Answered: Pal, pa Balance the chemical equation…

Science

Chemistry

Pal, pa Balance the chemical equation with the correct coefficients:

World of Chemistry, 3rd edition

3rd Edition

ISBN:9781133109655

Author:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Chapter7: Chemical Reactions: An Introduction

Section: Chapter Questions

Problem 41A

See similar textbooks

Related questions

Q: Balance the following equation:

Q: Balance the following equation by algebraic method. C5H10 02 CO2 -> H20

Q: Balance the following chemical equation: Al + HCI -> AICI3 H2

Q: Balance the equation by inserting coefficients as needed. equation: Li3N+H2O⟶LiOH+NH3

A: The term chemical equation for a given chemical reaction is its symbolic representation in the form…

Q: Balance the following chemical equations:

Q: Balance the following equation: vX + V XZ3

A: The equation which represents a chemical reaction is called the chemical equation. It is necessary…

Q: =: Balance the following equations.

A: As per Law of consevation of mass "All atoms of different elements must be equal on both sides of a…

Q: Balance the following chemical equation: MgO (5) + H2SO4 (aq)- MgSO4 (5) + H20 (aq) The coefficient…

Q: Balance the chemical equation by adding coefficients as needed. equation: NaOH(aq) + NaNO,(aq) +…

A: A balanced chemical equation states that the number of elements in the reactant side is equal to the…

Q: Balance the following equation by algebraic method. Fe +1 Fe,O;

Q: Q) balance the following equation in details. 0 p.m. KCI + HNO3+O2>KNOg+Czt HeO

A: The balancing of chemical equation means that the number of atoms in the reactant are equal to…

Q: balance the following equation: Cu + HNO3 --> Cu(NO3)2 +H2O

A: A balanced equation is one that has same number of atoms of all types in reactants as well as…

Q: Balance the following equation by algebraic method. CAH10 CO, H,0

Q: 28. Balance the following chemical reaction: C3H8 + O2 CO2 + H2O

A: To balance the equation we will balance the atom on reactant and product. Number of C , H and O on…

Q: Fill in the coefficients (include a 1 where appropriate or a single space) to balance this chemical…

A: Count the atoms of each elements present on reactant and product side of the reaction in order to…

Q: Balance the following equation by algebraic method. Fe 02 → Fe203

A: The strategy for balancing chemical equations algebraically is as follows: Write a different letter…

Q: Balance the equation by inserting coefficients as needed. equation: Li,N + H,O → LIOH + NH3

A: The equation is given below:

Q: Balance the following equation: 8Be - > 4He + X 4 2

Q: Balance the following equation by algebraic method. O2 SO3

A: Balance the reaction: Given equation: S8 + O2 ----->> SO3

Q: Balance the chemical equation: H2S2O7(l) + H2O(l) -----> ?

A: Disulfuric acid H2S2O7 Water H2O Sulfuric acid H2SO4

Q: Balance the following equation.

A: Since you have posted multiple questions, we are entitled to answer the first only. Please repost…

Q: Fill in the coefficients (include a 1 where appropriate or a single space) to balance this chemical…

A: Law of conservation of matter says that matter can neither be created nor be destroyed. A chemical…

Q: Balance the following chemical equation (if necessary): V2Os(s) + → VOCI;(s) + H20(1) HCI(aq)

A: The balanced chemical equation can be written by following a few steps: Step1: Writing the correct…

Q: (Balance the equation) H2SO+NaOHàH2SO+H2O

A: A balanced chemical reaction equation has equal number of atoms and charges on both reactant and…

Q: Balance the following equations.

A: Steps to balance a chemical equation 1. Write unbalanced equation 2. Make a list…

Q: Balance the equation by inserting coefficients as needed. equation: Al4C3+HCl⟶AlCl3+CH4

A: For a given chemical reaction, the term chemical equation can be defined as its symbolic…

Q: Balance the following chemical equation: Fe + HCI НСI --> FeCl3 H2

A: According to the Law of conservation of mass " all atoms of different elements must be equal on both…

Q: 1) [20 pts] Balance the following equations: a) HI + MnO, à Mnl, + I, + H,0 b) Mg + MnO, à MgO + Mn

A: To balance an equation the coefficients are multiplied as prefix to the molecules to get the equal…

Q: Fill in the coefficients (include a 1 where appropriate or a single space) to balance this chemical…

A: The chemical equation are always balanced because they must follow law of conservation of mass which…

Q: Write a balanced equation for the following by inserting the correct coefficients (if a coefficient…

Q: Balance chemical equation H2SO4+NaOH---->

A: The given Equation can be balanced as follows -

Q: Balance the following chemical equations (type corresponding coefficients (1, 2, 3, ...) in blanks).…

Q: Balance the following equation by algebraic method. Fe Cl2 FeCl; +

Q: Balance the following equation: Ni + HCl = NiCl2 + H2

A: The given Chemical Equation can be balanced as follows -

Q: Balance the following chemical reaction. Enter the sum of the balanced coefficients as your answer.…

A: The unbalanced chemical equation can be written as: K + I2 → KI

Q: 13. Balance the following equation: Mg + 02 --> MgO

A: Since you have asked multiple question, we will solve the first question for you, If you want any…

Q: a balanced chemical equation for t

Q: Fill in the coefficients (include a 1 where appropriate or a single space) to balance this chemical…

A: The correct answer is given below

Q: Predict the products and balance the following equation. Reduce the coefficients to the smallest…

A: The unbalanced reaction is: KOH(aq) + H2SO4(aq) → (l) + (aq)

Q: Balance the following equation: H,SO4 v KOH K2SO, + H20

A: Given equation: H2SO4 + KOH → K2SO4 + H2O. We have to balance this equation.

Q: PLease solve the attached

A: The equation for the reaction should be balanced i.e., the number of atoms of reactants and products…

Q: Balance the equation and 51 Cr + 24 je > 1 e

A: This is a nuclear reaction and in nuclear reaction there must be mass balance and proton balance.

Q: Balance the following equation by algebraic method. S8 + 02 SO3

Q: For the followiing unbalanced equation: C,H+0 co,+H.O Balance The sum of the coefficients is O 38 26…

A: Hello. Since more than one question has been asked, the first question shall only be answered in…

Q: Balance

Q: lead + nickel (II) nitrate;Balanced chemical equation:Reaction type

Q: Balance the following chemical equations (type corresponding coefficients (1, 2, 3, ...) in blanks).…

A: BALANCED REACTION 2 NO2 + F2 ---> 2 NO2 F

Q: GHN, O

A: Given equation is : C11H8N2O + C7H7N3O3 -----------> C18H13N5O3 Balance the equation = ?

Q: Balance each of the following skeletal equations. Copper + Silver nitrate -----> Copprous nitrate +…

A: Copper + Silver nitrate -----> Copprous nitrate + Silver

Question

Question in image

Balance the chemical equation with the correct coefficients:
Pals
Pa +
: 2
: 2
: 1
: 5
: 5

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Balance the following equations: (a) CaC2(s)+H2O(l)Ca(OH)2(s)+C2H2(g) (b) (NH4)2Cr2O7(s)Cr2O3(s)+N2(g)+H2O(f) (c) CH3NH2(g)+O2(g)CO2(g)+N2(g)+H2O(g)
3.94 Calcium carbonate (limestone, CaCO3) dissolves in hydrochloric acid, producing water and carbon dioxide. An unbalanced net ionic equation for this reaction is given below. Balance it. CaCO3(s)+H3O+(aq)H2O(l)+CO2(g)+Ca2+(aq)
Balance the following equations: (a) for the reaction to produce "superphosphate" fertilizer Ca3(PO4)2(s) + H2SO4(aq) Ca(H2PO4)2(aq) + CaSO4(s) (b) for the reaction to produce diborane, B2H6 NaBH4(s) + H2SO4(aq) B2H6(g) + H2(g) + Na2SO4(aq) (c) for the reaction to produce tungsten metal from tungsten(VI) oxide WO3(s) + H2(g) W(s) + H2O() (d) for the decomposition of ammonium dichromate (NH4)2Cr2O7(s) N2(g) + H2O() + Cr2O3(s)
Sodium thiosulfate, Na2S2O3, is used as a fixer in black-and-white photography. Suppose you have a bottle of sodium thiosulfate and want to determine its purity. The thiosulfate ion can be oxidized with I2 according to the balanced, net ionic equation I2(aq) + 2 S2O32(aq) 2 I(aq) + S4O62 (aq) If you use 40.21 mL of 0.246 M I2 in a titration, what is the weight percent of Na2S2O3 in a 3.232-g sample of impure material?
Balance equations for these reactions that occur in aqueous solution, and then classify each as a precipitation, add-base, or gas-forming reaction. Show states for the products (s, , g, aq), give their names, and write the net ionic equation. (a) K2CO3 + HClO4 KClO4 + CO2 + H2O (b) FeCl2 + (NH4)2S FeS + NH4Cl (c) Fe(NO3)2 + Na2CO3(aq) FeCO3 + NaNO3 (d) NaOH + FeC13 NaCl + Fe(OH)3
It is stated in Section 6.3 of the text that to balance equations by inspection you start “with the most complicated molecule.” What does this mean? Why is it best to do this?