For the following reaction, 6.92 grams of carbon (graphite) are mixed with excess oxygen gas . The reaction yields 16.5 grams of carbon dioxide carbon (graphite) (s) + oxygen ( g ) → carbon dioxide ( g ) What is the theoretical yield of carbon dioxide ? grams What is the percent yield for this reaction ? Submit Answer Try Another Version 3 item attempts remaining

For the following reaction, 6.92 grams of carbon (graphite) are mixed with excess oxygen gas . The reaction yields 16.5 grams of carbon dioxide carbon (graphite) (s) + oxygen ( g ) → carbon dioxide ( g ) What is the theoretical yield of carbon dioxide ? grams What is the percent yield for this reaction ? Submit Answer Try Another Version 3 item attempts remaining

Introductory Chemistry: An Active Learning Approach

6th Edition

ISBN:9781305079250

Author:Mark S. Cracolice, Ed Peters

Publisher:Mark S. Cracolice, Ed Peters

Chapter10: Quantity Relationships In Chemical Reactions

Section: Chapter Questions

Problem 70E: Classify each of the following statements as true or false: a Coefficients in a chemical equation...

See similar textbooks

Similar questions

Consider the following reaction: 4NH3(g)4NO(g)+6H2O(g) If a container were to have 10 molecules of O2 and 10 molecules of NH3 initially, how many total molecules (reactants plus products) would be present in the container after this reaction goes to completion?
Classify each of the following statements as true or false: a Coefficients in a chemical equation express the molar proportions among both reactants and products. b A stoichiometry problem can be solved with an unbalanced equation. c In solving a stoichiometry problem, the change from quantity of given substance to quantity of wanted substance is based on masses. d Percentage yield is actual yield expressed as a percentage of ideal yield. e The quantity of product of any reaction can be calculated only through the moles of the limiting reactant. f rH is positive for an endothermic reaction and negative for an exothermic reaction.
Consider the following unbalanced chemical equation for the combustion of pentane (C5H12): :math>C5H12(l)+O2(g)CO2(g)+H2O(l) a 20.4-gram sample of pentane is burned in excess oxygen, what mass of water can be produced, assuming 100% yield?
4.36 Sometimes students in chemistry labs determine percentage yields greater than 100%. Assuming there is no calculation error, how could this happen?
Copper(II) sulfate has been used extensively as a fungicide (kills fungus) and herbicide (kills plants). Copper(II) sulfate can be prepared in the laboratory by reaction of copper(II) oxide with sulfuric acid. The unbalanced equation is :math>CuO(s)+H2SO4(aq)CuSO4(aq)+H2O(l) 2.49 g of copper(II) oxide is treated with 5.05 g of pure sulfuric acid, which reactant would limit the quantity of copper(II) sulfate that could be produced?
You have seven closed containers, each with equal masses of chlorine gas (Cl2) . You add 10.0 g of sodium to the first sample, 20.0 g of sodium to the second sample, and so on (adding 70.0 g of sodium to the seventh sample). Sodium and chlorine react to form sodium chloride according to the equation 2Na(s)+Cl22NaCl(s) After each reaction is complete, you collect and measure the amount of sodium chloride formed. A graph of your results is shown below. Answer the following questions: a. Explain the shape of the graph. b. Calculate the mass of NaCl formed when 20.0 g of sodium is used. c. Calculate the mass of Cl2 in each container. d. Calculate the mass of NaCl formed when 50.0 g of sodium is used. e. Identify the leftover reactant, and determine its mass for parts b and d above.
Nitrogen (N2) and hydrogen (H2)react to form ammonia (NH3). Consider the mixture of N2 and H2 in a closed container as illustrated below: Assuming the reaction goes to completion, draw a representation of the product mixture. Explain how you arrived at this representation.
Explain how one determines which reactant in a process is the limiting reactant. Does this depend only on the masses of the reactant present? Give an example of how to determine the limiting reactant by using a Before-Change-After (RCA) table with a balanced chemical equation and reactant starling amounts.
Alkali metal hydroxides are sometimes used to “scrub” excess carbon dioxide from the air in closed spaces (such as submarines and spacecraft). For example, lithium hydroxide reacts with carbon dioxide according to the unbalanced chemical equation :math>LiOH(s)+CO2(g)Li2CO3(s)+H2O(g) ppose a lithium hydroxide canister contains 155 g of LiOH(s). What mass of CO2(g)will the canister be able to absorb? If it is found that after 24 hours of use the canister has absorbed 102 g of carbon dioxide, what percentage of its capacity has been reached?
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.