1:23:110In the reaction A+B C+D, if element B is in excess, thenelement D is the limiting reactantelement A is the limiting reactant.element C is the limiting reactant.element B is the limiting reactant.You have responded to 1 of 10 questions. 1 reSubmit

In the reaction A+B C+D, if element B is in excess, then O element D is the limiting reactant O element A is the limiting reactant. O element C is the limiting reactant. O element B is the limiting reactant. You have responded to 1 of 10 questions 1.

In the reaction A+B C+D, if element B is in excess, then O element D is the limiting reactant O element A is the limiting reactant. O element C is the limiting reactant. O element B is the limiting reactant. You have responded to 1 of 10 questions 1.

Chemistry: Matter and Change

1st Edition

ISBN:9780078746376

Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Publisher:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Chapter11: Stoichiometry

Section: Chapter Questions

Problem 76A

See similar textbooks

Related questions

Q: In the reaction between aluminum and fluorine, 30.0 grams of the product is experimentally obtained…

A: As the aluminum is the limiting reactant then the yield of reaction is depend upon the moles of…

Q: The reaction between A (one large red sphere) and B (one small blue sphere) to produce AB, is shown…

A: Limiting reactant reactant that completely consumed during reaction.

Q: (4.2, Similar to For Practice 4.2) Write balanced equation for the combustion of hexane (C6H14) in…

Q: Balance the following equations: (m) KOH + H3PO4 ⟶ K3PO4 + H2O (n) CH4 +Br2 ⟶CBr4 +HBr

Q: 4Fe + 3O2 ---> 2Fe2O3 You have a bicycle made of iron that you left outside all winter. Iron (Fe)…

A: Rusting is a natural process which takes place, when a metal is kept in open environment and the…

Q: Balance the following equation C7H14O2+ O2 ----> CO2+H2O

Q: Balance the chemical equation below using the smallest possible whole number stoichiometríc…

Q: The drawing below shows a mixture of molecules: key carbon hydrogen nitrogen sulfur охудen chlorine…

A: 1. Given that :

Q: The following diagrams represent the reaction of A2 (shaded spheres) with B2 (unshaded spheres).…

A: Given reaction, A2 reacts with B2

Q: If carbon dioxide is streamed over silicon in the right conditions, you can produce solid carbon and…

A: A balanced chemical reaction is one in which number of atoms of each type are equal in reactants and…

Q: Question - Balance the following chemical equations: NaClO3 ---> NaCl + O2 When you complete…

A: Given, NaClO3 NaCl + O2 Required, Balance the above chemical…

Q: Question - Balance the following chemical equations: C3H18 + O2 ---> CO2 + H2O When you complete and…

A: Recall the reaction --- C8H18 + O2 ----> CO2 + H2O Balanced the following above reaction ---

Q: A sealed container has 4 moles of iron and 4 moles of oxygen inside. which statements are true ?

Q: Given the following equation: complete the required compund. Make sure to include the coefficient…

A: A chemical reaction is said to Balance when the number of atoms on either side of the reaction are…

Q: Question - Balance the following chemical equations: C8H18 + O2 ---> CO2 + H2O When you complete and…

Q: 15. Laboratory analysis of a sample yielded the following data for the combustion of Nickel Ni(s) +…

A: Given, The combustion reaction: Ni(s) + O2(g) -------> Ni O(s)…

Q: 2.56 aluminum foil, Al, reacts with unlimited supply of Oxygen gas produced aluminum oxide, Al203…

A: Molecular mass is given by the sum of the mass of the constituent elements.

Q: Balance the following chemical equations using the smallest whole number coefficients. Fe(s)+…

Q: When the equation _Sio2 +_C - _ Sic +. CO - is correctly balanced using whole-number coefficients,…

A: Given compound balance the reaction Here Sio2 have 1 coefficient Carbon have 3 SiC have 1 CO have 2…

Q: Aluminium reacts with oxygen to form aluminium oxide in a synthesis reaction described by the…

A: The reaction taking place is given as, => Al + O2 -----> Al2O3

Q: Read the information below, then answer the question. A laboratory assistant was experimenting with…

A: Zn : Zinc HCl : Hydrochloric acid ZnCl2 : Zinc chloride H2 : Hydrogen gas

Q: A student sets up and solves the following equation to solve a problem in solution stoichiometry.…

Q: QUESTION 9 Which of the following statements is true? O A. The smallest mass of reactant in a…

A: According to the answering guidelines, I'm posting the solution for the first question. Kindly…

Q: 3.85 Give an everyday example that illustrates the limitingreactant concept.

A: Limiting reactant is a term associated with chemical reactions. In a chemical reaction, the reactant…

Q: According to the following reaction, how many grams of oxygen gas are required for the complete…

A: To solve this problem we will first write the balanced chemical equation then according to this…

Q: (29) When 35.0 kg of SiO2 reacts with 25.3 kg of carbol recovered, what is the percent yield for the…

Q: The mole ratios among the reactants and products in a chemical reaction. empirical formula O formula…

Q: 14) Which set of coefficients correctly balances this chemical equation? Ag+_N, →_Ag,N O 1,1,2 O 3,…

Q: the equation N2 + H2 → NH3, NH3 is? A. reactant B. product C. equation D. subscript Which of…

A: Reactants combine to form products. The answers for the questions relating chemical products and…

Q: Consider the reaction of solid aluminum iodide and potassium metal to form solid potassium iodide…

A: Solid aluminum iodide and potassium metal to form solid potassium iodide and aluminum metal. The…

Q: 2. C,H,,0; + 6CO,– 6H,0 + 60, a) CH,0̟ to 0, b) o, to Co, c) H,0 to CO,

A: C6H12O6 + 6CO2 -----> 6H2O + 6O2 1mole 6mole 6mole 6mole

Q: Balance the following reaction. Use the lowest possible numbers. Be sure to put a number in every…

Q: you were manufacturing ammonia, 3H2+N2 ——>2NH3 and had 6 moles of hydrogen and 1 mole of nitrogen,…

A: Industrial preparation of ammonia is known as the Haber process and it involves the following…

Q: 10. Translate the following written chemical equation to a shorthand chemical equation. Aluminum…

A: General chemistry.

Q: The combustion of methane (carbon tetrahydride) is represented by the following (unbalanced)…

A: The molecular diagram, which represents the oxygen as limiting reactant has to be identified.

Q: element A is the limiting reactant

A: Limiting reagent is the reagent which is in Limiting reagent. i.e. Reactant which consumed first in…

Q: miun reaciant stoIchiomeuy This question will walk you through the steps of calculating the mass of…

A: Given : Mass of Fe2O3= 201g

Q: In the reaction, A + B→C + D, if element B is in excess, then: O both A & B are limiting reactants.…

A: A+B→C+Dit means 1 mole of A require 1mole of B

Q: Mass of watch glass and evaporating dish:67.511 g Mass of watch glass, evaporating dish, and Mg…

A: We are given data for the formation of a chloride product of magnesium from Mg(s) metal. Your…

Q: Iron reacts with oxygen at high temperatures to form iron(II) oxide. 4 Fe(s) + 3 0,(g) 2 Fe,0,(s)…

A: as per Q&A guidelines of portal I solve first image question because it comes under multiple…

Q: Given the balanced reaction: 4NH3 + 502 4NO + 6H2O; If 2.50 g of NH3 and 2.85 g of O2 are combined,…

Q: The reaction of ammonia and oxygen is shown below. 4 NH3(aq) + 5 O2(g) 4 NO(g) + 6 H20(1) In an…

A: a. The limiting reactant here will be O2, as it is present here in lesser amount(mole ratio) as…

Q: 8. The white circles represent H, and the black circles represent N. Reactonts Products 3 H, + 1 N,…

A: Answer

Q: S+ HNO3 → H2SO4+ NO2 + H2O. Balance this chemical equation, finding the smallest possible integer…

A: The given unbalanced chemical reaction is - S + HNO3 ---> H2SO4 + NO2 + H2O Here ,the number of…

Q: Balance the following equation. The coefficients are in order for the substances from left to right.…

Q: Fill in the blanks for the balancing stoichiometric coefficients for the following reaction ____…

Q: The image below shows the reaction between hydrogen and chlorine gas. Based on the starting amounts…

A: Please find your solution below : Limiting reactant in a chemical reaction is a reagent which is…

Q: The balanced reaction of calcium carbonate and hydrochloric acid is as follows: CACO3 (s) + 2…

A: A numerical problem based on quantitative analysis, which is to be accomplished.

Q: 04 Fill in the Blank Drag and Drop Use the reaction below to determine the mass of oxygen needed to…

A: Given combustion reaction of butane in the presence of oxygen ; 2C4H10 + 13O2 ---> 8CO2…

Q: According to the following reaction, how many grams of oxygen gas are required for the complete…

A: Given information, Mass of nitrogen gas is 28.5 g. Write the balanced equation,

Concept explainers

Ionic Equilibrium

Chemical equilibrium and ionic equilibrium are two major concepts in chemistry. Ionic equilibrium deals with the equilibrium involved in an ionization process while chemical equilibrium deals with the equilibrium during a chemical change. Ionic equilibrium is established between the ions and unionized species in a system. Understanding the concept of ionic equilibrium is very important to answer the questions related to certain chemical reactions in chemistry.

Arrhenius Acid

Arrhenius acid act as a good electrolyte as it dissociates to its respective ions in the aqueous solutions. Keeping it similar to the general acid properties, Arrhenius acid also neutralizes bases and turns litmus paper into red.

Bronsted Lowry Base In Inorganic Chemistry

Bronsted-Lowry base in inorganic chemistry is any chemical substance that can accept a proton from the other chemical substance it is reacting with.

Question

1:2
3:1
10
In the reaction A+B C+D, if element B is in excess, then
element D is the limiting reactant
element A is the limiting reactant.
element C is the limiting reactant.
element B is the limiting reactant.
You have responded to 1 of 10 questions. 1 re
Submit

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Atoms of three different elements are represented by O, , and . Which compound is left over when three molecules of O. and three molecules of . react to form O. And O?
Solid calcium carbide (CaC2)reacts with liquid water to produce acetylene gas (C2H2)and aqueous calcium hydroxide. l type='a'> Write the balanced equation for the reaction that is (occurring. including all phases. If a 100.0-g sample of calcium carbide (CaC2)is initially reacted with 50.0 g of water, which reactant is limiting? Prove that mass is conserved for the reactant amounts used in pan b.
What is the limiting reactant when 1.50 g of lithium and 1.50 g of nitrogen combine to form lithium nitride, a component of advanced batteries, according to the following unbalanced equation? Li+N2Li3N
An air bag is deployed by utilizing the following re tion the nitrogen gas produced inflates the air bag): :math>2NaN3(s)2Na(s)+3N2(g) 10.5 g of NaN1 is decomposed, what theoretical mass of sodium should be produced? If only 2.84 g of sodium is actually collected, what is the percent yield?
Hydrazine N2H4, emits a large quantity of energy when it reacts with oxygen, which has led to hydrazine’s use as a fuel for rockets: :math>N2H4(l)+O2(g)N2(g)+2H2O(g) w many moles of each of the gaseous products are produced when 20.0 g of pure hydrazine ¡s ignited in the presence of 20.0 g of pure oxygen? How many grams of each product are produced?
3.50 A test of an automobile engine's exhaust revealed that g of NO2 was emitted in 10 minutes of operation. How many moles of NO2 would this engine release if it were used for a 45-minute commute, assuming that this mea- sured number is representative of the emission under all circumstances?
The gaseous hydrocarbon acetylene, C2H2, is used in welders’ torches because of the large amount of heat released when acetylene burns with oxygen. :math>2C2H2(g)+5O2(g)4CO2(g)+2H2O(g) w many grams of oxygen gas are needed for the complete combustion of 150 g of acetylene?
or each of the following reactions, give the balanced chemical equation for the reaction and state the meaning of the equation in terms of individual molecules and in terms of moles of molecules. msp;MnO2(s)+Al(s)Mn(s)+Al2O3(s) msp;B2O3(s)+CaF2(s)BF3(g)+CaO(s) msp;NO2(g)+H2O(l)HNO3(aq)+NO(g) msp;C6H2(g)+H2C6(g)H12(g)
Toluene, C6H5CH3, is oxidized by air under carefully controlled conditions to benzoic acid, C6H5CO2H, which is used to prepare the food preservative sodium benzoate, C6H5CO2Na. What is the percent yield of a reaction that converts 1.000 kg of toluene to 1.21 kg of benzoic acid? 2C6H5CH3+3O22C6H5CO2H+2H2O
When potassium chlorate is subjected to high temperatures, it decomposes into potassium chloride and oxygen. (a) Write a balanced equation for the decomposition. (b) In this decomposition, the actual yield is 83.2%. If 198.5 g of oxygen are produced, how much potassium chlorate decomposed?
When elemental carbon is burned in the open atmosphere, with plenty of oxygen gas present, the product is carbon dioxide. :math>C(s)+O2(g)CO2(g) wever, when the amount of oxygen present during the burning of the carbon is restricted, carbon monoxide is more likely to result. :math>2C(s)+O2(g)CO(g) at mass of each product is expected when a 5.00-g sample of pure carbon is burned under each of these conditions?
itamin B12 , cyancobalamin, is essential for human nutrition. Its molecular formula is C63H88CoN14O14P . A lack of this vita min in the diet can lead to anemia. Cyanocohalamin is the form of the vitamin found in vitamin supplements. l type='a'> What is the molar mass of cyanocobalamin to two decimal places? How many moles of cyanocohalamin molecules are present in 250 mg of cyanocobalamin? What is the mass of 0.60 mole of cyanocobalamin? How many atoms of hydrogen are in 1 .0 mole of cyanocobalamin? What is the mass of 1.0107 molecules of cyanocobalamin? What is the mass (in grams) of one molecule of cyanocobalamin?