![Chemistry, Loose-leaf Edition (8th Edition)](https://www.bartleby.com/isbn_cover_images/9780135210123/9780135210123_largeCoverImage.gif)
Concept explainers
How much heat in kilojoules is evolved or absorbed in the reaction of 233.0 g of calcium oxide with enough carbon to produce calcium carbide? Is the process exothermic or endothermic?
![Check Mark](/static/check-mark.png)
Want to see the full answer?
Check out a sample textbook solution![Blurred answer](/static/blurred-answer.jpg)
Chapter 9 Solutions
Chemistry, Loose-leaf Edition (8th Edition)
- A 0.470-g sample of magnesium reacts with 200 g dilute HCl in a coffee-cup calorimeter to form MgCl2(aq) and H2(g). The temperature increases by 10.9 C as the magnesium reacts. Assume that the mixture has the same specific heat as water and a mass of 200 g. (a) Calculate the enthalpy change for the reaction. Is the process exothermic or endothermic? (b) Write the chemical equation and evaluate H.arrow_forwardThe process of dissolving ammonium nitrate, NH4NO3, in water is an endothermic process. What is the sign of q? If you were to add some ammonium nitrate to water in a flask, would you expect the flask to feel warm or cool?arrow_forwardWhen solid iron burns in oxygen gas (at constant pressure) to produce Fe2O3(s), 1651 kJ of heat is released for every 4 mol of iron burned. How much heat is released when 10.3 g Fe2O3(s) is produced (at constant pressure)? What additional information would you need to calculate the heat released to produce this much Fe2O3(s) if you burned iron in ozone gas, O3(g), instead of O2(g)?arrow_forward
- The Romans used calcium oxide, CaO, to produce a strong mortar to build stone structures. Calcium oxide was mixed with water to give Ca(OH)2, which reacted slowly with CO2 in the air to give CaCO3. Ca(OH)2(s) + CO2(g) CaCO3(s) + H2O(g) (a) Calculate the standard enthalpy change for this reaction. (b) How much energy is evolved or absorbed as heat if 1.00 kg of Ca(OH)2 reacts with a stoichiometric amount of CO2?arrow_forwardThe thermochemical equation for the burning of methane, the main component of natural gas, is CH4(g)+2O2(g)CO2(g)+2H2O(l)H=890kJ (a) Is this reaction endothermic or exothermic? (b) What quantities of reactants and products are assumed if H = 890 kJ? (c) What is the enthalpy change when 1.00 g methane burns in an excess of oxygen?arrow_forwardAssume 200. mL of 0.400 M HCl is mixed with 200. mL of 0.400 M NaOH in a coffee-cup calorimeter The temperature of the solutions before mixing was 25.10 C; after mixing and allowing the reaction to occur, the temperature is 27.78 C. What is the enthalpy change when one mole of acid is neutralized? (Assume that the densities of all solutions are 1.00 g/mL and their specific heat capacities are 4.20 J/g K.)arrow_forward
- In a calorimetric experiment, 6.48 g of lithium hydroxide, LiOH, was dissolved in water. The temperature of the calorimeter rose from 25.00C to 36.66C. What is H for the solution process? LiOH(s)Li(aq)+OH(aq) The heat capacity of the calorimeter and its contents is 547 J/C.arrow_forward9.41 Under what conditions does the enthalpy change equal the heat of a process?arrow_forwardWhat mass of acetylene, C2H2(g), must be burned to produce 3420 kJ of heat, given that its enthalpy of combustion is 1301 kJ/mol? Compare this with the answer to Exercise 5.91 and determine which substance produces more heat per gram.arrow_forward
- Gasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.arrow_forwardThe temperature of the cooling water as it leaves the hot engine of an automobile is 240 F. After it passes through the radiator it has a temperature of 175 F. Calculate the amount of heat transferred from the engine to the surroundings by one gallon of water with a specific heat of 4.184 J/g oC.arrow_forwardThe standard enthalpy of formation of solid barium oxide, BaO, is 553.5 kJ/mol, and the standard enthalpy of formation of barium peroxide, BaO2, is 634.3 kJ/mol. (a) Calculate the standard enthalpy change for the following reaction. Is the reaction exothermic or endothermic? 2 BaO2(s) 2 BaO(s) + O2(g) (b) Draw an energy level diagram that shows the relationship between the enthalpy change of the decomposition of BaO2, to BaO and O2, and the enthalpies of formation of BaO2(s) and BaO2(s).arrow_forward
- Chemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage Learning
- General Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry: Matter and ChangeChemistryISBN:9780078746376Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl WistromPublisher:Glencoe/McGraw-Hill School Pub CoChemistry by OpenStax (2015-05-04)ChemistryISBN:9781938168390Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark BlaserPublisher:OpenStax
![Text book image](https://www.bartleby.com/isbn_cover_images/9780534420123/9780534420123_smallCoverImage.gif)
![Text book image](https://www.bartleby.com/isbn_cover_images/9781337399074/9781337399074_smallCoverImage.gif)
![Text book image](https://www.bartleby.com/isbn_cover_images/9781133949640/9781133949640_smallCoverImage.gif)
![Text book image](https://www.bartleby.com/isbn_cover_images/9781305580343/9781305580343_smallCoverImage.gif)
![Text book image](https://www.bartleby.com/isbn_cover_images/9781938168390/9781938168390_smallCoverImage.gif)