Concept explainers
Interpretation: The additional data required to determine the
Concept introduction:
Chemical reactions proceed with the absorption (endothermic) or evolution (exothermic) of heat.- Enthalpy change or the change in the energy of a chemical reaction can be deduced in terms of the enthalpy of formation of the products and reactants.
- The enthalpy of formation of any chemical system in its natural state is zero.
Answer to Problem 9.95PAE
Solution: The data showing the standard enthalpy of formation of solid silicon dioxide is required.
Explanation of Solution
The given reaction is:
Reaction enthalpy can be calculated using the following equation
nproducts and nreactants are the number of moles of products and reactants respectively
Based on equation (1) for the given reaction we can write:
Therefore,
The standard enthalpy of formation of solid silicon dioxide is required to calculate the enthalpy of formation of silicon nitride.
Want to see more full solutions like this?
Chapter 9 Solutions
Chemistry for Engineering Students
- Hydrogen sulfide, H2S, is a poisonous gas with the odor of rotten eggs. The reaction for the formation of H2S from the elements is H2(g)+18S3(rhombic)H2S(g) Use Hesss law to obtain the enthalpy change for this reaction from the following enthalpy changes: H2S(g)+32O2(g)H2O(g)+SO2(g);H=518kJH2(g)+12O2(g)H2O(g);H=242kJ18S8(rhombic)+O2(g)SO2(g);H=297kJarrow_forwardThe decomposition of ozone, O3, to oxygen, O2, is an exothermic reaction. What is the sign of q? If you were to touch a flask in which ozone is decomposing to oxygen, would you expect the flask to feel warm or cool?arrow_forwardThe process of dissolving ammonium nitrate, NH4NO3, in water is an endothermic process. What is the sign of q? If you were to add some ammonium nitrate to water in a flask, would you expect the flask to feel warm or cool?arrow_forward
- The head of a strike anywhere match contains tetraphosphorus trisulfide, P4S3. In an experiment, a student burned this compound in an excess of oxygen and found that it evolved 3651 kJ of heat per mole of P4S3 at a constant pressure of 1 atm. She wrote the following thermochemical equation: P4S3(s)+8O2(g)P4O10(s)+3SO2(g);H=3651kJ Calculate the standard enthalpy of formation of P4S3, using this students result and the following standard enthalpies of formation: P4O10(s), 3009.9 kJ/mol; SO2(g), 296.8 kJ/mol. How does this value compare with the value given in Appendix C?arrow_forwardGive the definition of the standard enthalpy of formation for a substance. Write separate reactions for the formation of NaCl, H2O , C6H12O6, and PbSO4 that have H values equal to Hf for each compound.arrow_forwardHydrogen peroxide, H2O2, is a colorless liquid whose solutions are used as a bleach and an antiseptic. H2O2 can be prepared in a process whose overall change is H2(g)+O2(g)H2O2(l) Calculate the enthalpy change using the following data: H2O2(l)H2O(l)+12O2(g);H=98.0kJ2H2(g)+O2(g)2H2O(l);H=571.6kJarrow_forward
- When solid iron burns in oxygen gas (at constant pressure) to produce Fe2O3(s), 1651 kJ of heat is released for every 4 mol of iron burned. How much heat is released when 10.3 g Fe2O3(s) is produced (at constant pressure)? What additional information would you need to calculate the heat released to produce this much Fe2O3(s) if you burned iron in ozone gas, O3(g), instead of O2(g)?arrow_forward9.103 One reason why the energy density of a fuel is important is that to move a vehicle one must also move its unburned fuel. Octane is a major component of gasoline. It burns according to the reaction 2C8H18(l)+25O2(g)16CO2(g)+18H2O(g) H = 1.10104 kJ Starting from this thermochemical equation, describe how you would determine the energy density, in kJ/g, for octane. Be sure to indicate what you would need to calculate or look up to complete this problem.arrow_forwardAnother reaction that is used to propel rockets is N2O4(l)+2N2H4(l)3N2(g)+4H2O(g) This reaction has the advantage that neither product is toxic, so no dangerous pollution is released. When the reaction consumes 10.0 g liquid N2O4, it releases 124 kJ of heat. (a) Is the sign of the enthalpy change positive or negative? (b) What is the value of H for the chemical equation if it is understood to be written in molar quantities?arrow_forward
- 9.41 Under what conditions does the enthalpy change equal the heat of a process?arrow_forwardGiven the following (hypothetical) thermochemical equations: A+B2C;H=447kJA+3D2E;H=484kJ2D+B2F;H=429kJ Calculate H, in kJ, for the equation 4E+5B4C+6Farrow_forwardUse Appendix L to find the standard enthalpies of formation of oxygen atoms, oxygen molecules (O2), and ozone (O3). What is the standard state of oxygen? Is the formation of oxygen atoms from O2 exothermic? What is the enthalpy change for the formation of 1 mol of O3 from O2?arrow_forward
- General Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage Learning
- Chemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningChemistry for Engineering StudentsChemistryISBN:9781285199023Author:Lawrence S. Brown, Tom HolmePublisher:Cengage LearningChemistry for Engineering StudentsChemistryISBN:9781337398909Author:Lawrence S. Brown, Tom HolmePublisher:Cengage Learning