Consider the reaction N2(g) + 2H2O(1)–→2NO(g) + 2H2(g) for which AH° = 752.2 kJ and AS° = 351.6 J/K at 298.15 K. (1) Calculate the entropy change of the UNIVERSE when 1.844 moles of N2(g) react under standard conditions at 298.15 K. ASuniverse = J/K (2) Is this reaction reactant or product favored under standard conditions? (3) If the reaction is product favored, is it enthalpy favored, entropy favored, or favored by both enthalpy and entropy? If the reaction is reactant favored, choose 'reactant favored'.

Consider the reaction N2(g) + 2H2O(1)–→2NO(g) + 2H2(g) for which AH° = 752.2 kJ and AS° = 351.6 J/K at 298.15 K. (1) Calculate the entropy change of the UNIVERSE when 1.844 moles of N2(g) react under standard conditions at 298.15 K. ASuniverse = J/K (2) Is this reaction reactant or product favored under standard conditions? (3) If the reaction is product favored, is it enthalpy favored, entropy favored, or favored by both enthalpy and entropy? If the reaction is reactant favored, choose 'reactant favored'.

Chemistry & Chemical Reactivity

9th Edition

ISBN:9781133949640

Author:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Publisher:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Chapter18: Principles Of Chemical Reactivity: Entropy And Free Energy

Section18.5: Entropy Changes And Spontaneity

Problem 3RC

See similar textbooks

Similar questions

What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the explosive decomposition of TNT? Use your knowledge of TNT and the chemical equation, particularly the phases, to answer this question. (Thermodynamic data for TNT are not in Appendix G.) 2C7H5N3O6(s) 3N2(g) + 5H2O() + 7C(s) + 7CO(g)
Calculate the standard Gibbs free-energy change when SO3 forms from SO2 and O2 at 298 K. Why is sulfur trioxide an important substance to study? (Hint: What happens when it combines with water?)
The standard molar entropy of methanol vapor, CH3OH(g), is 239.8 J K1 mol-1. (a) Calculate the entropy change for the vaporization of 1 mol methanol (use data from Table 16.1 or Appendix J). (b) Calculate the enthalpy of vaporization of methanol, assuming that rS doesnt depend on temperature and taking the boiling point of methanol to be 64.6C.
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the formation of hydrogen sulfide from the elements? H2(g)+18S8(s)H2S(g)
In the thermodynamic definition of a spontaneous process, why is it important that the phrase “continuous intervention” be used rather than just “intervention?”
Appendix J lists standard molar entropies S, not standard entropies of formation rS. Why is this possible forentropy but not for internal energy, enthalpy, or Gibbsfree energy?
The synthesis of glucose directly from CO2 and H2O and the synthesis of proteins directly from amino acids are both non-spontaneous processes under standard conditions. Yet it is necessary for these to occur for life to exist. In light of the second law of thermodynamics, how can life exist?
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the combustion of acetaldehyde? CH3CHO(l)+52O2(g)2CO2+2H2O(l)
Explain why absolute entropies can be measured.
Billions of pounds of acetic acid are made each year, much of it by the reaction of methanol with carbon monoxide. (AssumeT= 298 K.) CH3OH() + CO(g) CH3COOH() (a) By calculating the standard Gibbs free energy change, rG, for this reaction, show that it is product-favored. (b) Determine the standard Gibbs free energy change, rG,for the reaction of acetic acid with oxygen to form gaseous carbon dioxide and liquid water. (c) Based on this result, is acetic acid thermodynamicallystable compared with CO2(g) and H2O()? (d) Is acetic acid kinetically stable compared with CO2(g)and H2O()?
For ammonia (NH3), the enthalpy of fusion is 5.65 kJ/mol and the entropy of fusion is 28.9 J/K mol. a. Will NH3(s) spontaneously melt at 200. K? b. What is the approximate melting point of ammonia?