2. The following cell is set up: 2. The following cell is set up: Porous Barrier 0.01M Pb(NO32 pH - 10.0 0.1M KMN04 Pt Pb a) What are the reactions taking place at the electrodes? b) What will the cell voltage be? c) What is the maximum amount of work you can get from this cell (per mole of electrons)?

2. The following cell is set up: 2. The following cell is set up: Porous Barrier 0.01M Pb(NO32 pH - 10.0 0.1M KMN04 Pt Pb a) What are the reactions taking place at the electrodes? b) What will the cell voltage be? c) What is the maximum amount of work you can get from this cell (per mole of electrons)?

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 67E: A galvanic cell is based on the following half-reactions at 25C: Ag++eAg H2O2+2H++2e2H2O Predict...

See similar textbooks

Similar questions

Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?
An aqueous solution of an unknown salt of gold is electrolyzed by a current of 2.75 amps for 3.39 hours. The electroplating is carried out with an efficiency of 93.0%, resulting in a deposit of 21.221 g of gold. a How many faradays are required to deposit the gold? b What is the charge on the gold ions (based on your calculations)?
Consider a voltaic cell in which the following reaction takes place in basic medium at 25°C. 2NO3-(aq)+3S2(aq)+4H2O3S(s)+2NO(g)+8OH(aq) (a) Calculate E°. (b) Write the Nernst equation for the cell E. (c) Calculate E under the following conditions: PNO=0.994atm,ph=13.7,[S2]=0.154M,[NO3-]=0.472M, .
A mercury battery, used for hearing aids and electric watches, delivers a constant voltage (1.35 V) for long periods. The half-reactions are HgO(s)+H2O(l)+2eHg(l)+2OH(aq)Zn(s)+2OH(aq)Zn(OH)2(s)+2e Which half-reaction occurs at the anode and which occurs at the cathode? What is the overall cell reaction?
For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mg(s)+Ni2+(aq)Mg2+(aq)+Ni(s) (b) 2Ag+(aq)+Cu(s)Cu2+(aq)+2Ag(s) (c) Mn(s)+Sn(NO3)2(aq)Mn(NO3)2(aq)+Sn(s) (d) 3Fe(NO3)2(aq)+Au(NO3)3(aq)3Fe(NO3)3(aq)+Au(s)
A lead storage battery delivers a current of 6.00 A for one hour and 22 minutes at a voltage of 12.0 V. (a) How many grams of lead are converted to PbSO4? (b) How much electrical energy is produced in kilowatt hours?
Consider the galvanic cell based on the following half-reactions: a. Determine the overall cell reaction and calculate b. Calculate G and K for the cell reaction at 25C. c. Calculate at 25C when [Au3+] = 1.0 102 M and [Tl+] = 1.0 104 M.
Consider a concentration cell that has both electrodes made of some metal M. Solution A in one compartment of the cell contains 1.0 M M2+. Solution B in the other cell compartment has a volume of 1.00 L. At the beginning of the experiment 0.0100 mole of M(NO3)2 and 0.0100 mole of Na2SO4 are dissolved in solution B (ignore volume changes), where the reaction M2+(aq)+SO42(aq)MSO4(s) occurs. For this reaction equilibrium is rapidly established, whereupon the cell potential is found to be 0.44 V at 25C. Assume that the process M2++2eM has a standard reduction potential of 0.31 V and that no other redox process occurs in the cell. Calculate the value of Ksp for MSO4(s) at 25C.
A galvanic cell is based on the following half-reactions at 25C: Ag++eAg H2O2+2H++2e2H2O Predict whether is larger or smaller than for the following cases. a. [Ag+]=1.0M,[H2O2]=2.0M,[H+]=2.0M b. [Ag+]=2.0M,[H2O2]=1.0M,[H+]=1.0107M
A fuel cell designed to react grain alcohol with oxygen has the following net reaction: C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) The maximum work that 1 mole of alcohol can do is 1.32 103 kJ. What is the theoretical maximum voltage this cell can achieve at 25C?
The overall reaction in the lead storage battery is Pb(s)+PbO2(s)+2H+(aq)+2HSO4(aq)2PbSO4(s)+2H2O(l) a. For the cell reaction H = 315.9 kJ and S = 263.5 J/K. Calculate at 20.C. Assume H and S do not depend on temperature. b. Calculate at 20.C when [HSO4] = [H+] = 4.5 M. c. Consider your answer to Exercise 71. Why does it seem that batteries fail more often on cold days than on warm days?
a Calculate G for the following cell reaction: Tl(s)Tl+(aq)Pb2+(aq)Pb(s) The Gf for Tl+(aq) is 32.4 kJ/mol. b From G, calculate the standard cell potential for the cell reaction and from this, determine the standard potential for Tl2+(aq)+eTl(s).