MCQ 116: Iodine is the least volatile Halogen, due toA. complex molecular structureB. greater number of electrons in the principal outermost electron shellC. strong Van der Waals forcesD. none of above

A substance is said to be volatile if it will easily changes to gas or vapour. Generally compounds…

Answered: 116: Iodine is the least volatile…

116: Iodine is the least volatile Halogen, due to .complex molecular structure greater number of electrons in the principal outermost electron shell strong Van der Waals forces - none of above

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter8: Molecules And Materials

Section: Chapter Questions

Problem 8.22PAE

See similar textbooks

Related questions

Q: Which one of the following is TRUE? lect one: a. ΔΗ for N, (?) b. AH°dissociation for O2(g) = 0 c.…

A: a. delta Hof for N2 is 472,650. Hence delta Hof for N2 is not less than zero. Hence, not a correct…

Q: If the temperature drops to -40 °C, the ammonia will and become a If the temperature drops further…

A: At standard temperature and pressure: Boiling point of ammonia=-33oC Freeing point of ammonia=-78oC

Q: What are anistropic substances?

A: All matter can exist in different physical states; solid, liquid and gases. Solid is well known…

Q: The melting and boiling points of alkaline metals are higher than alkali metals. Give reason.

A: Melting point is that temperature at which solid and liquid phase stay in equilibria and boiling…

Q: Predict If the following CHa) + Hla) > CHalg) disorder OTo predit order o disorder numerical values…

A: Interpretation: We have to predict whether the given reaction gets order or disorder.

Q: Rank the following in order of increasing(a) Melting point: Na, Si, Ar(b), ΔH(fus): Rb, Cs, Li

A: The inter-atomic force present in sodium is metallic bonding. This force binds numerous sodium atoms…

Q: Compare the boiling points {f all period 2 non metal hydrides. Explain the trend

A: The boiling point of a fluid is the temperature with which the vapor pressure of a liquid equals the…

Q: What is the role of cation during ion-dipole interactions? A. it distorts the electron…

A: Ion dipole interaction: It is defined as the interaction between ion and a molecule with permanent…

Q: a. A group 1 metal only forms one oxide (MO) with oxygen. The oxide that is formed will not produce…

A: "Since there are multiple sub-parts in this question and it is not mentioned that which one has to…

Q: IV. Physical and chemical properties. 1. Arrange the following in increasing boiling point Br a. H3C…

A: Boiling point of a compound depends on various factors as discussed in the following step.

Q: Molten metal often has a bright red/orange color to it, what phenomenon causes this? O Electrons can…

A: When electromagnetic radiation is emitted from a hot bodey due to high temperature then the…

Q: Why do nonmetals oxides tend to form acids and metal oxides tend to form bases? O Metal oxides tend…

A: Metal oxides are basic beacuse metal looose electron and oxygen gain electron and oxide is formed…

Q: Complete and balance the following:(a) AsCl₃(l) +H₂O(l) → (b) Sb2O₃(s) +NaOH(aq)→

A: a) The reactants are 1) AsCl₃(l) 2) H₂O(l) Hence the reaction taking place will be double…

Q: 22. Distillation is a process which consists in separating, by heat, the various elements…

A: The molecules given are,

Q: The group 17 elements cannot be found free in nature because they are reactive. they are in gaseous…

A: 1. Option A 2. Option A 3. Option A

Q: The highest specific heat among the species is for O a. Sulphur Dioxide O b. Oleum O c. Hydrogen…

A: Definition of specific heat : Specific heat is the quantity of heat required by any substance to…

Q: Dissolved oxygen in water is in the form of O a. Uncombined O2 molecules O b. Oxygen in carbon…

Q: Which of the following is a covalent compound ? A 4.22 mol sample of Ar has a pressure of 1.21 atm…

A: Using ideal gas equation, volume of the argon gas can be calculated. PV=nRT here P = pressure of the…

Q: a) How does the boiling point change from top to bottom in group 6A elements (o, S, Se, Te)? b) The…

A: Answer:- This question is answered by using the simple concept of boiling point of group 6A which…

Q: Join In, Question When KCl dissolves in water, what types of intermolecular bonds are formed?…

A: KCl is an ionic compound, it easily dissolve in water. Since water is a polar molecule, it has…

Q: Name and draw and example of three basic ionic crystal structures.

A: Crystal lattice is symmetrical 3-dimensional structural arrangements of atoms, ions or molecules…

Q: Which of the following do you expect to have the highest ∆Hvap H2O, NH3, CH30H, F2

A: Out of the given 4 option, the molecule which has greatest intermolcular force of attraction will…

Q: A 0.708 g sample of a metal, M, reacts completely with sulfuric acid according to M(s) + H,SO, (aq)…

A: Given that : The mass of metal sample = 0.708 g The reaction of the metal with sulfuric acid is :…

Q: In weak chemical bonds, an example of it is Hydrogen bonds. What does it mean when they say, "The H…

A: Hydrogen bond: hydrogen bond is an attraction between two atoms that already participate in other…

Q: Which is TRUE regarding the conduction of electricity at regular conditions for metals, nonmetals…

A: Option A is correct answer.

Q: Use the equation that follows for parts (a) and (b) below. Molecular masses are under each…

A: The ideal law is sometimes considered as the combination of Boyle’s law, Charles’s law and…

Q: Nitrogen and phosphorus are elements from the same group. Which of the following reasons is NOT A…

Q: Of the gases in the figure, which gas has the smallest value for the Henry's Law constant?

A: The equation for Henry's law is: c = kH . P where c is the solubility, kH is the henry's constant, P…

Q: In the mountains, water in an open container will boil when, O its vapor pressure equals atmospheric…

A: Given: To find at what temperature will the water boil in the mountains.

Q: briefly explain why the oleic acid molecules organize themselves into a monolayer?

A: Oleic acid is a fatty acid with the molecular formula CH3(CH2)7CH=CH(CH2)7COOH.

Q: Below, writé the formula far the solid formed in Zn(CIO4)2 (aq) + K2CrO4 (aq) → ZnCrO4 (s) + 2 KCIO4…

A: Interpretation - To write the formula for the solid formed in this given reaction -…

Q: а. The strong electrostatic attractions between cations and anions are responsible for the fact that…

A: Ionic liquid is a salt in a liquid state. These are also known with other names, such as ionic…

Q: Select one of the following formulas and describe all that it tells you about the ç.p's it…

A: Since we can choose any one formula, here I am describing H2S.

Q: What do u think is giving rise to electrical conductivity

Q: structure

Q: In liquid ammonia, NaH and NH3 react to form sodamide (NaNH2). What happens when NaNH2 is placed in…

A: when NaH react with NH3 to give NaNH2 and Hydrogen gas NaH + NH3 → NaNH2 + H2(g)

Q: 122 CHAPTER 5ID 15. Which of the following best describes the particle-level bonding in a crystal of…

A: The correct option are as follows:

Q: is a smelly, yellow to black liquid and is usually found in the underground areas called reservoirs.…

A: The smell and colour of any substance depends upon its chemical composition. The materials which are…

Q: Alcohols (ROH) are structurally similar to water. Why are alcohols not as powerful a solvent as…

A: Water molecule, H2O consists a hydrogen atom and a hydroxyl group, (-OH). Alcohol consists an alkyl…

Q: CI Na Na

A: The ions and water molecules have ion-dipole interactions. It is because the water molecule is…

Q: Why do the noble gases have such low boiling points?

A: The explanation is as given below:

Q: 1.The prediction of melting point rank can be useful when discussing the different applications of…

A: Melting point is the temperature at which a solid turns into a liquid. In theory, the melting point…

Q: write the condense structure of the following

A: The condensed structural formula of any compound is written without showing the bonds in between the…

Q: Which of the following compounds has the highest boiling point? Не Li Be B. Ne 14 17 Na Mg Al Si ci…

A: Answer:- This question is answered by using the simple concept of boiling point which depends on the…

Q: 4. Define the following: a. supematant liquid - b, decant -

A: Since you have asked multiple question, we will solve the first question for you.If you want any…

Question

MCQ 116: Iodine is the least volatile Halogen, due to
A. complex molecular structure
B. greater number of electrons in the principal outermost electron shell
C. strong Van der Waals forces
D. none of above

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

There are three flask they are all 1.00L flask a is NH3 flask B is NO2 flask c is N2 which flask are the molecules least polar and therfore most ideal in behavior
Why is water(H2O) more polar than NH3 and CH4?
Which of the following statements is/are correct? l. Water is good at dissolving ions and polar molecules, but poor at dissolving nonpolar molecules. ll. A polar molecule is one that is uncharged, but has an asymmetric internal distribution of charge, leading to partially positive and partially negative regions. lll. Water interacts differently with charged and polar substances than with nonpolar substances because of the polarity of its own molecules. lV. Water molecules are polar, with partial positive charges on the hydrogen, a partial, and negative charge on the oxygen.
A paper published in the research Journal Science in 2007 (S. Vallina and R. Simo, Science, Vol. 315, p. 506, January 26, 2007) reported studies of dimethylsulfide (DMS), an important green-house gas that is released by marine phytoplankton. This gas represents the largest natural source of atmospheric sulfur and a major precursor of hygroscopic (i.e., cloud-forming) particles in clean air over the remote oceans, thereby acting to reduce the amount of solar radiation that crosses the atmosphere and is absorbed by the ocean. (a) Sketch the Lewis structure of dimethylsulfide, CH3SCH3, and list the bond angles in the molecule. (b) Use electronegativities to decide where the positive and negative charges lie in the molecule. Is the molecule polar? (c) The mean seawater concentration of DMS in the ocean in the region between 15 north latitude and 15 south latitude is 2.7 nM (nanomolar). How many molecules of DMS are present in 1.0 m3 of seawater?
Follow the directions of Question 1 for (a) OCl2 (b) PF3 (c) SbCl6- (d) ICl4-
Will the two have the same dipole moment? why or why not? Express in terms of their structure and intermolecular force.
35. Which of the following does have the highest boiling point? molar masses: C = 12.01 g/ mole, S = 32.07 g/ mole, O = 16.00 g/ mole, H = 1.008 g/mole, I = 126.9 g/mole, Cl = 35.45 g/mole electronegativities: C = 2.5, H = 2.1, O = 3.5, Cl = 3.0, S= 2.8 , I = 2.3 a.COb.HClc.I2d.SO2
1. Which of the following would you expect to have the higher melting point? Explain why.
If you have 10.0 moles of BH3 and 5.0 moles of HF, which amount exhibits the most hydrogen bonding. Explain?
In the ammonia (NH3) molecule, three hydrogen (H) atoms form an equilateral triangle, with the center of the triangle at distance d = 94.0 pm (picometer) from each hydrogen atom. The nitrogen (N) atom is at the apex of a pyramid, with the three hydrogen atoms forming the base. The nitrogen-to-hydrogen atomic mass ratio is 13.9, and the nitrogen-to-hydrogen distance is L = 101.4pm. What are the (a)x and (b)y coordinates of the molecule's center of mass? [Answer: (a) 0; (b)31.3 pm]. SHOW work, work needs to be shown!
Consider the following materials: 1) liquid methane (CH4) 2) liquid water (H2O), 3) solid sodium fluoride (NaF) and 4) liquid solution of NaF in water. Describe the types of forces which hold the ions and/or molecules together in each of these materials.
where are the polar and non polar atoms in C22H23ClN2O2.Label where the dipole dipole are and the hydrogen bonding are