For the below reaction: 2502(g) + O2(g) → 2503(g) AG° = -142 kJ mol-1 at 298K Rate = k[SO2][SO3]¬1/2 Consider the following statements based on the information provided and knowledge of chemical kinetics. I. Since AG = -142 kJ mol-1, the conversion of SO2 to SO3 must occur the instant the reactants are combined at 298 K. II. The overall reaction order is + %. III. The rate constant, k , is a function of temperature. IV. The activation energy for this reaction in both the forward and reverse directions will be the same. V. When the rate of consumption of SO2 is 0.02 mol L-15-1 the rate of consumption of O2 will be 0.01 mol L-1s-1 Which of the above statements are correct? O l and Il only O , I, and III only O V and V only O II, IV and V only O II, II and V only

For the below reaction: 2502(g) + O2(g) → 2503(g) AG° = -142 kJ mol-1 at 298K Rate = k[SO2][SO3]¬1/2 Consider the following statements based on the information provided and knowledge of chemical kinetics. I. Since AG = -142 kJ mol-1, the conversion of SO2 to SO3 must occur the instant the reactants are combined at 298 K. II. The overall reaction order is + %. III. The rate constant, k , is a function of temperature. IV. The activation energy for this reaction in both the forward and reverse directions will be the same. V. When the rate of consumption of SO2 is 0.02 mol L-15-1 the rate of consumption of O2 will be 0.01 mol L-1s-1 Which of the above statements are correct? O l and Il only O , I, and III only O V and V only O II, IV and V only O II, II and V only

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter14: Chemical Equilibrium

Section: Chapter Questions

Problem 69P

See similar textbooks

Similar questions

Monochloroethane (C2H5Cl) can be produced by the direct reaction of ethane gas (C2H6) with chlorine gas or by the reaction of ethylene gas (C2H4) with hydrogen chloride gas. The second reaction gives almost a 100% yield of pure C2H5Cl at a rapid rate without catalysis. The first method requires light as an energy source or the reaction would not occur. Yet G for the first reaction is considerably more negative than G for the second reaction. Explain how this can be so.
Consider the reaction 2SO2(g)+O2(g)2SO3(g) (a) Calculate G at 25C. (b) If the partial pressures of SO2 and SO3 are kept at 0.400 atm, what partial pressure should O2 have so that the reaction just becomes nonspontaneous (i.e., G=+1.0 k J)?
Why are there no changes specified for Ni in Exercise 13.61, part (f)? What property of Ni does change?
If wet silver carbonate is dried in a stream of hot air. the air must have a certain concentration level of carbon dioxide to prevent silver carbonate from decomposing by the reaction Ag2CO3(s)Ag2O(s)+CO2(g) H for this reaction is 79.14 kJ/mol in the temperature range of 25 to 125C. Given that the partial pressure of carbon dioxide in equilibrium with pure solid silver carbonate is 6.23 103 torr at 25C, calculate the partial pressure of CO2 necessary to prevent decomposition ofAg2CO3 at 110C. (Hint: Manipulate the equation in Exercise 79.)
The equilibrium constant for the butane iso-butane equilibrium at 25 C is 2.50. Calculate rG at this temperature in units of kJ/mol.
Carbon dioxide decomposes into CO and O2 at elevated temperatures. What is the equilibrium partial pressure of oxygen in a sample at 1000 C for which the initial pressure of CO2 was 1.15 atm?
Predict the temperature at which the reaction in Exercise 17.67 comes to equilibrium. Consider the equation G = H TS. At some value of T, G equals zero and the reaction is at equilibrium. Set G = 0, substitute for H and S (assuming that they do not vary much with temperature) and solve for T. CH3CHO(l)+52O2(g)2CO2(g)+2H2O(l)
For the following reaction C(s)+2H2(g)CH4(g) K=0.26 at 1000C (3 significant figures). What is the equilibrium constant at 750C (3 significant figures)?
For the given chemical equilibrium, these data are determined experimentally: T K 350K 3.76102 450K 1.86101 Determine H for this reaction.
5.12. True or false: If all the partial pressures of reactants and products drop by half, the value of Q drops by half. Give an example of a chemical reaction to support your answer.
In the text, the equation G=G+RTIn(Q) was derived for gaseous reactions where the quantities in Q were expressed in units of pressure. We also can use units of mol/L for the quantities in Q, specifical.ly for aqueous reactions. With this in mind, consider the reaction HF(aq)H+(aq)+F-(aq) for which Ka = 7.2 104 at 25C. Calculate G for the reaction under the following conditions at 25C. a. [HF] = [H+] = [F] = 1.0 M b. [HF] = 0.98 M, [H+] = [F] = 2.7 102M c. [HF] = [H+] = [F] = 1.0 105 M d. [HF] = [F] = 0.27 M, [H+] = 7.2 104M e. [HF] = 0.52 M, [F] = 0.67 M, [H+] = 1.0 103M Based on the calculated G values, in what direction will the reaction shift to reach equilibrium for each of the five sets of conditions?
At 1 atm, liquid water is heated above 100C. For this process, which of the following choices (iiv) is correct for Ssurr? S? Suniv? Explain each answer. i. greater than zero ii. less than zero iii. equal to zero iv. cannot be determined