O CHEMICAL REACTIONSPercent yield of chemical reactionsLiquid hexane (CH3(CH,) CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO,) and gaseous water (H,O). If 18.1 g ofwater is produced from the reaction of 29.3 g of hexane and 68.2 g of oxygen gas, calculate the percent yield of water.Round your answer to 3 significant figures.%

Given: mass of water=18.1 g mass of hexane=29.3 g mass of oxygen gas=68.2 g To calculate: percent…

O CHEMICAL REACTIONS Percent yield of chemical reactions Liquid hexane (CH3(CH2)¸CH;) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO,) and gaseous water (H,0). If 18.1 g of water is produced from the reaction of 29.3 g of hexane and 68.2 g of oxygen gas, calculate the percent yield of water. Round your answer to 3 significant figures. II

O CHEMICAL REACTIONS Percent yield of chemical reactions Liquid hexane (CH3(CH2)¸CH;) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO,) and gaseous water (H,0). If 18.1 g of water is produced from the reaction of 29.3 g of hexane and 68.2 g of oxygen gas, calculate the percent yield of water. Round your answer to 3 significant figures. II

Chemistry: Matter and Change

1st Edition

ISBN:9780078746376

Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Publisher:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Chapter11: Stoichiometry

Section: Chapter Questions

Problem 95A

See similar textbooks

Similar questions

When potassium chlorate is subjected to high temperatures, it decomposes into potassium chloride and oxygen. (a) Write a balanced equation for the decomposition. (b) In this decomposition, the actual yield is 83.2%. If 198.5 g of oxygen are produced, how much potassium chlorate decomposed?
DDT, an insecticide harmful to fish, birds, and humans, is produced by the following reaction: In a government lab, 1142 g of chlorobenzene is reacted with 485 g of chloral. a. What mass of DDT is formed, assuming 100% yield? b. Which reactant is limiting? Which is in excess? c. What mass of the excess reactant is left over? d. If the actual yield of DDT is 200.0 g, what is the percent yield?
Citric acid, C6H5CH3, a component of jams, jellies, and fruity soft drinks, is prepared industrially via fermentation of sucrose by the mold Aspergillus niger . The equation representing this reaction is C12H22O11+H2O+3O22C6H8O7+4H2O What mass of citric acid is produced from exactly 1 metric ton (1.000103kg) of sucrose if the yield is 92.30%?
When small quantities of elemental hydrogen gas are needed for laboratory work, the hydrogen is often generated by chemical reaction of a metal with acid. For example, tine reacts with hydrochloric acid, releasing gaseous elemental hydrogen: :math>Zn(s)+2HCI(aq)ZnCl2(aq)+H2(g) at mass of hydrogen gas is produced when 2.50 g of zinc is reacted with excess aqueous hydrochloride acid?
Solid calcium carbide (CaC2)reacts with liquid water to produce acetylene gas (C2H2)and aqueous calcium hydroxide. l type='a'> Write the balanced equation for the reaction that is (occurring. including all phases. If a 100.0-g sample of calcium carbide (CaC2)is initially reacted with 50.0 g of water, which reactant is limiting? Prove that mass is conserved for the reactant amounts used in pan b.
The text explains that one reason why the actual yield for a reaction may be less than the theoretical yield is side reactions. Suggest some other reasons why the percent yield for a reaction might not be 100%.
For each of the following balanced equations, indicate how many moles of the product could be produced by complete reaction of 1.00 g of the reactant indicated in boldface. Indicate clearly the mole ratio used for the conversion. msp;NH3(g)+HCl(g)NH4Cl(s) msp;CaO(s)+CO2(g)CaCO3(s) msp;4Na(s)+O2(g)2Na2O(s) msp;2P(s)+3Cl2(g)2PCl3(l)
Sodium borate decahydrate, Na2B4O710H2O is commonly known as borax. It is used as a deodorizer and mold inhibitor. A sample weighing 15.86 g is heated until a constant mass is obtained indicating that all the water has been evaporated off. (a) What percent, by mass of Na2B4O710H2O is water? (b) What is the mass of the anhydrous sodium borate, Na2B4O7?
For each of the following balanced chemical equations, calculate how many grams of the product(s) would be produced by complete reaction of 0.125 mole of the first reactant. msp;AgNO3(aq)+LiOH(aq)AgOH(s)+LiNO3(aq) msp;Al2(SO4)3(aq)+3CaCl2(aq)2AlCl3(aq)+3CaSO4(s) msp;CaCO3(s)+2HCl(aq)CaCl2(aq)+CO2(g)+H2O(l) msp;2C4H10(g)+13O2(g)8CO2(g)+10H2O(g)
or each of the following reactions, give the balanced chemical equation for the reaction and state the meaning of the equation in terms of individual molecules and in terms of moles of molecules. msp;MnO2(s)+Al(s)Mn(s)+Al2O3(s) msp;B2O3(s)+CaF2(s)BF3(g)+CaO(s) msp;NO2(g)+H2O(l)HNO3(aq)+NO(g) msp;C6H2(g)+H2C6(g)H12(g)
Consider the equation: 2A+B5C. If 10.0 g of A reacts with 5.00 g of B. how is the limiting reactant determined? Choose the best answer and explain. l type='a'> Choose the reactant with the smallest coefficient in the balanced chemical equation. So in this case, the limiting reactant is B. Choose the reactant with the smallest mass given. So in this case, the limiting reactant is The mass of each reactant must be converted to moles and then compared to the ratios in the balanced chemical equation. So in this case, the limiting reactant cannot be determined without the molar masses of A and B. The mass of each reactant must he converted to moles first. The reactant with the fewest moles present is the limiting reactant. So in this case, the limiting reactant cannot be determined without the molar masses of A and B. The mass of each reactant must be divided by their coefficients in the balanced chemical equation, and the smallest number present is the limiting reactant. So in this case, there is no limiting reactant because A and B arc used up perfectly.
The following pictures show a molecular-scale view of a chemical reaction between the compounds AB2 and B2. (A at-oms are shown in blue and B atoms in white). The box on the left represents the box on the right shows what is left once the reaction has gone to completion. Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.