Concept explainers
Portable hot packs are available for skiers and people engaged in other outdoor activities in a cold climate. The air-permeable paper packet contains a mixture of powdered iron, sodium chloride, and other components, all moistened by a little water. The exothermic reaction that produces the heat is a very common one—the rusting of iron.
When the outside plastic envelope is removed, O2 molecules penetrate the paper, causing the reaction to begin. A typical packet contains 250 g of iron to warm your hands or feet for up to 4 hours. Using data from Appendix 2, determine how much heal (in kilojoules) is produced by this reaction.
Want to see the full answer?
Check out a sample textbook solutionChapter 10 Solutions
CHEM: ATOM FIRST V. 1 W/ACCESS >C<
- The decomposition of ozone, O3, to oxygen, O2, is an exothermic reaction. What is the sign of q? If you were to touch a flask in which ozone is decomposing to oxygen, would you expect the flask to feel warm or cool?arrow_forwardThe temperature of the cooling water as it leaves the hot engine of an automobile is 240 F. After it passes through the radiator it has a temperature of 175 F. Calculate the amount of heat transferred from the engine to the surroundings by one gallon of water with a specific heat of 4.184 J/g oC.arrow_forwardA piece of titanium metal with a mass of 20.8 g is heated in boiling water to 99.5 C and then dropped into a coffee-cup calorimeter containing 75.0 g of water at 21.7 C. When thermal equilibrium is reached, the final temperature is 24.3 C. Calculate the specific heat capacity of titanium.arrow_forward
- A sample of sucrose, C12H22O11, is contaminated by sodium chloride. When the contaminated sample is burned in a bomb calorimeter, sodium chloride does not burn. What is the percentage of sucrose in the sample if a temperature increase of 1.67C is observed when 3.000 g of the sample are burned in the calorimeter? Sucrose gives off 5.64103kJ/mol when burned. The heat capacity of the calorimeter and water is 22.51 kJ/C.arrow_forwardIn a bomb calorimeter, the reaction vessel is surrounded by water that must be added for each experiment. Since the amount of water is not constant from experiment to experiment, the mass of water must be measured in each case. The heat capacity of the calorimeter is broken down into two parts: the water and the calorimeter components. If a calorimeter contains 1.00 kg water and has a total heat capacity of 10.84 kJ/C, what is the heat capacity of the calorimeter components?arrow_forward9.35 A piece of titanium metal with a mass of 20.8 g is heated in boiling water to 99.5°C and then dropped into a coffee cup calorimeter containing 75.0 g of water at 2 1.7°C. When thermal equilibrium is reached, the final temperature is 24.3°C. Calculate the specific heat capacity of titanium.arrow_forward
- The standard molar enthalpy of formation of diborane, B2H6(g), cannot be determined directly because the compound cannot be prepared by the reaction of boron and hydrogen. It can be calculated from other enthalpy changes, however. The following enthalpy changes can be measured. 4 B(s) + 3 O2(g) 2 B2O3(s) rH = 2543.8 kJ/mol-rxn H2(g) + O2(g) H2O(g) rH = 241.8 kl/mol-rxn B2H6(g) + 3 O2(g) B2O3(s) + 3 H2O(g) rH = 2032.9 kJ/mol-rxn (a) Show how these equations can be added together to give the equation for the formation of B2H6(g) from B(s) and H2(g) in their standard states. Assign enthalpy changes to each reaction. (b) Calculate fH for B2H6(g). (c) Draw an energy level diagram that shows how the various enthalpies in this problem are related. (d) Is the formation of B2H6(g) from its elements exo- or endothermic?arrow_forwardA 10.00-g sample of acetic acid, HC2H3O2, was burned in a bomb calorimeter in an excess of oxygen. HC2H3O2(l)+2O2(g)2CO2(g)+2H2O(l) The temperature of the calorimeter rose from 25.00C to 35.84C. If the heat capacity of the calorimeter and its contents is 13.43 kJ/C, what is the enthalpy change for the reaction?arrow_forwardExplain the difference between heat capacity and specific heat of a substance.arrow_forward
- Adding 5.44 g of NH4NO3(s) to 150.0 g of water in a coffee-cup calorimeter (with stirring to dissolve the salt) resulted in a decrease in temperature from 18.6 C to 16.2 C. Calculate the enthalpy change for dissolving NH4NO3(s) in water, in kJ/mol. Assume the solution (whose mass is 155.4 g) has a specific heat capacity of 4.2 J/g K. (Cold packs take advantage of the fact that dissolving ammonium nitrate in water is an endothermic process.)arrow_forwardWhen calcium carbonate, CaCO3 (the major constituent of limestone and seashells), is heated, it decomposes to calcium oxide (quicklime). CaCO3(s)CaO(s)+CO2(g);H=177.9kJ How much heat is required to decompose 21.3 g of calcium carbonate?arrow_forwardEthylene glycol, HOCH2CH2OH, is used as antifreeze. It is produced from ethylene oxide, C2H4O, by the reaction C2H4O(g)+H2O(l)HOCH2CH2OH(l) Use Hesss law to obtain the enthalpy change for this reaction from the following enthalpy changes: 2C2H4O(g)+5O2(g)4CO2(g)+4H2O(l);H=2612.2kJHOCH2CH2OH(l)+52O2(g)2CO2(g)+3H2O(l);H=1189.8kJarrow_forward
- General Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage Learning
- Chemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage LearningChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningChemistry: Principles and ReactionsChemistryISBN:9781305079373Author:William L. Masterton, Cecile N. HurleyPublisher:Cengage Learning