Aqueous hydrobromic acid (HBr) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium bromide (NaBr) and liquid water (H,O). What is the theoretical yield of water formed from the reaction of 4.9 g of hydrobromic acid and 3.6 g of sodium hydroxide? Round your answer to 2 significant figures.

Aqueous hydrobromic acid (HBr) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium bromide (NaBr) and liquid water (H,O). What is the theoretical yield of water formed from the reaction of 4.9 g of hydrobromic acid and 3.6 g of sodium hydroxide? Round your answer to 2 significant figures.

World of Chemistry, 3rd edition

3rd Edition

ISBN:9781133109655

Author:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Chapter9: Chemical Quantities

Section: Chapter Questions

Problem 71A

See similar textbooks

Similar questions

3.50 A test of an automobile engine's exhaust revealed that g of NO2 was emitted in 10 minutes of operation. How many moles of NO2 would this engine release if it were used for a 45-minute commute, assuming that this mea- sured number is representative of the emission under all circumstances?
3.81 The particulate scale drawing shown depicts the products of a reaction between H2 and O2 molecules. (a) Draw a similar representation for the reactants that must have been present before the reaction took place. (b) Write a balanced chemical equation for the reaction, using the smallest possible whole number coefficients.
For each of the following balanced reactions, calculate how many moles of each product would be produced by complete conversion of 0.50 mole of the reactant indicated in boldface. Indicate clearly the mole ratio used for the conversion. msp;2H2O(l)2H2O(l)+O2(g) msp;2KClO3(s)2KCl(s)+3O2(g) msp;2Al(s)+6HCl(aq)2AlCl3(aq)+3H2(g) msp;C3H8(g)+5O2(g)3CO2(g)+4H2O(g)
3.82 The particulate scale drawing shown depicts the products of a reaction between N2 and O2 molecules. (a) Draw a similar representation for the reactants that must have been present before the reaction took place. (b) Write a balanced chemical equation for the reaction, using the smallest possible whole number coefficients.
One way to remove nitrogen oxide (NO) from smoke-stack emissions is to react it with ammonia. 4NH3(g)+6NO(g)5N2(g)+6H2O(l) Calculate (a) the mass of water produced from 0.839 mol of ammonia. (b) the mass of NO required to react with 3.402 mol of ammonia. (c) the mass of ammonia required to produce 12.0 g of nitrogen gas. (d) the mass of ammonia required to react with 115 g of NO.
For each of the following unbalanced chemical equations, suppose 25.0 g of each reactant is taken. Show by calculation which reactant is limiting. Calculate the theoretical yield in grams of the product in boldface. msp;C2H5OH(l)+O2(g)CO2(g)+H2O(l) msp;N2(g)+O2(g)NO(g) msp;NaClO2(aq)+Cl2(g)NaCl(aq) msp;H2(g)+N2(g)NH3(g)
About 5 billion kilograms of benzene, C6H6, are made each year. Benzene is used as a starting material for many other compounds and as a solvent (although it is also a carcinogen, and its use is restricted). One compound that can be made from benzene is cyclohexane, C6H12. C6H6() + 3 H2(g) C6H12() rH = 206.7 kJ/mol-rxn; rS = 361.5 J/K mol-rxn Is this reaction predicted to be product-favored at equilibrium at 25 C? Is the reaction enthalpy- or entropy-driven?
Aqueous sulfuric acid H2SO4 reacts with solid sodium hydroxide NaOH to produce aqueous sodium sulfate Na2SO4 and liquid water H2O . What is the theoretical yield of water formed from the reaction of 2.0g of sulfuric acid and 2.3g of sodium hydroxide? Round your answer to 2 significant figures.
Aqueous sulfuric acid H2SO4 reacts with solid sodium hydroxide NaOH to produce aqueous sodium sulfate Na2SO4 and liquid water H2O. What is the theoretical yield of water formed from the reaction of 8.8g of sulfuric acid and 9.7g of sodium hydroxide? Be sure your answer has the correct number of significant digits in it.
Aqueous sulfuric acid H2SO4 reacts with solid sodium hydroxide NaOH to produce aqueous sodium sulfate Na2SO4 and liquid water H2O . What is the theoretical yield of water formed from the reaction of 0.98g of sulfuric acid and 0.50g of sodium hydroxide?Be sure your answer has the correct number of significant digits in it.
Aqueous hydrochloric acid HCl reacts with solid sodium hydroxide NaOH to produce aqueous sodium chloride NaCl and liquid water H2O. What is the theoretical yield of water formed from the reaction of 4.0g of hydrochloric acid and 3.8g of sodium hydroxide?Round your answer to 2 significant figures.
Aqueous hydrobromic acid (HBr) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium bromide (NaBr) and liquid water (H2O). If 22.4g of sodium bromide is produced from the reaction of 75.2g of hydrobromic acid and 10.0g of sodium hydroxide, calculate the percent yield of sodium bromide.Be sure your answer has the correct number of significant digits in it.