Answered: a) Do you expect a distortion for…

a) Do you expect a distortion for [Ti(H2O),]³* and [CoCl]³- b) What type of distortion would be expected for the complexes?

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter20: Chemistry Of Selected Transition Elements And Coordination Compounds

Section20.7: Crystal-field Theory: Color And Magnetism In Coordination Compounds

Problem 20.13CE

See similar textbooks

Related questions

Q: Rhol(PPhs)s 9volume eICCtronsinRn in Cr which are The L-type ligands? Oxidanon State of Rn,cr…

A: The L type ligands in [RhCl(PPh3)3] is PPh3; i.e. triphenylphosphine. The L type ligand in Cr(CO)6…

Q: 7) If you were to use a ligand L that was a stronger field ligand than NH3, what color would you…

A: Step : 1 The required answer is follows as :

Q: So I am working with an octahedral complex that has two weak field ligands (Cl) and 4 strong field…

Q: chelating ligands?

Q: 1.43g sample of the complex [Co(NH3)4CO3]NO3 (MM=249 g/mol) was ignited in a crucible to convert all…

A: Previded amount of sample [Co(NH3)4CO3]NO3=1.43g Molar mass of [Co(NH3)4CO3]NO3=249g/mol Provided…

Q: What is a chelating ligand?

A: Ligands that are having multiple donor sites to form five- to six-membered stable rings with metals…

Q: Amongst the two listed in each question, which complex has a faster ligand exchange rate? Give a…

Q: Why are multidentate ligands preferable to unidentate ligands for complexometric titrations?

A: Ligands are generally negatively charged or neutral species with a lone pair that forms bonds with a…

Q: Describe the types of NO bonds by demonstrating the electrons involved. This is an acid (pi) ligand…

A: The metal uses t2g orbital to form pi bonds with ligands. Pi star orbital of metal is high energy…

Q: [FeL6]* complex (L indicates a monodentate ligand) has a magnetic moment of approximately 1.73 B.M.…

Q: Crystal field splitting energy of the complex [CoBr (en), Cl, is A) 4 B) 5 - - 6. C) -A. 5 3 D) -2A,

A: Crystal field splitting in octahedral complex is into t2g and eg t2g have 3 orbitals and eg have 2…

Q: Explain the stability of the complexes TiCl62- and [Zn(en)3]2+

A: TiCl62- is less stable than [Zn(en)3]+2 because Ethylene Di ammine is bidentate ligand so it will…

Q: Arrange these complexes in order of octahedral splitting energy, A.. Largest A. [Ru(CN),}-…

Q: Which of the following is a π-donor ligand О со OPPh3 O Br O CN- The coordination number of Hg…

A: Transiston metal are those in which last electron enter the d-subshell.

Q: If the ligands are either Cl", ethylenediamine or H₂O, which of the following is TRUE? O a. The…

Q: i. State TWO (2) characteristics of a o-donor ligand. By using one example, explain how to change a…

A: A sigma-donor ligand is a ligand that acts as a Lewis base donating electrons from a lone pair to…

Q: Q3. Calculate the crystal field stabilization energy (in terms of Da) for the complexes:…

A: Applying formula of CFSE =[ x×-0.4+y×0.6]∆° + ZP Where X is no of electrons in t2g Y is no of…

Q: The absorption spectrum of the complex ion [Rh(NH,)6+ has maximum absorbance at 295 nm. Calculate…

A: Given, Maximum absorbance of the ion 295 nm ∆ = hc/ λ = [( 6.626 x 10 -34 Js ) x ( 3 x 10 8 m/s) x…

Q: a) What is the meaning of labil and inert complexes? For the following complexes, order them…

A: “Since you have posted a question with multiple sub-parts, we will solve first three subparts for…

Q: [FeL6]* complex (L indicates a monodentate ligand) has a magnetic m approximately 1.73 B.M. a) What…

A: The electronic configuration is given by, [FeL6]3- i.e. Fe 3+: 18(Ar) 4s0 3d5

Q: What is the effective atomic number of the [Ir(CO)(PPh3)2Cl(NO)]+ complex?

A: Given Complex compound [Ir(CO)(PPh3)2Cl(NO)]+ For calculation of effective atomic number (EAN) EAN…

Q: W, X, Y, and Z are different monodentate ligands.a. Is the square planar [NiWXYZ]2+ optically…

A: a)

Q: 2. Rank the ligands in order of their increasing effect on Act for Cr³+. Do this by looking at the…

Q: Why is CO a stronger ligand than Cl-?

A: The spectrochemical series is a list of ligands based on the strength of their interaction with…

Q: Give the systematic name of this coordination compound. Co(NH,),Cl,: triamminetrichlorocolbalt (III)…

A: The nomenclature of inorganic complexes is done according to the following rules: a) The name of the…

Q: In the given complex of [Fe(CO)6] having CO ligand, carbon and oxygen both having lone pair of…

A: if wae observe the carbon monoxide molecule it has a dative bond.

Q: How many unpaired electrons are in the low-spin octahedral complex [Co(CN),Jª¯? Provide your answer…

A: The no. Of unpaired electron in given complex = 1 (one).

Q: 1) Why are lanthanide complexes always weak field in nature , second and third d-transition metal…

A: Hey, since there are multiple questions posted, we will answer first question. If you want any…

Q: 1) In accordance to Crystal Field Theory (CFT): Explain in details the difference between [Fe(CN),]…

Q: 1). What is chelate effect and why does it occur? Give an example for bidentate ligand along with…

A: When a coordination compound contains chelate ligands, then the Stability of coordination compound…

Q: 4. UV-visible spectroscopy provides information about cobalt(III) complexes. A blue cobalt complex…

A: UV-Visible spectroscopy deals with the electronic transitions of a molecule. The absorbance of a…

Q: Write the valence electron configuration for the cobalt ions in the complexes [CoCl4]2- and draw…

Q: a) Draw the lewis structure of the nitrate ion and discuss its potential to serve as an ambidentate…

A: Ambidentate Ligand : This are one type of monodentate ligands having two different donar atoms, that…

Q: Which ion would you expect to have the largest crystal field splitting, A? strong weak CN,CO NO₂ en…

A: "To get remaining sub-parts solved please repost the complete question and mention the sub-parts to…

Q: The maximum absorption for the complex ion [Co(NH3 )6 ] 3+ is located at 470 nm. A) Predict the…

A: The wavelength absorbed by the complex is 470 nm Color of the coordination complex will be…

Q: Given the colors observed for VO43- (orthovanadate ion), CrO42- (chromate ion), and MnO4-…

A: The color of VO43- (orthovanadate ion) is pale yellow. The color of CrO42- (chromate ion) is strong…

Q: The ion [Fe(CN)6]3- has one unpaired electron, whereas[Fe(NCS)6]3- has five unpaired electrons. From…

A: The coordination complexes can be defined as the complex compounds which have coordinate linkage…

Q: Elucidate the bonding of the following complexes according to the valence-bond theory approach: (a)…

A: Valence bond theory is used to determine the bonding in atoms of a molecule by overlapping of their…

Q: 1. Draw two possible resonance structures for DMSO, where S is the central atom. What kind of bond…

A: 1. DMSO means dimethyl sulfoxide contains two S-Me and one S=O with one l.p. on S atom. It's…

Q: The complex (Fe(H,O)]* is paramagnetic. Is the H,0 ligand inducing a strong or weak field?

A: The coordination complex is the compound that does not lose its identity in the solution. The…

Q: b) Experimentally, it is found that the value of Ao varies with the chemical nature of the ligand…

A: In presence of the strong ligand (CO) the value of the crystal field splitting energy is higher and…

Q: b) Consider (Co(CI).F and (Co(NH3)e]* ions. i. Illustrate the energy level splitting diagram for…

A: Since Cl is weak field ligand then the complex shows high spin And NH3 is strong field ligand shows…

Q: (b) Which copper complex ion is colourless? O A [CuCl] I B [CuClj²- O C [Cu(H,O),J** 2+ O D…

A: Cu+ ion has a d10 configuration and all eg orbitals are filled. There is no transition between the…

Q: 3- The gap between the higher and lower energy levels is called the crystal-field splitting energy…

A: Strong field ligands cause a greater splitting of the d-orbitals of the central metal atom, than the…

Q: Broad absorption bands are characteristics of the spectra of transition metal complexes. Discuss the…

A: Transition metal atoms give broad peaks in spectra due to vibronic coupling i.e vibration of bonds…

Q: A, B, C, and D are four different ligands, draw all possible structures of geometric isomers for…

A: In square - planar complex- All the four ligand are different i.e A, B, C, and DThe complex is Pt…

Q: The octahedral complex ion [Co(NH3)6]** has fewer unpaired spins than the octahedral complex ion…

Concept explainers

Atomic Structure

The basic structure of an atom is defined as the component-level of atomic structure of an atom. Precisely speaking an atom consists of three major subatomic particles which are protons, neutrons, and electrons. Many theories have been stated for explaining the structure of an atom.

Shape of the D Orbital

Shapes of orbitals are an approximate representation of boundaries in space for finding electrons occupied in that respective orbital. D orbitals are known to have a clover leaf shape or dumbbell inside where electrons can be found.

Question

a) Do you expect a distortion for [Ti(H2O),]³* and [CoCl]³-
b) What type of distortion would be expected for the complexes?

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Two different compounds are known with the formula Pd(py)2Cl2, but there is only one compound with the formula Zn(py)2Cl2. The symbol py is for pyridine, a mono-dentate ligand. Explain the differences in the Pd and Zncompounds.
Would you expect salts of the gold(I) ion, Au+, to be colored? Explain.
Is it possible for a complex of a metal in the transition series to have six unpaired electrons? Explain.
What is the mass percent of sulfur in the [Ag(SCN)2-]complex ion?
Four different octahedral chromium coordination compounds exist that all have the same oxidation state for chromium and have H2O and Cl as the ligands and counterions. When 1 mole of each of the four compounds is dissolved in water, how many moles of silver chloride will precipitate upon addition of excess AgNO3?
Experiments show that K4[Cr(CN)6] is paramagnetic and has two unpaired electrons. The related complex K4[Cr(SCN)6] is paramagnetic and has four unpaired electrons. Account for the magnetism of each compound using the ligand field model. Predict where the SCN ion occurs in the spectro-chemical series relative to CN.