2. (B-1 linkage) head group and a linoleic acid attached. Number each of the carbons in linoleic acid. Draw the structure of a glycosphingolipid molecule with an N-acetyl glucosamine
Q: 3. Consider the following amino acid: HS. он NH2 a. Draw this structure in a solution of potassium…
A: Introduction The given amino acid is Homocysteine. In a basic solution, the carboxyl group is…
Q: For each of the tripeptide: Tyrosylisoleucylleucine Methionylcysteinylisoleucine 1. Draw the…
A: An amino group and an acid group-containing organic molecules are called Amino acids.…
Q: 2. Draw the structure of 1-palmitoleyl-2-linolenyl-3-stearyl triacylglyceride
A: 1-Palmitoleyl-2-linolenyl-3-stearyl triglyceride: This is a triglyceride compound containing…
Q: 1. Indicate whether each of the following molecules is an alpha amino acid or not and explain why.…
A: Proteins are defined as the polymers of amino acids. It is a macronutrient that plays a very…
Q: 5. Draw the structures of the TWO glycoside products formed below. CH2OH OH CH3OH, H* но НО Он
A:
Q: 3. Which of the following pair is an enantiomeric pair? *
A: Enantiomeric pairs are the isomers that are non-superimposable mirror images of each other. they…
Q: 4. Draw the bond-line dash-wedge structure and the Fischer projection of the following compounds.…
A: The wedge and dash projection is a means of representing a molecule with three types of lines. The…
Q: 2. Draw the structural formula of the amino acid asparagine that predominates in solution at each of…
A: Asparagine is a polar amino acid. It contains one amide group in its side chain which is not…
Q: Amino acids can be prepared from a-halo carboxylic acids [RCH(X)COOH] by reaction with excess NH3.…
A: Amino acids are the organic acids that contains an amino group, carboxyl group, hydrogen atom, and…
Q: Which functional groups are present?
A: Compound is a chemical substance that is made up of more than two atoms which are joined by chemical…
Q: Draw the stereoisomers of the following amino acids. Indicate pairs of enantiomers and pairs of…
A: Isomers are molecules with the same molecular formula, but they differ in functional groups,…
Q: 4. Draw the -forms of the following sugars. CHO CHO H- OH но H- HO H- HO. OH OH CH,OH CH;OH 5. Draw…
A: A biomolecule is a molecule produced by living organisms or cells. Carbohydrates, proteins, lipids,…
Q: 4. Draw the condensed structural formula for the triacylglycerol made from 3 saturated fatty acids…
A: Triglycerides are the main constituents of body fat in humans and other vertebrates and are also…
Q: 3. Draw the chemical structure of a triacylglycerol with lauric acid, palmitoleic acid and stearic…
A: Fats are an important nutrient for healthy cell and normal cellular functioning. The fats are stored…
Q: "CH,OH OH HO A. Draw the 2 resulting structures that would occur upon initial hydrolysis of the…
A: Glycosidic bond: The bond that joins carbohydrate residue with other group is called Glycosidic…
Q: A glucogenic amino acid is an amino acid that can be converted into glucose through glycogenesis. An…
A: Since you have asked multiple questions, we will solve the first question for you. If you want any…
Q: 7. When carbohydrates in their Fischer projection form a pyranose ring structure, it can be either a…
A: Carbohydrates are polyhydroxy aldehydes and ketones which are associated with reducing properties.…
Q: Describe the four functional groups of carbon 2 based on a typical saturated fatty acid.
A: The saturated fatty acids have single bonds predominantly. They do not have double bonds (C=C)…
Q: uestion 13 /hich of the following is the correct structure of the tripeptide Gly-Phe-Ala? a. Ph H.…
A: A tripeptide is a polypeptide that was formed by joining an alpha carboxyl group of one amino acid…
Q: In monounsaturated fatty acids, the presence of a double bond is usually found at the position…
A: Fatty acids are important micromolecules which combine together to form lipids in plants, animals…
Q: 5. Which of the following structure is the not stable structure of hexoses? 6 Он ОН4 HO HO. 5 HO- 2…
A: In the hexose structure or any structure when the position of OH group is in equatorial postion it…
Q: Identify the functional groups of Statins and their derivatives, and explain the importance of these…
A:
Q: 8. Which of the following fatty acids is an essential omega-3-fatty acids? *
A: Omega 3 fatty acids play an important role in maintaining a healthy diet and healthy physiology.…
Q: 2. Draw the structure of the tripeptide Gly-Ala-Tyr H H. N-C-C H N-C-C + N-C-C + H он он CH3 H. 0-H…
A: Proteins have four levels of structural organization including Primary, secondary,…
Q: 4. Histidine, one of the 20 amino acids, contains an imidazole functional group with a pKa of 6.0.…
A: Dissociation of a weak acid is mathematically described by the Henderson-Hasselbalch equation: pH =…
Q: Which of these polymers contains α1à6 glycosidic linkages? (Select all that apply!) a) Starch b)…
A: Polysaccharides are carbohydrates that contain many monosaccharides that are linked through O…
Q: The following structure is sorbose CH2OH C=0 H-C-OH НО -С -Н 4. Draw the boat conformation of no. 3.…
A: Hi! Since you have posted a multipart question and have not mentioned which to answer, I shall be…
Q: 2. The diagram below shows the structure of a sugar. ÇH2OH C=0 Но -H- но ČH2OH a. Is the sugar an…
A: “Since you have posted a question with multiple sub-parts, we will solve first three sub-parts for…
Q: Define the alternative chemical structure of deoxyribonucleic acid which could be copienfaithfully.
A: The Sanger chain termination sequencing method was invented by Sanger to identify the sequence of…
Q: 4. Cleanly draw: a. fatty acid bearing 14:245,7 configuration b. triacylglycerol bearing all 12:0…
A: Fatty acids are the carboxylic acid associated with the aliphatic carbon chain. These are known to…
Q: 8. Match each of the following amino acids with the intermediate needed for its synthesis. (a)…
A: The non-essential amino acids can be synthesized in the body, they need not be supplied in the diet.…
Q: 18. R-C-N-R вс Where is the amide linkage in the diagram above? a. A b. B Oc. C d. D 19. Which…
A: Only first three parts will be answered.
Q: 1. The figure below shows the Fischer projection of an L-aldohexose. T or F Но- HO- но ČH2OH 2. T or…
A: “Since you have posted a question with multiple sub-parts, we will solve first three subparts for…
Q: 7. general structure of a TAG 8. structure of glycerol 9. structure of a sterol
A: You have asked question with multiple subparts. I will answer 1st three subparts. Triacylglycerol -…
Q: III. Convert the ff. cyclic sugar structures in Fischer formula into their corresponding Haworth…
A: Carbohydrates: Is a biomolecule having ketone and aldehyde groups also known as aldoses and ketoses…
Q: 6. Convert each of the following chair conformations to an open-chain from and to a Fischer…
A: Carbohydrates are the polyhydroxy ketones or polyhydroxy aldehydes or their derivatives. In…
Q: 2. The structure of a vitamin is shown below. H HH H. H H C Č-H H. но нн Identify two potentially…
A: Elements are arranged according to the atomic numbers. Atomic masses, as well as numbers, increase…
Q: The two isomers that can form when glucose turns from an open chain to a closed ring is called:…
A: Asked : Isomers formed when open chain forms closed ring
Q: Which of these polymers contains a1à6 glycosidic linkages? (Select all that apply!) Starch Cellulose…
A: Carbohydrates are one of the major biomolecules needed for the survival of living beings. It is made…
Q: 1. Draw the structure of the following triacylglycerols (TAGS) 1,2-dioleoyl-3-myristyl-sn-glycerol…
A: Triacylglycerol: Triacylglycerides are esters of fatty acids that are hydrolyzed to glycerol and…
Q: If the pKa of a carboxyl group in a protein is approximately 4.5, at pH 5.5 the ratio of carboxylate…
A: pH at which 50% acid dissociate called its pKa. Buffer solutions often are weak…
Q: 3. In the space provided, draw the structure of Glycine (Gly) at the following pH value. Glycine has…
A: Glycine is non polar amino acid it's side chain is a hydrogen atom , glycine is not optically active…
Q: 2. The diagram below shows the structure of a sugar. ÇH2OH C=0 но H но H- ČH2OH Is the sugar an…
A:
Q: 4. This question is about the effect of geometric isomerism on the melting and boiling points of…
A: Cis-1,2- dichloroethene - Polar (i) Same groups(Cl) are present on the same side : So, net dipole…
Q: 4. Draw the boat conformation of no. 3. 5. Draw the chair conformation of no. 3. 6. How many…
A: A boat and a chair form (different three dimensional structural conformations) of the carbohydrates…
Q: 18. Which of the following characteristics are found in the class of C20 carboxylic acids called…
A: Prostaglandins, thromboxane, as well as leukotrienes, are known to be derived from the essential…
Q: . Draw the structure of the omega-6 fatty acid 16:1. Give the (simplified) systematic name of the…
A: Omega-6 fatty acids are a family of polyunsaturated fatty acids that all have a final carbon-carbon…
Q: 3. Give (draw) an example of a meso isomer. Ans
A: Stereoisomers are compounds that have the same chemical formula and sequence of bonded atoms, but…
Please explain in detail and don't copy paste.
Trending now
This is a popular solution!
Step by step
Solved in 2 steps with 1 images
- 1. Why is β-carotene less polar than chlorophyll b? Mention any TWO functional groups which make chlorophyll b more polar than carotene. 2. What is the degree of unsaturation of a β-carotene molecule?1.One of the main sources of sphingosine in the body is in the cell membrane. What complication could arise from the biological synthesis of ceramide?1. The main sweetener in Mackies Honeycomb is _______________
- 3. One of the triacylglycerols found in corn oil contains palmitic acid, linoleic acid, and linolenic acid. During the production of spreadable margarine, all of the double bonds in this triacylglycerol are converted from cis to trans isomers. Linoleic acid: CH3(CH2)4CH=CHCH2CH=CH(CH2)7COOHLinolenic acid: CH3CH2CH=CHCH2CH=CHCH2CH=CH(CH2)7COOH Palmitic acid: CH3(CH2)14COOH a. Identify the unsaturated fatty acid(s) listed above and provide the associated omega designation. b. Draw an accurate representation of the structure of the triacylglycerol present in spreadable margarine. Circle all ester bonds in the structure you have drawn.1. provide three reasons why most of the research on carotenoids concentrates on b-carotene. 2. draw the retinol ester that has stearic acid as the carboxylic acid portion of its structure.1. For this compound to cyclize, an alcohol group must attack a carbonyl group. Which carbon is bonded to the reactive alcohol? A. C1 B. C2 C. C3 D. C4 E. C5 F. C6
- 7. WHAT IS A PHOSPHODIESTER BOND? WHERE CAN IT BE FOUND? 8. GIVE AT LEAST 10 CARBOXYLIC ACIDS THAT HAVE A SIGNIFICANT ROLE IN BIOLOGICAL SYSTEMS AND/OR IN MEDICINE. 9. WHAT IS DECARBOXYLATION? CITE BIOLOGICAL PROCESSES WHICH INCLUDE DECARBOXYLATION.2. View a butane molecule along the C2-C3 bond and provide a Newman projection of the lowest energy conformer.1.How many chiral center does D-Eranose have？ 2. How many stereoisomer are possible for D-Eranose. 3. Why did I got this question wrong？？？did I messed up the calculation？I dont undestand why my professor marked me wrong
- 1. In one (1) sentence point out a key structural similarity and difference in each of the following pair of terms: a) Cellulose and chitin b) α (alpha)- and β(beta)- anomers c) glycosidic and ester bonds d) triacylglycerols and glycerophospholipids e) linoleic and linolenic acids#2 under Identify the Structures is what... A. phosphate groups B. deoxyribose sugars C. nitrogen bases D. covalent bonds4. The following rules on aromaticity promotes a planar structure of nitrogenous bases EXCEPT: A. All atoms in the ring are sp2 hybridized. B. Pi bonds show conjugation. C. The structure is cyclic. D. The number of electrons satisfies Huckel’s Rule. 5. Which parts of Adenine are involved in the formation of hydrogen bonds with its complementary base pair? A. Atoms 1 and 6 B. Atoms 9 and 6 C. Atoms 3 and 4 D. Atoms 2 and 4