The chemical formula for hydrogen fluoride is HF. A chemist measured the amount of hydrogen fluoride produced during an experiment. She finds that 79.2 g of hydrogen fluoride is produced. Calculate the number of moles of hydrogen fluoride produced.

The chemical formula for hydrogen fluoride is HF. A chemist measured the amount of hydrogen fluoride produced during an experiment. She finds that 79.2 g of hydrogen fluoride is produced. Calculate the number of moles of hydrogen fluoride produced.

World of Chemistry

7th Edition

ISBN:9780618562763

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter9: Chemical Quantities

Section: Chapter Questions

Problem 54A

See similar textbooks

Related questions

Q: If an experiment produced 3.57 x 10^4 grams of methanol, but calculations performed referencing a…

A: Answer:- This question is answered by using the simple concept of calculation of percent yield using…

Q: how do i do this

A: First, determine the moles of aluminium.The molar mass of aluminium is 26.982 g/mol.

Q: Arsenic reacts with oxygen to form a compound AsxOy. If 2.354 g of arsenic forms 3.611 g of the…

Q: Calculate the number of (a)nitrogen molecules (N2 molecules) (b)nitrogen atoms(N atoms) in 0.111g of…

A: Since 0.111 g of nitrogen gas will have moles = mass/molar mass molar mass of N2 = 28 g/mol Hence…

Q: If 6.1 × 10²⁵ molecules of CO₂ are produced in a combustion reaction, what is the mass in kg of CO₂…

A: Given: 6.1 × 10²⁵ molecules of CO₂ are produced in a combustion reaction. To determine : The mass…

Q: How many grams of iron are created from 32 grams of Al? 2AI + 3FEO --> 3Fe + Al203 2702.4 B 48556.8…

A: Given the chemical reaction as follows,2Al+3FeO→3Fe+Al2O3amount of Al for reaction =32 gramwe are…

Q: Pure aluminum (Al) metal reacts with hydrochloric acid (HCl) to produce aluminum chloride (AlCl3)…

A: Given. 2 Al + 6 HCl → 2 AlCl3 + 3 H2

Q: If 7.7 × 10²⁵ molecules of CO₂ are produced in a combustion reaction, what is the mass in kg of CO₂…

Q: 1.51x1022 atoms of iron, Fe.

A: 1 mol contains atoms or molecules equal to the Avagadro's number. Avagadro's number = 6.022 × 1023…

Q: The fuel tank of an automobile contains 62.0 kg of gasoline. If the gasoline reacts completely with…

A: Answer:- This question is answered by using the simple concept of stoichiometry which involves the…

Q: 87: A compound containing nitrogen and oxygen is decomposed in the laboratory and produces 1.78 g of…

Q: Consider a 1.245 g sample of glucose (C H, O.). Calculate the following. moles of glucose in the…

A: Since you have posted multiple questions, the answer for first question is given below. Kindly…

Q: Balanced chemical equations relate reactants and products by what quantity?

A: Concept Introduction: Balanced chemical equation gives the details about the identities (moles) of…

Q: over 2 billion pounds per year. Acrylonitrile, the building block for polyacrylonitrile fibers and a…

Q: How many grams of CO2 are formed from the combustion of 129 g methane?

A: The above question can be solved by using stoichiometric calculations.

Q: 5.00 g of copper is reacted with 5.00 g of sulfur in a crucible and a compound composed of copper…

A: Mass percentage of substance is one of the ways to express composition of compounds. Mass percentage…

Q: Suppose that 6.71 × 10³ g of titanium(IV) chloride is reacted with 2.45 × 10° g of oxygen. Calculate…

Q: Ammonia, NH3, can be synthesized by this reaction:

A: Given, Amount of NO is 45.8 g Amount of H2 is 12.4 g Formula Used,

Q: If I burn 280g of Methane on my stove, how many grams of Carbon Dioxide (CO2) will be produced O…

A: The combustion of methane produces carbon dioxide and water . We have to calculate the amount of CO2…

Q: Given the reaction shown below and its corresponding graph, which line represents represents ammonia…

A: As ammonia is the reactant, the concentration of ammonia should decrease with time.

Q: what is the maximum number of moles of C that can be formed?

A: The branch of chemistry that deals with the structure, properties and the reaction of the organic…

Q: he Freons are a class of compounds containing carbon, chlorine, and fluorine. While they have many…

A: HFC-134a is CH2FCF3 HCFC-124 is CHClFCF3

Q: Vitamin C has the formula C6H8O6. Calculate the number of vitamin C molecules present in a 0.250-g…

A: Vitamin C, also called ascorbic acid, seems to be a water-soluble vitamin contained in citrus fruits…

Q: Make the following conversions: 25 mol Cl2 to atoms chlorine

A: The number of Cl2 molecule in the 25 mol Cl2 is; Number of Cl2 molecules=6.022×1023/mol×25…

Q: 250(g) + 02 (g) + HCI (g) NH3(g) MgCO3 250 (g) NH,CI (s) + CO2(g) Mgo (s) +

A: Entropy denotes by a symbol 's' . Entropy of a universe increasses spontaneously. Second law of…

Q: [References] Hydrogen cyanide, HCN, is prepared from ammonia, air, and natural gas (CH4) by the…

A: Please note- As per our company guidelines we are supposed to answer only one question. Kindly…

Q: Calculate the mass of Mg. Calculate the mass of the product. Calculate the moles of Mg in the…

A: Mass of any product is calculated by eliminating the mass of watch glass and evaporating dish from…

Q: A 58.5 g sample of an unknown compound that contains only carbon, hydrogen and oxygen was analyzed…

A: Given: The mass of the unknown compound is 58.5 g The mass of CO2 (carbon dioxide) is 105.6 g The…

Q: If 6.7 × 10²⁵ molecules of CO₂ are produced in a combustion reaction, what is the mass in kg of CO₂…

A: Given: The number of molecules of CO₂=6.7 × 10²⁵ molecules The moles of CO₂=(6.7 × 10²⁵ )÷ (6.022 x…

Q: Write the balanced chemical equation for the reaction of magnesium metal with oxygen gas to form…

A: Mass of Mg = 10.0 g Moles of Mg = 10.0g/24.305g/mol = 0.411 mol Mass of Oxygen = 10.0g Moles of…

Q: For the reaction "P₄(s) + 6 Cl₂(g) → 4 PCl₃(l)", if 125 g of P₄ is reacted with 323 g of Cl₂, what…

A: Phosphorus reacts with chlorine to form phosphorus trichloride. The equation for the balanced…

Q: The combustion of 1.66 g ultrafine aluminum in air results in 2.97g of a product, which is a mixture…

A: Given: Mass of Aluminium = 1.66 gMass of the product = 2.97 g% of aluminium oxide = 80% of aluminium…

Q: The illustration on the left represents a mixture of I2 (purple) molecules and F2 (green) molecules…

A: From the representation, it can be seen that one molecule of iodine and three molecules of fluorine…

Q: 5. Fructose (C,H,,O), a simple sugar, is commonly found in soft drinks, vegetables, fruit, and many…

A: Given: molecules of Fructose = 93.0*1023 molecules molar mass of C = 12.011 g/mol molar mass of H =…

Q: How many NH3 molecules comprise one mole of NH3? What is the mass in grams of one mole of NH3? What…

A: In one moles of NH3 is equal to Avagadro number of Molecules of NH3 That means, 1mol of NH3 =…

Q: cylinder contains 1.475 x 1024 argon atoms. How many moles of argon are there in the cylinder?

Q: The reaction of methane and water is one way to prepare hydrogen for use as a fuel: If you begin…

A: Explanation Stoichiometric equation of methane and water CH4(g) +H2O(g) → CO(g) +H2(g) So we…

Q: If 101 g of CaO and 280. g of NH4Cl are mixed, what mass of NH3 can be produced?

A: Given,CaO is 101 gAmmonium chloride is 280 gMolar mass of CaO is 56.0774 g/molMalar mass of Ammonium…

Q: Provided you are given a balanced chemical equation Where do you find the numbers we are to use…

A: For a given balanced chemical equation number of moles of substance is equal to stoichiometric…

Q: 1. Consider the following unbalanced chemical equation: Al+ CALC, What mass of aluminum is required…

A: The answer to the following question is-

Q: You have 30 g CH4 that you burn in oxygen. How many grams of water can you make?

A: We will use stoichiometry of the reaction to get the answer.

Q: The mass of C3H8O3 that can be made from 2.4 × 1023 H atoms is

Q: (S) For the reaction 3 H2 (g) + N2 (g) 2 NH3 (g), how many moles of ammonia will be produced from…

A: The given reaction is as follows: 3H2g+N2g→2NH3g From the stoichiometry of the above balanced, we…

Q: Which reactant was the limiting reactant? Which reactant was the excess reactant

Q: the maximum amount of SF6 that can be produced from the reaction of 32.1 g of sulfur with 114 g of…

A: Limiting Reagent : The limiting reagent is a reactant species taking part in a chemical reaction…

Q: If the same amount of electricity that is used to produce 500 g copper metal (Cu Cu") is used to…

Q: The number of moles of H in three moles of copper(II) sulfate pentahydrate, CuSO45H2O, is a. 2 b.…

A: The given compound is copper(II) sulfate pentahydrate,

Q: Consider the following balanced chemical equation: Fe2(SO4)3 + 3H2 → 2Fe + 3H2SO4 If 500. grams of…

A: In this problem, we will use the concept of stoichiometry of balanced reaction to determine the…

Q: 2H2(g) + O2(g) -> 2H2O(g) Calculate the mass (in grams) of water vapor produced when 56.0 g of pure…

A: 1) From the balanced chemical equation, deduce the molar relation between hydrogen gas and water…

Q: One mole of sucrose, C12H22O11, contains _________________ molecules of sucrose

Concept explainers

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".

Question

The chemical formula for hydrogen fluoride is HF.
A chemist measured the amount of hydrogen fluoride produced during an experiment. She finds that 79.2 g of hydrogen fluoride is produced. Calculate the
number of moles of hydrogen fluoride produced.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

When aluminum is mixed with iron(lll) oxide, iron metal and aluminum oxide are produced, along with a large quantity of heat. What mole ratio would you use to determine moles of Fe if moles of Fe2O3 is known? Fe2O3(s)+2A1(s)2Fe(s)+A12O3(s)+heat
A possible practical way to eliminate oxides of nitrogen(such as NO2 ) from automobile exhaust gases uses cyanuricacid, C3N3(OH)3 . When heated to the relatively lowtemperature of 625°F, cyanuric acid converts to gaseousisocyanic acid (HNCO). Isocyanic acid reacts with NO2 inthe exhaust to form nitrogen, carbon dioxide, and water,all of which are normal constituents of the air. (a) Write balanced equations for these two reactions. (b) If the process described earlier became practical, howmuch cyanuric acid (in kilograms) would be requiredto absorb the 1.71010kgNO2 generated annuallyin auto exhaust in the United States?
Alkali metal hydroxides are sometimes used to “scrub” excess carbon dioxide from the air in closed spaces (such as submarines and spacecraft). For example, lithium hydroxide reacts with carbon dioxide according to the unbalanced chemical equation :math>LiOH(s)+CO2(g)Li2CO3(s)+H2O(g) ppose a lithium hydroxide canister contains 155 g of LiOH(s). What mass of CO2(g)will the canister be able to absorb? If it is found that after 24 hours of use the canister has absorbed 102 g of carbon dioxide, what percentage of its capacity has been reached?
Calculate the number of grams of SO2 that must react to produce 350.g of SO3. Use the statement written in Exercise 5.40 and express your answer using the correct number of significant figures.
A common experiment in introductory chemistry courses involves heating a weighed mixture of potassium chlorate, KClO3 , and potassium chloride. Potassium chlorate decomposes when heated, producing potassium chloride and evolving oxygen gas. By measuring the volume of oxygen gas produced in this experiment, students can calculate the relative percentage of KClO3 and KCl in the original mixture. Write the balanced chemical equation for this process.
The simplest example of the hydrogenation of a carbon-carbon double bond is the reaction between ethene and hydrogen in the presence of nickel: CH2=CH2+H2NiCH3CH3. When 5.20g of ethene react with excess hydrogen gas, the reaction yields 4.75g of ethane. What is the percentage yield for this reaction?
Electrolysis Determine the theoretical and percent yield of hydrogen gas if 36.0 g ofwater undergoes electrolysis to produce hydrogen and oxygen and 3.80 g of hydrogen is collected.
Small quantities of ammonia gas can be generated in the laboratory by heating an ammonium salt with a strong base. For example, ammonium chloride reacts with sodium hydroxide according to the following balanced equation: :math>NH4Cl(s)+NaOH(s)NH3(g)+NaCl(s)+N2O(g) at mass of ammonia gas is produced if 1.39 g of ammonium chloride reacts completely?
The quicklime produced in Question 63 is frequently converted to calcium hydroxide, sometimes called slaked lime, by an exothermic reaction with water: CaO(s)+H2O(l)Ca(OH)2(s)+65.3kJ. What mass in grams of quicklime was processed in a reaction that transferred 291kJ of energy?
If common sugars arc heated too strongly, they char as they decompose into carbon ¡md water vapor. For example, if sucrose (table sugar) is bated, the reaction is :math>C12H22O11(s)12C(s)+11H2O(g) at mass of carbon is produced if 1.19 g of sucrose decomposes completely?
The quantitative significance of take a deep breath varies, of course, with the individual. When one person did so, he found that he inhaled 2.951022 molecules of the mixture of mostly nitrogen and oxygen, which we call air. Assuming this mixture has an average molar mass of 29g/mol, what is his apparent lung capacity in grams of air?