Q: Consider the reaction shown. 4 HCI(g) +0,(g)- 2Cl,(g) + 2H,O(g) Calculate the number of grams of Cl,…
A: Since oxygen gas is present in excess, it is the excess reagent and HCl is the limiting reagent in…
Q: For the reaction N2 + 3H2 = 2NH3, if you have 2.00 moles N2 and 4.00 of H2: How many moles of NH3…
A: The balanced chemical equation for the formation of ammonia is given below.
Q: The combustion of ethane (C2H6)(C2H6) produces carbon dioxide and steam.…
A:
Q: Al(s)+O2(g) —— Al2O3(s) What is the mole ratio of aluminum and aluminum oxide?
A: Given:- Al(s) + O2(g)→Al2O3(s) (unbalanced equation) To find: Mole ratio of Al and Al2O3
Q: According to the following reaction, how many moles of nitrogen monoxide will be formed upon the…
A:
Q: How many molecules (not moles) of NH3 are produced from 5.01x10-*g of H2? Express your answer…
A: Given: Mass of H2 = 5.01×10-4 g. Balanced chemical reaction is given by,
Q: Sucrose (C₁₂H₂₂O₁₁) is combusted in air according to the following reaction: C₁₂H₂₂O₁₁(s) + O₂(g) →…
A: Given : Mass of sucrose = 35.4 gram Molar mass of sucrose = 342 gm/mole
Q: Consider the following balanced reaction between hydrogen and nitrogen to form ammonia:…
A:
Q: How many molecules of SO₃ can be formed from 0.83 moles of O₂ (assuming excess SO₂) from the…
A: 2SO₂(g) + O₂(g) → 2SO₃(g) This is required Balanced chemical equation
Q: How many moles of N2 reacted if 0.65 mol of NH3 is produced?
A: Given that :- 0.65 mol of NH3 is produced. We have to find how many moles of N2 required to give…
Q: onsider the following equation: 6CO2 + 6H2O → C6H12O6 + 6O2 How many moles of glucose (C6H12O6) will…
A: Given chemical reaction : 6CO2 + 6 H2O ---> C6H12O6 + 6 O2 MOLES of co2 = 3.0 moles moles of…
Q: Calculate how many moles of Ca(OH), are needed to produce 4.8 x 1024 NH3 molecules, according to the…
A: In the question it is given that the number of molecules of NH3 are 4.8 * 1024. According to the…
Q: How many moles of AlCl3 would be produced if 9.00 moles of HCl is reacted according to the following…
A:
Q: how many moles of NaClNaCl will be produced, if 0.276 mol0.276 mol of BaCl2BaCl2 is allowed to react…
A:
Q: From the unbalanced reaction: B2H6 + O2 HBO2 + H2O How many moles of water are produced from 19.2…
A: The given mass of B2H6 is 19.2 g The molar mass fof B2H6 is 27.66 g/mole
Q: 2KCl2 ? 2KCl + 3O2 How many moles of oxygen gas could be produced from 5.0 moles of KClO3 using the…
A: The reaction of decomposition of KClO3 can be written as follows: 2KClO3 →2KCl + 3O2 From the…
Q: For the reaction between N2 and H2 to make NH3, if 2.0 moles of N2 reacts with 3.0 moles of H2, what…
A: GIVEN: To Find: Limiting reactants=?moles of NH3 produced=? Solution: The Balanced chemical…
Q: reacting
A: Dear student I have given answer to your question in the image format.
Q: The mineral bauxite, which is mostly Al2O3, is the principal industrial source of aluminum metal.…
A: Given, 7.00 ton of Al2O3 1 ton = 907184.74 grams 7 ton = 7x907184.74 grams
Q: 12. For the reaction 2Al + 6HCl → 2AlCl3 + 3H2 How many moles of H2 are produced by the complete…
A: Given Reaction 2Al + 6 HCl → 2AlCl3 + 3H2 Mass of Al = 132 gram Number of mole of…
Q: For the reaction, N2 + 3H2 → 2NH3, if 0.125 mole of N2 reacts, how many moles of H2 will be used?
A:
Q: Given the unbalanced equation, NH4NO2(s) → N2(g) + H2O(l), how many grams of H2O are produced from…
A:
Q: Consider a reaction between 1.27 g of solid manganese and 4.84 g of gaseous oxygen to produce solid…
A: The balanced reaction is, 3 Mn + 2 O2 →Mn3O4
Q: The mineral bauxite, which is mostly Al2O3, is the principal industrial source of aluminum metal.…
A: 1 ton = 106 g So, 9 ton = 9 x 106 g
Q: Indicate how many moles of the second reactant would be required to react with .460 mol of the first…
A: We know that The reaction between Co and P4 occurs to produce Co3P2(s)
Q: Nitrogen and hydrogen combine at a high temperature, in the presence of a catalyst, to produce…
A:
Q: According to the following reaction, how many grams of oxygen gas are necessary to form 0.167 moles…
A: The balanced reaction is as :- C(s) + O2(g) ----> CO2(g) From the above equation, 1 mole of CO2…
Q: 2. If 50.0 grams of Cl2 gas is reacted with enough sodium hydroxide (N2OH), calculate the following:…
A: Given, Mass of Cl2 is 50 grams First write a balanced chemical reaction of Cl2 gas with sodium…
Q: How many molecules of SO₃ can be formed from 0.41 moles of O₂ (assuming excess SO₂) from the…
A: Balanced reaction equation: 2 SO2 (g) + O2 (g) --------> 2 SO3 (g) Moles of O2 = 0.41 mol…
Q: Consider the following balanced reaction between hydrogen and nitrogen to form ammonia:…
A: The given balanced reaction equation is, 3H2(g) +N2(g) --> 2NH3(g) From this reaction we see…
Q: A mixture of C3H8 and C2H2 has a mass of 3.0 g . It is burned in excess O2 to form a mixture of…
A: Combustion reaction: It is a process of burning something in presence of oxygen to produce heat and…
Q: Considered the unbalanced equation: O2(g)+C3H8(g)→CO2(g)+H2O(I) if C3H8 is present in excess how…
A: It is given that a combustion reaction of propane is taking place, to produce carbon dioxide and…
Q: The combustion of ethane (C2H6)(C2H6) produces carbon dioxide and steam.…
A: The given reaction is shown below.
Q: How many moles of N2 reacted if 0.35 mol of NH3 is produced?
A: Given :- N2 + 3 H2 -----> 2 NH3 Number of moles of NH3 = 0.35 mol Number of moles of H2 = 1.6…
Q: How many moles of H₂O can be formed from 4.05 × 10²³ atoms of NH₃ from the following equation? 4 NH₃…
A: Given: Number of NH₃ atoms = 4.05 × 10²³ atoms
Q: Enter your answer in the provided box. Silicon tetrachloride (SiCl4) can be prepared by heating Si…
A: Since you have asked multiple questions, we will solve the first question for you. If you want any…
Q: How many moles of iron (Fe) will be produced from 6.20 moles of carbon monoxide (CO) Fe O, reacting…
A: Balanced Equation Fe2O3 +3CO -----> 2Fe +3CO2 we have, Moles of carbon Monoxide =6.20 moles…
Q: S + 6 HNO3 --> H₂SO4 + 6 NO2 + 2H₂O In the above equation how many moles of H₂SO4 can be made when…
A: given, moles of HNO3 = 46 moles
Q: Nitrogen and hydrogen combine at a high temperature, in the presence of a catalyst, to produce…
A: The considered reaction is expressed as, N2 (g) + 3 H2 (g) →2 NH3(g)
Q: For the reaction HNO3 + Mg(OH)2 → Mg(NO3)2 + H2O, hor many grams of Mg(NO3)2 are produced from 8.00…
A: The given reaction is HNO3 + Mg(OH)2 → Mg(NO3)2 + H2O First balance the given equation. We know…
Q: If 10 atoms of Zn completely react with 10 molecules of I2, how many molecules of ZnI2will result?
A:
Q: For the following reaction, 0.193 moles of sulfur dioxide are mixed with 0.121 moles of water.…
A: The balanced chemical equation is - SO2 + H2O → H2SO3 The limiting reagent is the reagent that is…
Q: For the following cases, determine which reactant is limiting and which is in excess as well as the…
A: Nitrogen reacts with hydrogen to form ammonia. The equation for the balanced chemical reaction is as…
Q: molecules of SO₃
A:
Q: Consider the following reaction: N: + H: - How many moles of ammonia are produced when 6 moles of…
A: • The given balanced chemical equation is, N2 + 3 H2 → 2 NH3 • The values provided…
Q: What is the percent yield if 4.55 g of copper are produced when 1.87 g of aluminum react with an…
A:
Q: How many molecules of SO₃ can be formed from 0.31 moles of O₂ (assuming excess SO₂) from the…
A: Given, an unbalanced chemical reaction as follows,SO2(g)+O2(g)→SO3(g)Number of moles of O2 for…
Q: Consider the conversion of oxygen (O2) to ozone (03). What is the percent yield if 8.0 mol of 02…
A: Percent yield can be calculated by using the formula: Percent Yield =Obtained yieldTheoretical…
Q: Ethanol (C,H,O) is combusted in air according to the following reaction: C,H,O(1) + 0,(g) → CO,.(g)…
A: Combustion Reaction :- When an organic molecule reacts with oxygen it produces water vapor and…
Trending now
This is a popular solution!
Step by step
Solved in 2 steps with 2 images
- A weighed sample of iron (Fe) is added to liquid bromine (Br2) and allowed to react completely. The reaction produces a single product, which can be isolated and weighed. The experiment was repeated a number of times with different masses of iron but with the same mass of bromine (see graph below). (a) What mass of Br2 is used when the reaction consumes 2.0 g of Fe? (b) What is the mole ratio of Br2 to Fe in the reaction? (c) What is the empirical formula of the product? (d) Write the balanced chemical equation tor the reaction of iron and bromine. (e) What is the name of the reaction product? (f) Which statement or statements best describe the experiments summarized by the graph? (i) When 1.00 g of Fe is added to the Br2, Fe is the limiting reagent. (ii) When 3.50 g of Fe is added to the Br2, there is an excess of Br2. (iii) When 2.50 g of Fe is added to the Br2, both reactanu are used up compietely. (iv) When 2.00 g of Fe is added to the Br2, 10.8 g of product is formed. The percent yield must therefore be 20.0%.3.59 The composition of materials such as alloys can be described in terms of mole percentage (mol%), atom percentage (at%), or weight percentage (wt%). Carry out the following conversions among these units. (a) 60 Cu and 40 Al to at%, (b) 25 mol% NiO and 75 mol % MgO to wt%, (C) 40 wt% MgO and 60 wt% Feo to mol %For each of the following balanced chemical equations, calculate how many grams of the product(s) would be produced by complete reaction of 0.125 mole of the first reactant. msp;AgNO3(aq)+LiOH(aq)AgOH(s)+LiNO3(aq) msp;Al2(SO4)3(aq)+3CaCl2(aq)2AlCl3(aq)+3CaSO4(s) msp;CaCO3(s)+2HCl(aq)CaCl2(aq)+CO2(g)+H2O(l) msp;2C4H10(g)+13O2(g)8CO2(g)+10H2O(g)
- Billions of pounds of urea, CO(NH2)2, are produced annually for use as a fertilizer. The principal reaction employed is: 2NH3+CO2CO(NH2)2+H2O By assuming unlimited amounts of CO2, how many moles of urea can be produced from each of the following amounts of NH3? a.2molNH3b.0.45molNH3c.10gNH3d.2.0kgNH3The phosphorus pentoxide used to produce phosphoric acid for cola soft drinks is prepared by burning phosphorus in oxygen. (a) What is the limiting reactant when 0.200 mol of P4 and 0.200 mol of 02 react according to P4+5O2P4O10 (b) Calculate the percent yield if 10.0 g of P4O10 is isolated from the reaction.Fig. 5-5 illustrates a schematic diagram of a combustion device used to analyze organic compounds. Given that a certain amount of a compound containing carbon, hydrogen, and oxygen is combusted in this device, explain how the data relating to the mass of CO2 produced and the mass of H2O produced can be manipulated to determine the empirical formula.
- or each of the following reactions, give the balanced chemical equation for the reaction and state the meaning of the equation in terms of individual molecules and in terms of moles of molecules. msp;MnO2(s)+Al(s)Mn(s)+Al2O3(s) msp;B2O3(s)+CaF2(s)BF3(g)+CaO(s) msp;NO2(g)+H2O(l)HNO3(aq)+NO(g) msp;C6H2(g)+H2C6(g)H12(g)Cyanogen gas, C2N2, has been found in the gases of outer space. It can react with fluorine to form carbon tetrafluoride and nitrogen trifluoride. C2N2(g)+7F2(g)2CF4(g)+2NF3(g)(a) How many moles of fluorine react with 1.37 mol of cyanogen? (b) How many moles of CF4 are obtained from 13.75 mol of fluorine? (c) How many moles of cyanogen are required to produce 0.8974 mol of NF3? (d) How many moles of fluorine will yield 4.981 mol of nitrogen trifluoride?For each of the following balanced equations, indicate how many moles of the product could be produced by complete reaction of 1.00 g of the reactant indicated in boldface. Indicate clearly the mole ratio used for the conversion. msp;NH3(g)+HCl(g)NH4Cl(s) msp;CaO(s)+CO2(g)CaCO3(s) msp;4Na(s)+O2(g)2Na2O(s) msp;2P(s)+3Cl2(g)2PCl3(l)
- Sodium borate decahydrate, Na2B4O710H2O is commonly known as borax. It is used as a deodorizer and mold inhibitor. A sample weighing 15.86 g is heated until a constant mass is obtained indicating that all the water has been evaporated off. (a) What percent, by mass of Na2B4O710H2O is water? (b) What is the mass of the anhydrous sodium borate, Na2B4O7?The coefficients in the chemical reaction 2A+3B products give us a relationship between which of the following: a. grams of A and grams of B b. density of A and density of B c. moles of A and moles of B4.17 Phosgene is a highly toxic gas that has been used as a chemical weapon at times in the past. It is now used in the manufacture of polycarbonates, which are used to make phone cases and plastic eyeglass lenses. Phosgene is produced by the reaction, CO+Cl2COCl2 . Given an excess of carbon monoxide, what mass of chlorine gas must be reacted to form 4.5 g of phosgene?