1. Incompound[Cr(en)2Cla]Cltheligandsthecoordinationthe coordination number isthe donor atomsarearecentral ion is

In the coordination compound [Cr(en)2Cl2]Cl , the central metal atom is Cr and the ligands are…

Answered: 1. In coordination compound…

1. In coordination compound [Cr(en)2Cla]Cl the ligands the the coordination number is the donor atoms are are central ion is

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter19: Complex Ions

Section: Chapter Questions

Problem 5QAP

See similar textbooks

Related questions

Q: Consider the following three complexes. [Co(NH3)4Br2]Cl [Pd(NH3)2(ONO)2] [V(en)2Cl2]+ Which of…

A: In geometric isomerism is a type of stereoisomerism in which the atoms are arranged in a different…

Q: In the coordination compound (NH4)2[Fe(OH2)F5 ], the Fe complex is octahedral. a) Given that F- is a…

A: Given that NH4)2[Fe(OH2)F5 is a octahedral complex

Q: Bridging structures are quite common in coordination compounds. In this kind of structure, the…

Q: inner orbital complexes are formed by which type of ligands , strong or weak ?

A: Crystal field splitting is defined as the difference in the energies between the lower-energy (dxy,…

Q: Which ions are unlikely to form colored coordination complexes in an octahedral ligand environment?…

A: Colour for the complex is arise due to electronic transition. If no any transition possible compound…

Q: Hexafluorocobaltate(III) ion is a high-spin complex. Draw the orbital-energy splitting diagram for…

A: A coordination bond is a type of covalent bond that is formed by unequal sharing of electrons…

Q: <p>The complexes of Fe^3+ have magnetic properties that depend on whether the ligands are…

A: Iron, Fe has electronic configuration [Ar]4s23d6. Hence, during the formation of Fe3+ ions, the…

Q: The complex [CoFg]³¯ absorbs light at a wavelength of 290 nm. What is the value of the crystal filed…

A: Given: Wavelength = 290 nm Convert nm into m as follows.

Q: CI H20, 1H,0 Co 'CI H2 H20

Q: Some metal complexes have a coordination number of 5. One such complex is Fe(CO)5, which adopts a…

A: Stereoisomers are those in which arrangement of molecules are spatially distinct but molecular…

Q: The complex [Co(ox)(PMe,), (NH,)Ci] shows total number of isomers is ... A) 5 В) 4 С) 3 D) 2

Q: • Name these coordination complexes: •a. Cr(NH3);Cl3 •b. Pt(en)Cl, • . [Pt(ox),]? а. С.

A: a. Given, Cr(NH3)3Cl3 Name => Triamminetrichloridochromate(III)

Q: (b) Give 5 properties of metal ions that will affect the structure and bonding in coordination…

A: The answer is attached below-

Q: Name this coordination compound: K2[Cr(CN)5CO]

A: A compound containing transition elements displays different colors. The 'unpaired electrons of…

Q: [CoCl2(NH3)4] Cl is a Coordination compound, Counter ion, Ligand, or Complex ion? In the compound…

A: In this question, we have to find out the correct answer of given problem by the help of…

Q: 1. K₂[Co(dme)(bpy)(NCS)CI₂] i. ii. iii. Coordination compound Determine the oxidation state of…

A: “Since you have posted a question with multiple sub-parts, we will solve first three subparts for…

Q: How many ligands are found on the coordination compound [Co(NH3)5CI ]CI2? OA8 OB. 6 OC4 OD 5

A: Calculate number of ligand in the given complex---

Q: Which of the following d electron configurations would have three unpaired electrons in an…

A: In octahedral complex there are two state, t2g and eg. t2g is ground state and eg is excited state…

Q: Give the systematic name of this coordination compound. Na[Au(CN),] systematic name:

Q: Determine the oxidation state of the transition metal in each of these coordination compounds.…

A: Oxidation state of metal ion is defined the total number of electrons that an atom either gains or…

Q: Let us consider the following coordination complexes: [Fe(CN6)]3- Given that the chloride ion and…

A: The given coordination complex is a cyanide containing complex, and cyanide is a strong field…

Q: How many unpaired electrons are there in the complex ion [CO(NO3)5]¯? For this in the nitrate…

A: Given , Initial amount of substance = 60mg t1/2 = 6 h Total time = 24 h N ❓ In question 2 Since…

Q: (c) Explain crystal field splitting in the case of tetrahedral complexes.

A: Crystal field splitting in tetrahedral complexes:

Q: The number of unpaired electrons in dº, low spin, octahedral complex is-

A: Chemical compounds that consist of an arrangement of neutral molecules or anions that are bound to a…

Q: What is the coordination number for the transition metal in the following complexes? a)…

A: Coordination number : it is the total number of atoms are attached to the central atom.

Q: Draw the structure of each of the following coordination compounds or ions. Then draw the structure…

A: The structure of given coordination compound-

Q: 18. K3[Fe(CN)6], The oxidation state Off. the metal atom is _ and the coordination number of the…

A: Given coordination complex = K3[Fe(CN)6] Here, K = Metal which lies in the ionization sphere. Fe…

Q: How many isomers are possible for a tetrahedral complex [MA2BC]? а. О b b. 2 a с. 4

A: The number of isomers in tetrahedral complex having formula MA2BC are calculated as follows,

Q: 1. Consider the coordination compound Na4[Fe(ONO)2(Ox)2]. A. Write the systematic name of the…

Q: What is the coordination number of the central metal in [Co(en)3]Cl2 ? The en (NH2CH2CH2NH2)…

A: The coordination number of Co is calculated below. The coordination sphere is [Co(en)3]2+

Q: There are two isomerism in coordination complexes which are structural isomerism and…

A: Isomerism: same chemical composition but different structures called isomers and process is called…

Q: Draw the structures of optical isomers of each of the following complex ions:[Cr(C2O4)3]3-,…

A: Compounds which are non-super imposable mirror image of each other are known as optical isomers.

Q: Cobalt(II) forms more tetrahedral complexes than any other ion except zinc(II). Draw the…

A: The structure of the tetrahedral complex [CoCl2(en)] is

Q: Can any of the following serve as ligands in coordination complex? Why or why not? a. CO b. NH4+…

A: In a coordination complex, a ligand is a molecule that can donate electrons to the central atom.

Q: The complex ion [Ni(TAP)(CN)]+ has a distorted trigonal bipyramidal structure, the complex ion has a…

A: Given: The complex ion [Ni(TAP)(CN)]+ has a distorted trigonal bipyramidal structure.

Q: Determine the oxidation state and coordination number of the metal ion in each complex ion. a.…

A: To solve the given problems related to coordination compounds, we must be aware of the following…

Q: When a certain weak-field ligand forms an octahedral complex with Coʻ 2+ cation, the energies of the…

A: We have find out the unpaired electrons, nature and colour of octahedral complex.

Q: In the following list, identify a transition metal cation that cannot be used to distinguish between…

A: To identify a transition metal cation that cannot be used to distinguish between strong-field and…

Q: In the below coordination compound, the sodium ions are A._______the hydroxide ions are counterions…

Q: a) Provide the name of the coordination complex Na[COCI,(NH3),] b) Calculate the orbital…

Q: Consider the following complex ion: [Cu(NH3)4]2+ Identify the coordination number, oxidation state,…

A: [Cu(NH3)4]2+ This is the copper complex . The charge on this complex is + 2 . The charge on the NH3…

Q: Given: CN^- is a stronger field ligand compared to SCN^-. Briefly explain why a complex formed…

A: CN- is strong field ligand than SCN- , When it forms complex with Iron. There will be…

Q: What is the coordination number for the transition metal in the following complexes? a)…

A: To calculate coordination numbers of complexes , we have to look about ligands surrounding the…

Q: The following neutral molecules or ionic species are considered: CIo, CNO, NH3, O2, CH4,…

A: Coordinate complex is form by the coordinate covalent bond. In coordinate covalent bond the central…

Q: Consider the following three complexes:(Complex 1) [Co(NH3)5SCN]2+(Complex 2)…

A: Isomers are broadly classified into different types and they are: Geometrical Isomers-They differ…

Q: Question attached

A: The given Coordination compound is Cr(bpy)2(CO)2 To find: The oxidation state and d-configuration…

Q: How many ligands are found on the coordination compound: [Co(NH3)5CI]Cl2 ? O A. 8 B. 6 O C.4 O D.5

A: How many ligand found in the given complex ?

Q: Crystal field splitting can impact the properties of coordination complexes. In particular, whether…

Concept explainers

Atomic Structure

The basic structure of an atom is defined as the component-level of atomic structure of an atom. Precisely speaking an atom consists of three major subatomic particles which are protons, neutrons, and electrons. Many theories have been stated for explaining the structure of an atom.

Shape of the D Orbital

Shapes of orbitals are an approximate representation of boundaries in space for finding electrons occupied in that respective orbital. D orbitals are known to have a clover leaf shape or dumbbell inside where electrons can be found.

Question

1. In
compound
[Cr(en)2Cla]Cl
the
ligands
the
coordination
the coordination number is
the donor atoms
are
are
central ion is

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Four different octahedral chromium coordination compounds exist that all have the same oxidation state for chromium and have H2O and Cl as the ligands and counterions. When 1 mole of each of the four compounds is dissolved in water, how many moles of silver chloride will precipitate upon addition of excess AgNO3?
The square-planar complex Pt(en)Cl2 has chloride ligands in a cis configuration. No trans isomer is known. Based on the bond lengths and bond angles of carbon and nitrogen in the ethylenediamine ligand, explain why the trans compound is not possible.
How many geometric isomers of the complex ion [Cr(dmen)3]3+ can exist? (dmen is the bidentate ligand 1,1-dimethylethylenediamine.) 1,1-Dimethylethylenediamine, dmen
What is the coordination number of the central metal atom in the following complexes? (a) [Fe(H2O)63+] (b) [Pt(NH3)Br3] (c) [V(en)Cl42] (d) [Au(CN)2+]
Trimethylphosphine, P(CH3)3, can act as a ligand by donating the lone pair of electrons on the phosphorus atom. If trimethylphosphine is added to a solution of nickel(Il) chloride in acetone, a blue compound that has a molecular mass of approximately 270 g and contains 21.5% Ni, 26.0% Cl, and 52.5% P(CH3)3 can be isolated. This blue compound does not have any isomeric forms. What are the geometry and molecular formula of the blue compound?
Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
Two different compounds are known with the formula Pd(py)2Cl2, but there is only one compound with the formula Zn(py)2Cl2. The symbol py is for pyridine, a mono-dentate ligand. Explain the differences in the Pd and Zncompounds.