Concept explainers
Interpretation:
The explanation for cooling effect of ethanol on rubbing against skin has to be given.
Concept Introduction:
Heat is flow of thermal energy involving two bodies at various temperatures. The flow of thermal energy involving two bodies at various temperatures is called as heat. The flow of heat implies that energy is either released or absorbed on describing about energy changes that takes place during a process.
Exothermic process is the chemical process in which heat is released to the surroundings.
Endothermic process is the chemical process in which heat is absorbed from the surroundings.
The change in enthalpy that is associated with the formation of one mole of a substance from its related elements being in standard state is called standard enthalpy of formation (
The standard enthalpy of reaction is the enthalpy of reaction that takes place under standard conditions.
Want to see the full answer?
Check out a sample textbook solutionChapter 10 Solutions
CHEM: ATOM FIRST V. 1 W/ACCESS >C<
- The process of dissolving ammonium nitrate, NH4NO3, in water is an endothermic process. What is the sign of q? If you were to add some ammonium nitrate to water in a flask, would you expect the flask to feel warm or cool?arrow_forwardThe decomposition of ozone, O3, to oxygen, O2, is an exothermic reaction. What is the sign of q? If you were to touch a flask in which ozone is decomposing to oxygen, would you expect the flask to feel warm or cool?arrow_forwardWhich of the following substances have an enthalpy of formation equal to zero? a. Cl2(g) b. H2(g) c. N2(l) d. Cl(g)arrow_forward
- Gasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.arrow_forwardA sample of nickel is heated to 99.8C and placed in a coffee-cup calorimeter containing 150.0 g water at 23.5C. After the metal cools, the final temperature of metal and water mixture is 25.0C. If the specific heat capacity of nickel is 0.444 J/C g, what mass of nickel was originally heated? Assume no heat loss to the surroundings.arrow_forwardThe specific heat capacity of copper is 0.385 J g1 C1, whereas it is 0.128 J g1 C1 for gold. Assume you place 100. g of each metal, originally at 25 C, in a boiling water bath at 100 C. If energy is transferred to each metal at the same rate, determine which piece of metal will reach 100 C first.arrow_forward
- Explain the difference between heat capacity and specific heat of a substance.arrow_forwardThe temperature of the cooling water as it leaves the hot engine of an automobile is 240 F. After it passes through the radiator it has a temperature of 175 F. Calculate the amount of heat transferred from the engine to the surroundings by one gallon of water with a specific heat of 4.184 J/g oC.arrow_forwardA substance, X, has the following properties: Specific Heat Capacities Hvap 20.kj/mol C(s) 3.0j/gC Hfus 5.0kj/mol C(l) 2.5j/gC bp 75C C(g) 2.5j/gC mp 15Carrow_forward
- Another reaction that is used to propel rockets is N2O4(l)+2N2H4(l)3N2(g)+4H2O(g) This reaction has the advantage that neither product is toxic, so no dangerous pollution is released. When the reaction consumes 10.0 g liquid N2O4, it releases 124 kJ of heat. (a) Is the sign of the enthalpy change positive or negative? (b) What is the value of H for the chemical equation if it is understood to be written in molar quantities?arrow_forward9.45 What happens to the temperature of a material as it undergoes an endothermic phase change? If heat is added, how can the temperature behave in this manner?arrow_forwardWhen solid iron burns in oxygen gas (at constant pressure) to produce Fe2O3(s), 1651 kJ of heat is released for every 4 mol of iron burned. How much heat is released when 10.3 g Fe2O3(s) is produced (at constant pressure)? What additional information would you need to calculate the heat released to produce this much Fe2O3(s) if you burned iron in ozone gas, O3(g), instead of O2(g)?arrow_forward
- ChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning
- Chemistry by OpenStax (2015-05-04)ChemistryISBN:9781938168390Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark BlaserPublisher:OpenStaxChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage Learning