O STOICHIOMETRY Using a chemical equation to find moles of product from moles.. Lindsay v A major component of gasoline is octane (C,H,). When liquid octane is burned in air it reacts with oxygen (O,) gas to produce carbon dioxide gas and water vapor. Calculate the moles of oxygen needed to produce 1.5 mol of water. Be sure your answer has a unit symbol, if necessary, and round it to 2 significant digits. Ox10

O STOICHIOMETRY Using a chemical equation to find moles of product from moles.. Lindsay v A major component of gasoline is octane (C,H,). When liquid octane is burned in air it reacts with oxygen (O,) gas to produce carbon dioxide gas and water vapor. Calculate the moles of oxygen needed to produce 1.5 mol of water. Be sure your answer has a unit symbol, if necessary, and round it to 2 significant digits. Ox10

Chemistry: Matter and Change

1st Edition

ISBN:9780078746376

Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Publisher:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Chapter11: Stoichiometry

Section11.2: Stoichiometric Calculations

Problem 11PP

See similar textbooks

Similar questions

Calcium carbide, CaC2, can be produced in an electric furnace by strongly heating calcium oxide (lime) with carbon. The unbalanced equation is :math>CaO(s)+C(s)CaC2(s)+CO(g) lcium carbide is useful because it reacts readily with water to form the flammable gas acetylene, C2H2, which is used ex tensively in the welding industry. The unbalanced equation is :math>CaC2(s)+H2O(l)C2H2(g)+Ca(OH)2(s) at mass of acetylene gas, C2H2, would he produced by complete reaction of 3.75 g of calcium carbide?
Toluene, C6H5CH3, is oxidized by air under carefully controlled conditions to benzoic acid, C6H5CO2H, which is used to prepare the food preservative sodium benzoate, C6H5CO2Na. What is the percent yield of a reaction that converts 1.000 kg of toluene to 1.21 kg of benzoic acid? 2C6H5CH3+3O22C6H5CO2H+2H2O
A newspaper article about the danger of global warmingfrom the accumulation of greenhouse gases such as carbondioxide states that “reducing driving your car by 20 milesa week would prevent release of over 1000 pounds of CO2 per year into the atmosphere.” Is this a reasonable statement?Assume that gasoline is octane (molecularFormula C8H18 ) and that it is burned completely to CO2 and H2O in the engine of your car. Facts (or reasonable guesses)about your car’s gas mileage, the density of octane, andother factors will also be needed.
A possible practical way to eliminate oxides of nitrogen(such as NO2 ) from automobile exhaust gases uses cyanuricacid, C3N3(OH)3 . When heated to the relatively lowtemperature of 625°F, cyanuric acid converts to gaseousisocyanic acid (HNCO). Isocyanic acid reacts with NO2 inthe exhaust to form nitrogen, carbon dioxide, and water,all of which are normal constituents of the air. (a) Write balanced equations for these two reactions. (b) If the process described earlier became practical, howmuch cyanuric acid (in kilograms) would be requiredto absorb the 1.71010kgNO2 generated annuallyin auto exhaust in the United States?
he production capacity for acrylonitrile (C3H3N)in the United States is over 2 billion pounds per year. Acrylonitrile, the building block tor acrylonitrile fibers and a variety of plastics, is produced from gaseous propylene, ammonia, and oxygen: :math>2C3H6(g)+2NH3(g)+3O22C3H3N(g)+6H2O(g) l type='a'> Assuming 100% yield, determine the mass of acrylonitrile which can be produced from the mixture below: l> Mass Reactant msp;5.23102g propylene td> msp;5.00102g ammonia td> msp;1.00103g oxygen td> i>What mass of water is formed from your mixture? Calculate the mass (in grams) of each reactant after the reaction is complete.
Consider the following unbalanced chemical equation: :math>H2S(g)+O2(g)SO2(g)+H2O(g) termine the maximum number of moles of SO2produced from 8.0 moles of H2Sand 3.0 moIes of O2.
For each of the following balanced chemical equations, calculate how many moles of product(s) would be produced if 0.500 mole of the first reactant were lo react completely. msp;CO2(g)+4H2(g)CH4(g)+2H2O(l) msp;BaCl2(aq)+2AgNO3(aq)2AgCl(s)+Ba(NO3)2(aq) msp;C3H8(g)+5O2(g)4H2O(l)+3CO2(g) msp;3H2SO4(aq)+2Fe(s)Fe2(SO4)3(aq)+3H2(g)
itamin B12 , cyancobalamin, is essential for human nutrition. Its molecular formula is C63H88CoN14O14P . A lack of this vita min in the diet can lead to anemia. Cyanocohalamin is the form of the vitamin found in vitamin supplements. l type='a'> What is the molar mass of cyanocobalamin to two decimal places? How many moles of cyanocohalamin molecules are present in 250 mg of cyanocobalamin? What is the mass of 0.60 mole of cyanocobalamin? How many atoms of hydrogen are in 1 .0 mole of cyanocobalamin? What is the mass of 1.0107 molecules of cyanocobalamin? What is the mass (in grams) of one molecule of cyanocobalamin?
When aluminum is mixed with iron(lll) oxide, iron metal and aluminum oxide are produced, along with a large quantity of heat. What mole ratio would you use to determine moles of Fe if moles of Fe2O3 is known? Fe2O3(s)+2A1(s)2Fe(s)+A12O3(s)+heat
Which would produce a greater number of moles of product: a given amount of hydrogen gas reacting with an excess of oxygen gas to produce water, or the same amount of hydrogen gas reacting with an excess of nitrogen gas to make ammonia? Support your answer.
Interpret the following equation in terms of particles, moles, and mass. 4Al(s)+3O2(g)2Al2O3(s)