g of ethanol, C2HsOH() resulted in a rise in temperature from 18.5 C to 22.3 C. Calculate U for the combustion of ethanol, in kJ/mosl.arrow_forward
- The standard molar enthalpy of formation of diborane, B2H6(g), cannot be determined directly because the compound cannot be prepared by the reaction of boron and hydrogen. It can be calculated from other enthalpy changes, however. The following enthalpy changes can be measured. 4 B(s) + 3 O2(g) 2 B2O3(s) rH = 2543.8 kJ/mol-rxn H2(g) + O2(g) H2O(g) rH = 241.8 kl/mol-rxn B2H6(g) + 3 O2(g) B2O3(s) + 3 H2O(g) rH = 2032.9 kJ/mol-rxn (a) Show how these equations can be added together to give the equation for the formation of B2H6(g) from B(s) and H2(g) in their standard states. Assign enthalpy changes to each reaction. (b) Calculate fH for B2H6(g). (c) Draw an energy level diagram that shows how the various enthalpies in this problem are related. (d) Is the formation of B2H6(g) from its elements exo- or endothermic?arrow_forwardHydrogen sulfide, H2S, is a foul-smelling gas. It burns to form sulfur dioxide. 2H2S(g)+3O2(g)2SO2(g)+2H2O(g);H=1036kJ Calculate the enthalpy change to burn 27.4 g of hydrogen sulfide.arrow_forwardThe Romans used calcium oxide, CaO, to produce a strong mortar to build stone structures. Calcium oxide was mixed with water to give Ca(OH)2, which reacted slowly with CO2 in the air to give CaCO3. Ca(OH)2(s) + CO2(g) CaCO3(s) + H2O(g) (a) Calculate the standard enthalpy change for this reaction. (b) How much energy is evolved or absorbed as heat if 1.00 kg of Ca(OH)2 reacts with a stoichiometric amount of CO2?arrow_forward
- Chemistry: Principles and ReactionsChemistryISBN:9781305079373Author:William L. Masterton, Cecile N. HurleyPublisher:Cengage LearningChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage Learning
- Chemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage LearningChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage Learning