Answered: What constitutional isomers could be…

What constitutional isomers could be possible for [Co(H2O)4(SCN)2]CI? Coordination isomers only Both coordination and linkage isomers No isomers exist for [Co(H20)4(SCN)2]CI Linkage isomers only

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter21: Transition Metals And Coordination Chemistry

Section: Chapter Questions

Problem 46E

See similar textbooks

Related questions

Q: What is the oxidation state and coordination number (C.N.) of the metal atom in the following…

A: Given the complex is as follows; [Mn(acac)2(SCN)(OH)]

Q: Given the coordination compound: [MoCO3(H2O)2][Zn(CN)3OH(en)2]. what is the ligands of the…

Q: How many coordination isomers could be formed starting with [Cu(NH3)4][PtBr4]? Write the formula for…

A: Coordination isomers refers to the change in the bonds or ligands of the two coordination sphere…

Q: Give the systematic name for the following coordination compound: K₂[CrCO(CN)₅]

A: In the given coordination compound the cation is K+ and the anion is complex [CrCO(CN)₅]2-. The…

Q: Give the systematic name for the following coordination compound: [NiCl₄]²⁻

A: [NiCl₄]²⁻ The above coordination compound systematic name is, Tetrachloronickelate (II) ion A…

Q: Consider the coordination compound [Fe(NH3)2(en)2]Cl3 and select the FALSE statement below. a) the…

A: Complex is the one which contain the central metal atom surrounded by definite number of ligands…

Q: For the two complex ions [Mn(CN)6]4− and [Mn(H2O)6]2+ (a) Are all metal ligand bonds equal to…

A: We are given two complex, [Mn(CN)6]4−having CN as the pi acceptor an a strong field ligand.…

Q: True or false In the coordination compound [Mn(OH2)6]SO4, the complex cation is octahedral and…

A: Atomic number of Mn = 25 Atomic number of Pt = 78

Q: For the low spin coordination compound [Fe(en)2Cl]Cl, identify the Oxidation number of iron

A: Note : I think the complex should [Fe(en)2Cl2]Cl. So I'm giving answer for both the complex.

Q: If trans-[Cr(en)2(NCS)2]SCN is heated, it forms gaseousethylenediamine and solid…

A: The reaction on heating of the coordination compound trans-[Cr(en)2(NCS)2]SCN leads to the formation…

Q: .a)Sketch structure, find oxidation state of Co and write name of coordination compound…

A: a) The structure of [Co(NH3)4(NO2)2]Cl The oxidation state of Co is found as follows, Therefore,…

Q: Name this coordination compound: K2[Cr(CN)5CO]

A: A compound containing transition elements displays different colors. The 'unpaired electrons of…

Q: There are two isomerism in coordination complexes which are structural isomerism and…

Q: Platinum(IV) is readily complexed by ethylenediamine. Draw the structuresof both enantiomers of the…

A: Ethylenediamine (en) is a bidentate chelating ligand in coordination compounds with the two donor…

Q: A chemist synthesizes two coordination compounds. One compound decomposes at 280°C, the other at…

Q: The following coordination compounds have a metal center with a +2 oxidation state EXCEPT O…

Q: [CoCl2(NH3)4] Cl is a Coordination compound, Counter ion, Ligand, or Complex ion? In the compound…

A: In this question, we have to find out the correct answer of given problem by the help of…

Q: The complex [Ni(CN)4]

A: According to VBT ( valance bond theory) sp3d2 and d2sp3 hybridisations complexes are in…

Q: 1. K₂[Co(dme)(bpy)(NCS)CI₂] i. ii. iii. Coordination compound Determine the oxidation state of…

A: “Since you have posted a question with multiple sub-parts, we will solve first three subparts for…

Q: Identify each of the following coordination complexes as either diamagnetic or paramagnetic: (a)…

A: The oxidation state of Ru and Co in the given complexes are calculated as follows: In the complex…

Q: the coordination compound Rb2[Cr(O)Cls] (one oxide ligand and five chloride ligands). a. Determine…

A: Since you have posted a question with multiple sub-parts, we will solve first three subparts for…

Q: a) Almost every transition metal can exist as a cation with a 2+ charge. b) Square planar transition…

Q: Name each complex ion or coordination compound- [Cu(en)2],+ b. [Mn(CO)3(NO2)3],…

A: A complex is a substance in which a metal atom or ion is associated with a group of neutral…

Q: 24. Which of the following is the coordination number and geometry of lutetium(III) complex,…

A: The coordination number and geometry of lutetium(III) complex has to be given,

Q: The molar mass of the coordination compound [M(NH3)4Cl2]Cl is 381.5 g/mol and the atomic mass of…

Q: Identify each of the following coordination complexes as either diamagnetic or paramagnetic: (a)…

A: To determine magnetic behavior of complexes: The following coordination complexes are a). (Ag…

Q: coordination number of Co^3+ complex is a 3 b 4 c 5 d 6

A: Coordination number:The number of ligands that are directly bonded with central metal ion is said to…

Q: The coordination complex [Cr(CO)6] forms colorless, diamagnetic crystals that melt at 90 °C. What is…

A: The oxidation number of chromium in Cr(CO)6 has to be given.

Q: Give the systematic name for the following coordination compound or complex ion: HgN, NC NH3

A: The naming of ligands in c-ordination compounds We know:- negative ligands end with o F- fluorido…

Q: What is the coordination number for the transition metal in the following complexes? a)…

A: Coordination number : it is the total number of atoms are attached to the central atom.

Q: Draw the geometrical isomers of complex [Co(en)2Cl2]+. (ii) On the basis of crystal field theory,…

Q: 12) The complex [Fe(H2O)6]* is paramagnetic. Is the H20 ligand inducing a strong or weak field?

A: Ligands that give a large splitting are strong field ligands and those that produce a small…

Q: Which complex has the highest coordination number? a) K3[Cr(CN)4] b) [Ni(bpy)2en]2+ c)…

A: Answer - The correct option is (B) [Ni(bpy)2en]2 complex has the highest coordination number…

Q: Predict which complex is colorless: [Cr(en)3]2+, [Fe(CN)6]3−, [Zn(CN)4]2−, [Ni(CN)2Br2]2−?

A: In this question, we have to find out the correct answer of given problem by the help of…

Q: The complex ion [Fe(CN)6]³ is paramagnetic with one unpaired electron but the complex ion…

Q: What is the coordination number on the transition metal in the following compound? [Mn(H2O)6](NO3),

A: We have an coordination compound , we have to predict the coordination number of the metal in the…

Q: Draw the structures of optical isomers of each of the following complex ions:[Cr(C2O4)3]3-,…

A: Compounds which are non-super imposable mirror image of each other are known as optical isomers.

Q: Iron(II) forms a complex in hemoglobin. Two of the possibilities are [Fe(H2O)6]2+ and [Fe(CN)6]4–…

Q: The complex ion [Ni(TAP)(CN)]+ has a distorted trigonal bipyramidal structure, the complex ion has a…

A: Given: The complex ion [Ni(TAP)(CN)]+ has a distorted trigonal bipyramidal structure.

Q: Give the systematic name for the following coordination compound or complex ion: INH3 Pt) CI NH3

A: Given compound is Pt(Cl)2(NH3)2

Q: Indicate the coordination number and the oxidation num ber of the metal for each of the following…

A: Since you have posted question with multiple sub-parts, we are entitled to answer the first 3 only.…

Q: the coordination compound K3Fe(CN)6. Identify the complex ion. What is the counter ion in the…

Q: What is the coordination number for the transition metal in the following complexes? a)…

A: To calculate coordination numbers of complexes , we have to look about ligands surrounding the…

Q: A. From the following pairs of coordination complexes, identify the one that is a pair of ionization…

Q: Identify each of the following coordination complexes as either diamagnetic or paramagnetic: (a)…

Q: Consider the complexes d bis(ethylenediamine) nickel(II), [Ni(en)₂]+², versus tetracyanidoferrate…

A: Paramagnetic substances have unpaired electrons and diamagnetic substances have paired elections.

Q: Question attached

A: The given Coordination compound is Cr(bpy)2(CO)2 To find: The oxidation state and d-configuration…

Q: What is the oxidation state and coordination number (C.N.) of the metal atom in the following…

A: The oxidation state of the metal ion is depend on the charge of the ligands which make the…

Q: Fe(CN)6 complexes 3− and FeCl6 3− both have iron in the oxidation state 3+. Both complexes can be…

Concept explainers

Atomic Structure

The basic structure of an atom is defined as the component-level of atomic structure of an atom. Precisely speaking an atom consists of three major subatomic particles which are protons, neutrons, and electrons. Many theories have been stated for explaining the structure of an atom.

Shape of the D Orbital

Shapes of orbitals are an approximate representation of boundaries in space for finding electrons occupied in that respective orbital. D orbitals are known to have a clover leaf shape or dumbbell inside where electrons can be found.

Question

100%

What constitutional isomers could be possible for [Co(H2O)4(SCN)2]CI?
Coordination isomers only
Both coordination and linkage isomers
No isomers exist for [Co(H20)4(SCN)2]CI
Linkage isomers only

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
Give the coordination number for each metal ion in the following compounds: (a) [Co(CO3)3]3- (note that CO32- is bidentate in this complex). (b) [Cu(NH3)4]2+. (c) [Co(NH3)4Br2]2(SO4)3. (d) [Pt(NH3)4][PtCl4]. (e) [Cr(en)3](NO3)3. (f) [Pd(NH3)2Br2] (square planar). (g) K3[Cu(Cl)5]. (h) [Zn(NH3)2Cl2]
How many geometric isomers of the complex ion [Cr(dmen)3]3+ can exist? (dmen is the bidentate ligand 1,1-dimethylethylenediamine.) 1,1-Dimethylethylenediamine, dmen
Four different octahedral chromium coordination compounds exist that all have the same oxidation state for chromium and have H2O and Cl as the ligands and counterions. When 1 mole of each of the four compounds is dissolved in water, how many moles of silver chloride will precipitate upon addition of excess AgNO3?
The square-planar complex Pt(en)Cl2 has chloride ligands in a cis configuration. No trans isomer is known. Based on the bond lengths and bond angles of carbon and nitrogen in the ethylenediamine ligand, explain why the trans compound is not possible.
Five-coordinate coordination complexes are known, including [CuCl5]3 and [Ni(CN)5]3. Write the structuralformulas and identify a plausible geometry for thesecomplexes.
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?