Consider the formation of Ni(en)3]2+ from Ni(H20)6]+. The stepwise AG values at 298 K are AG1 for first step =-42.9 kJ - mol-1 AG2 for second step =-35.8 kJ - mol-1 AG3 for third step =-24.3 kJ - mol- 12+ Calculate the overall formation constant (Kf) for the complex Ni(en)3].

Consider the formation of Ni(en)3]2+ from Ni(H20)6]+. The stepwise AG values at 298 K are AG1 for first step =-42.9 kJ - mol-1 AG2 for second step =-35.8 kJ - mol-1 AG3 for third step =-24.3 kJ - mol- 12+ Calculate the overall formation constant (Kf) for the complex Ni(en)3].

Fundamentals Of Analytical Chemistry

9th Edition

ISBN:9781285640686

Author:Skoog

Publisher:Skoog

Chapter17: Complexation And Precipitation Reactions And Titrations

Section: Chapter Questions

Problem 17.12QAP

See similar textbooks

Related questions

Q: Describe how the structures of the following can be described in terms of the simple structures…

Q: (a) In early studies it was observed that when the complex [Co(NH3)4Br2]Br was placed in water, the…

A: Isomerism in coordination complexes in which one of ligand molecule is replaced by a solvent…

Q: What is the oxidation number of the central metal ion in each of the following complexes or…

A: Ans. (+2,+3,+1)

Q: Which of the following compounds is expected to have the lowest K₂ (complex dissociation constant)?…

A: A multiple choice question based on coordination complexes that is to be accomplished.

Q: his is the lab with my data sheet and please answer all of them. Thank you and please answer all of…

A: The equilibrium is a state at which two spontaneous reactions takes place at same rate in opposing…

Q: (Q61) Platinum cations in solution readily form complexes with free chloride anions in solution…

A: Given : Kf = 1.0 x 1016 Initial [Pt+2] = 0.0127 M [NaCl] = [Cl-] = 0.419 M

Q: Which of the following colorful octahedral complex ion solutions should have the longest Amax ? More…

A: In a complex upon absorbing the light the compound shows the colour . Depending on their CF…

Q: Write the formation constant expression for [Co(ox)3]3-. The oxalate ligand has a charge of -2.

A: The reaction involving the formation of [Co(ox)3]3- is as follows: Co+3 +3 ox2-→[Co(ox)3]3-

Q: 17. What do you observe when aqueous ammonia is added slowly to aqueous copper Il sulphate until the…

A: 17. What is observed when aqueous ammonia is added to aqueous copper(II) sulphate until the ammonia…

Q: A complex ion has been observed which starts with a violet color with six aqua ligands attached. It…

A: In transition metal complexes the d orbital of the central metal ion gets split into two sets of…

Q: 7. Consider the following complexes and enter the requested numbers in (a) and (b): PMes PMes Bu Bu…

A: There are some coordination complexes molecules. We have to calculate the total eletrons count…

Q: 5. Complex ion [Cu(NH3)4]?* 1M. This complex decomposes in acidic medium via the following reaction:…

A: In the given reaction Kf=10^12 We have to calculate the ph ar which 99% will be dissociates.…

Q: Calculate the solubility of the slightly soluble salts of Cr(OH)2 and Cr(OH)3. What would you…

A: The question is based on the concept of solubility product Principle. it states that a weak…

Q: R CH, CHa NH H,C NH CH, CH, HN CHa "CHa HC он

A: This structure is of Coenzyme Vit B12. Vitamin B12 is the most chemically complex of all the…

Q: Provide a name for the following complex ion:[Co(NO2)6]^3-

Q: What is crystal field theory?Briefly discuss the colors of transmission Metal Complexes.

A: The Crystal Field Theory (CFT) is a model for the bonding interaction between transition metals and…

Q: Provide a name for the following complex ion:[Fe(NH3)6]^3+

A: Naming an inorganic complex ion.Rules to follow,Name the ligands in alphabetical order prior to…

Q: The absorption spectrum of the complex ion [Rh(NH,)6+ has maximum absorbance at 295 nm. Calculate…

A: Given, Maximum absorbance of the ion 295 nm ∆ = hc/ λ = [( 6.626 x 10 -34 Js ) x ( 3 x 10 8 m/s) x…

Q: Which of the following ligands could form chelates? Indicate also the donor atom for each ligand.…

A: Chelating ligand is defined as a ligand which has more than one donor site and can attach with the…

Q: 6. In acidic soils, dissolved Al3+ undergoes a complex formation reaction with S0,2- to form…

Q: 3 - What is the correct order of the crystal field splitting energies for the following complex…

A: In an octahedral complex the d orbital of the central metal ion divided into two sets of different…

Q: Solve this question

A: The elements present in between s and p-block elements in the periodic table are termed as…

Q: 9b. Name the complex ion Cr(CN)(NO₂)(H₂O)(NH3] and note that it can exhibit chiral properties. There…

Q: 2) Using the stepwise formation constants given, calculate the net formation constant for the…

A: The stepwise complexation of Cu2+ and en (H2NCH2CH2NH2) are - Cu2+ +…

Q: Construct the octahedral crystal-field splitting diagram for the metal in each species. V(H,O),*…

Q: (i) Draw the geometrical isomers of complex [Pt(NH3)2Cl2].(ii) On the basis of crystal field theory,…

A: The coordination complexes can be defined as the complex compounds which have coordinate linkage…

Q: The octahedral complex ion [MNCI]³¯ has more unpaired spins than the octahedral complex ion…

A: In case of CFT, concept of strong ligand and weak ligand arises in case of pairing energy and…

Q: For the aqueous [Ag(CN)2]^- complex Kf =3.0x10^20 at 25°C.Suppose equal volumes of 0.0068M AgNO3…

A: Let us assume that volume of AgNO3 = Volume of KCN =V L.So, number of moles of AgNO3 = (molarity of…

Q: Consider the coordination complex with the formula [CoBr(NH3)5]SO4. Identify the Lewis acid(s) and…

A: 1- cordination compounds are define a Lewis acid and Lewis base.. Lewis acid -electron accept but…

Q: Which of the following complex ions has geometric isomers? explain a) [Co(NH3)6]³+ b) [Co(en)3]³+ c)…

A: For geometrical isomerism all the ligand should not be same.

Q: Which of the following colorful octahedral complex solutions should have the longest Amax? Mn(CO)62…

Q: The term free ion of metal contained in [Ti(H2O)6]3+ is.......... (atomic no. of Ti = 22) A. 2F B.…

A: Since you have posted multiple questions, we are entitled to answer the first only. 17) The complex…

Q: A metal complex solution that absorbs orange (650 nm) and yellow (570 nm) light will appear as a…

A: The three traditional sets of complementary colors, as derived from the Red-Yellow-Blue color model,…

Q: Elucidate the bonding of the following complexes according to the valence-bond theory approach: (a)…

A: As there are four ligand attached to nickel so molecule has either tetrahedral or square planar…

Q: Answer the following questions related to the complex ions shown in the figure. Notice that there…

A: The nomenclature and oxidation state of the coordination compounds can be evaluated by the rules of…

Q: What is the charge on each of the following complex ions? hexaaquairon(II), [Fe(H2O)6]?…

A: 1.) Charge on hexaaquairon(II) Is +2 The oxidation state or charge on the central metal ion, Fe =…

Q: Write the balanced net ionic equation for the reaction of Fe3+ and NaF. Explain, in your own words,…

A: The net ionic equation for the reaction of Fe3+ and NaF is, Fe3+(aq) + 6NaF(s) --->…

Q: Calculate the standard potential for the half-reaction: Al(C204)2 + 3e - Al(s) + 2C2042- if the…

Q: The complex formation reaction is given by: Ca^2+ + EDTA = CaY^2- 1.Calculate the…

A: Solution - According to the question - Given - Given reaction - Ca^2+ + EDTA = CaY^2- 10^10.65 =…

Q: Account for the trend in acidity of the following complexes: [Fe(0H2)6]²+ < [Fe(0H2)6]³+ < [Al(0H2)6…

A: Introduction: According to Bronsted theory, the acidity of a substance is defined as the ability of…

Q: (i) Plot the species distribution diagram for chloro complexation of lead (Pb) based on the log of…

Q: The equilibrium is Fe3+ + SCN- [FeSCN]2+. The Fe3+ is a pale yellow colour and the complex ion…

A: The equilibrium is a state at which two spontaneous reactions takes place at same rate in opposing…

Q: The reaction between iron and thiocyanate ions involves this equation: Fe3+ (aq) + SCN" (aq) =…

Q: Calculate the standard potential E0 for the process Ni(CN)42- + 2e- ⇄ Ni(s) + 4CN- given that the…

Q: What following factor affect the stability constant of metal complexes? equilibrium concentration…

A: Given What following factor affect the stability constant of metal complexes? equilibrium…

Q: As a result of the colour change, what can be concluded about the [FeSCN2+(aq)]? Explain. Explain…

A: "Since there are multiple sub-parts in this question and it is not mentioned that which one has to…

Q: The formation constant for Ni(en)32+ is 4.0 x 1017, what is the value of the dissociation constant…

A: Any reaction which is spontaneous in nature forms stable product and due to which the value of their…

Concept explainers

Atomic Structure

The basic structure of an atom is defined as the component-level of atomic structure of an atom. Precisely speaking an atom consists of three major subatomic particles which are protons, neutrons, and electrons. Many theories have been stated for explaining the structure of an atom.

Shape of the D Orbital

Shapes of orbitals are an approximate representation of boundaries in space for finding electrons occupied in that respective orbital. D orbitals are known to have a clover leaf shape or dumbbell inside where electrons can be found.

Question

Consider the formation of Ni(en)3]2+ from Ni(H20)6]+. The stepwise AG values at 298 K are
AG1 for first step =-42.9 kJ - mol-1
AG2 for second step
=-35.8 kJ - mol-1
AG3 for third step =-24.3 kJ - mol-
12+
Calculate the overall formation constant (Kf) for the complex Ni(en)3].

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

The transition metals form a class of compounds called metal carbonyls, an example of which is the tetrahedral complex Ni(CO)4. Given the following thermodynamic data (at 298 K): (a) Calculate the equilibrium constant for the formation of Ni(CO)4(g) from nickel metal and CO gas. (b) Is the reaction of Ni(s) and CO(g) product- or reactant-favored at equilibrium? (c) Is the reaction more or less product-favored at higher temperatures? How could this reaction be used in the purification of nickel metal?
Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
Use the formation constant of [Au(CN)2] in Appendix K to determine the equilibrium concentration of Au+(aq) in a solution that is 0.0071 M CN and 1.1 104 M [Au(CN)2]. Is it reasonable to conclude that 100% of the gold in solution is present as the [Au(CN)2] complex ion? Explain.
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
The standard reduction potential for the reaction [Co( H 2 O)6]3+(aq)+e[CO( H 2 O)6]2+(aq) is about 1.8 V. The reduction potential for the reaction [Co( NH 3 )6]3+(aq)+e[Co( NH 3 )6]2+(aq) is +0.1 V. Calculate the cell potentials to show whether the complex ions,. [Co( H 2 O)6]2+ and or [Co( NH 3 )6]2+, can be oxidized to the corresponding Cobalt (III) complex by oxygen.
Ethylenediaminetetraacetate (EDTA4 ) is used as a complexing agent in chemical analysis with the structure shown in Fig. 21.7. Solutions of EDTA4 are used to treat heavy metal poisoning by removing the heavy metal in the form of a soluble complex ion. The complex ion virtually prevents the heavy metal ions from reacting with biochemical systems. The reaction of EDTA4 with Pb2+ is Pb2+(aq) + EDTA4(aq) iPbEDTA2(aq) K = 1.1 1018 Consider a solution with 0.010 mol of Pb(NO3)? added to 1.0 L of an aqueous solution buffered at pH = 13.00 and containing 0.050 M Na1EDTA. Does Pb(OH)2 precipitate from this solution? [Ksp for Pb(OH)2 = 1.2 1015.
Five-coordinate coordination complexes are known, including [CuCl5]3 and [Ni(CN)5]3. Write the structuralformulas and identify a plausible geometry for thesecomplexes.
The energy of the absorption band in the electronic spectrum of the [Ti(H2O)6]3+ complex is 20300cm-1. This complex is about 32.4 kJ/mol more stable than the [Ti(H2O)4]3+ complex. Show this situation by making the necessary calculations.