Concept explainers
(a)
Interpretation:
The equation for the formation of Acetylene and the maximum amount of heat from combustion of Acetylene has to be calculated.
Concept Introduction:
The change in enthalpy that is associated with the formation of one mole of a substance from its related elements being in standard state is called standard enthalpy of formation (
The standard enthalpy of reaction is the enthalpy of reaction that takes place under standard conditions.
The equation for determining the standard enthalpies of compound and element can be given by,
(a)
Answer to Problem 10.147QP
Explanation of Solution
Calcium carbide upon reaction with Water gives Calcium hydroxide and Acetylene. The
(b)
Interpretation:
The equation for the formation of Acetylene and the maximum amount of heat from combustion of Acetylene has to be calculated.
Concept Introduction:
The change in enthalpy that is associated with the formation of one mole of a substance from its related elements being in standard state is called standard enthalpy of formation (
The standard enthalpy of reaction is the enthalpy of reaction that takes place under standard conditions.
The equation for determining the standard enthalpies of compound and element can be given by,
(b)
Answer to Problem 10.147QP
The maximum amount of heat obtained is
Explanation of Solution
The combustion reaction of Acetylene can be given as,
Standard enthalpy of formation of
Standard enthalpy of formation of
Standard enthalpy of formation of
Standard enthalpy of formation of
Enthalpy of reaction=
To calculate the moles of
Moles of
Moles of
To calculate the amount in heat for
Amount of heat =
Amount of heat =
Want to see more full solutions like this?
Chapter 10 Solutions
Chemistry: Atoms First (Looseleaf)-Package
- When 2.50 g of methane burns in oxygen, 125 kJ of heat is produced. What is the enthalpy of combustion per mole of methane under these conditions?arrow_forwardA typical fat in the body is glyceryl trioleate, C57H104O6. When it is metabolized in the body, it combines with oxygen to produce carbon dioxide, water, and 3.022104 kJ of heat per mole of fat. (a) Write a balanced thermochemical equation for the metabolism of fat. (b) How many kilojoules of energy must be evolved in the form of heat if you want to get rid of five pounds of this fat by combustion? (c) How many nutritional calories is this? (1 nutritional calories =1103 calories)arrow_forwardGiven the following reactions, N2H4(l)+O2(g)N2(g)+2H2O(g)H=534.2kJ H2(g)+12 O2(g)H2O(g)H=241.8kJ Calculate the heat of formation of hydrazine.arrow_forward
- When hydrazine reacts with oxygen, nitrogen gas and steam are formed. (a) Write a thermochemical equation for the reaction. (b) How much heat is evolved or absorbed if 1.683 L of steam at 125C and 772 mm Hg are obtained?arrow_forwardGiven the following thermochemical equations: 4B(s)+3O2(g)2B2O3(s)H=2543.8kJ H2(g)+12 O2(g)H2O(g)H=241.8kJ B2H6(s)+3O2B2O3(s)+3H2O(g)H=2032.9kJ Calculate H for the decomposition of B2H6 into its elements.arrow_forward9.32 The material typically used to heat metal radiators is water. If a boiler generates water at 79.5°C, what mass of water was needed to provide the heat required in the previous problem? Water has a specific heat of 4.184Jg1 C1 .arrow_forward
- Under what circumstances is the heat of a process equal to the enthalpy change for the process?arrow_forwardAmmonium nitrate is an oxidizing agent and can give rise to explosive mixtures. A mixture of 2.00 mol of powdered aluminum and 3.00 mol of ammonium nitrate crystals reacts exothermically yielding nitrogen gas, water vapor, and aluminum oxide. How many grams of the mixture are required to provide 245 kJ of heat? See Appendix C for data.arrow_forward9.41 Under what conditions does the enthalpy change equal the heat of a process?arrow_forward
- Given the following (hypothetical) thermochemical equations: A+B2C;H=447kJA+3D2E;H=484kJ2D+B2F;H=429kJ Calculate H, in kJ, for the equation 4E+5B4C+6Farrow_forwardThe head of a strike anywhere match contains tetraphosphorus trisulfide, P4S3. In an experiment, a student burned this compound in an excess of oxygen and found that it evolved 3651 kJ of heat per mole of P4S3 at a constant pressure of 1 atm. She wrote the following thermochemical equation: P4S3(s)+8O2(g)P4O10(s)+3SO2(g);H=3651kJ Calculate the standard enthalpy of formation of P4S3, using this students result and the following standard enthalpies of formation: P4O10(s), 3009.9 kJ/mol; SO2(g), 296.8 kJ/mol. How does this value compare with the value given in Appendix C?arrow_forwardSalicylic acid, C7H6O3, is one of the starting materials in the manufacture of aspirin. When 1.00 g of salicylic acid burns in a bomb calorimeter, the temperature of the bomb and water goes from 23.11C to 28.91C. The calorimeter and water absorb 21.9 kJ of heat. How much heat is given off when one mole of salicylic acid burns?arrow_forward
- Chemistry: Principles and ReactionsChemistryISBN:9781305079373Author:William L. Masterton, Cecile N. HurleyPublisher:Cengage LearningChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage Learning
- Principles of Modern ChemistryChemistryISBN:9781305079113Author:David W. Oxtoby, H. Pat Gillis, Laurie J. ButlerPublisher:Cengage LearningChemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningChemistry by OpenStax (2015-05-04)ChemistryISBN:9781938168390Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark BlaserPublisher:OpenStax