1) Consider the following reaction:NH,NO, +_Na,PO, (NH₂)₂PO₂ +_NaNO₂ Assume we start with 30.0 grams of ammonium nitrate and 50.0 grams of sodium phosphate. a. What is the limiting reactant? b. How much of the excessive reactant is left? c. How many moles are produced of each product? d. How many grams are produced of each product? e. What is the theoretical yield of sodium nitrate f. What is the percent yield of sodium nitrate if there were 25 grams of sodium nitrate? g. What is the percent error?

1) Consider the following reaction:NH,NO, +_Na,PO, (NH₂)₂PO₂ +_NaNO₂ Assume we start with 30.0 grams of ammonium nitrate and 50.0 grams of sodium phosphate. a. What is the limiting reactant? b. How much of the excessive reactant is left? c. How many moles are produced of each product? d. How many grams are produced of each product? e. What is the theoretical yield of sodium nitrate f. What is the percent yield of sodium nitrate if there were 25 grams of sodium nitrate? g. What is the percent error?

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter3: Stoichiometry

Section: Chapter Questions

Problem 36Q: Consider the following generic reaction: Y2+2XY2XY2 In a limiting reactant problem, a certain...

See similar textbooks

Similar questions

Thionyl chloride, SOCl2, is used as a very powerful drying agent in many synthetic chemistry experiments in which the presence of even small amounts of water would be detrimental. The unbalanced chemical equation is :math>SOCl2(l)+H2O(l)SO2(g)+HCl(g) lculate the mass of water consumed by complete reaction of 35.0 g of SOCl2.
Freon-12, CCl2F2, is prepared from CCl4 by reaction with HF. The other product of this reaction is HCl. Outline the steps needed to determine the percent yield of a reaction that produces 12.5 g of CCl2F2 from 32.9 g of Cd4. Freon-12 has been banned and is no longer used as a refrigerant because it catalyzes the decomposition of ozone and has a very long lifetime in the atmosphere. Determine the percent yield.
What is meant by a limiting reactant in a particular reaction? In what way is the reaction “limited”? What does it mean to say that one or more of the reactants are present in excess? What happens to a reaction when the limiting reactant is used up?
Chlorine and fluorine react to form gaseous chlorine trifluoride. Initially, 1.75 mol of chlorine and 3.68 mol of fluorine are combined. (Assume 100% yield for the reaction.) (a) Write a balanced equation for the reaction. (b) What is the limiting reactant? (c) What is the theoretical yield of chlorine trifluoride in moles? (d) How many moles of excess reactant remain after reaction is complete.
For each of the following balanced equations, indicate how many moles of the product could be produced by complete reaction of 1.00 g of the reactant indicated in boldface. Indicate clearly the mole ratio used for the conversion. msp;NH3(g)+HCl(g)NH4Cl(s) msp;CaO(s)+CO2(g)CaCO3(s) msp;4Na(s)+O2(g)2Na2O(s) msp;2P(s)+3Cl2(g)2PCl3(l)
Consider the following generic reaction: Y2+2XY2XY2 In a limiting reactant problem, a certain quantity of each reactant is given and you are usually asked to calculate the mass of product formed. If 10.0 g of Y2 is reacted with 10.0 g of XY, outline two methods you could use to determine which reactant is limiting (runs out first) and thus determines the mass of product formed.
For each of the following incomplete and unbalanced equations, indicate how many moles of the second reactant would be required to react completely with 0. 145 mole of the first reactant. msp;BaCl2(aq)+H2SO4(aq) msp;AgNO3(aq)+NaCl(aq) msp;Pb(NO3)2(aq)+Na2CO3(aq) msp;C3H8(g)+O2(g)
DDT, an insecticide harmful to fish, birds, and humans, is produced by the following reaction: In a government lab, 1142 g of chlorobenzene is reacted with 485 g of chloral. a. What mass of DDT is formed, assuming 100% yield? b. Which reactant is limiting? Which is in excess? c. What mass of the excess reactant is left over? d. If the actual yield of DDT is 200.0 g, what is the percent yield?
Although many sulfate salts are soluble in water, calcium sulfate is not (Table 7. 1). Therefore, a solution of calcium chloride will react with sodium sulfate solution to produce a precipitate of calcium sulfate. The balanced equation is :math>CaCl2(aq)+Na2SO4(aq)CaSO4(s)+2NaCl(aq) a solution containing 5.21 g of calcium chloride is combined with a solution containing 4.95 g of sodium sulfate, which is the limiting reactant? Which reactant is present in excess?
Consider this reaction: 3 H2 + N2 --> 2 NH3 a) How many moles of H2 are required to make 30 moles of NH3? b) How many grams of H2 are needed to product 30.0 grams NH3?
---CH3NH2(g)+---02(g)= CO2(g)+----H2O(g)+----N2(g) Consider the oxidation of methylamine shown in the image above. a.When properly balanced the coefficient infront of O2= ? b. If you want to combust 45.0 g of CH3NH2, how many grams of O2 do you need? c. How many grams of N2 gas can be formed from this oxidation?
How many grams of Cl2 can be prepared from the reaction of 16.0g of MnO2 and 30.0g of HCl according to the following balanced chemical equation? MnO2 + 4HCl --> MnCl2 + Cl2 + 2H2O I figured that MnO2 would be irrelevant because it doesn't have Cl in it. Is this assumption incorrect?