Interpretation:
The result of calculated standard enthalpy of reaction has to be identified if the concentration of one of the reactant solution is twice as high as it was supposed to be.
Concept Introduction:
- Calorimetry can be defined as the measurement of changes in heat.
- Two types of Calorimetry are coffee cup calorimeter and bomb calorimeter.
- The change in heat of the system can be determined with the value of the heat capacity of the calorimeter.
- The heat capacity of the calorimeter can be given as,
Standard enthalpy of reaction:
The change in enthalpy that is associated with the formation of one mole of a substance from its related elements being in standard state is called standard enthalpy of formation (
The standard enthalpy of reaction is the enthalpy of reaction that takes place under standard conditions.
The equation for determining the standard enthalpies of compound and element can be given by,
Want to see the full answer?
Check out a sample textbook solutionChapter 10 Solutions
CHEMISTRY:ATOMS FIRST (LL)>CUSTOM PKG.<
- The process of dissolving ammonium nitrate, NH4NO3, in water is an endothermic process. What is the sign of q? If you were to add some ammonium nitrate to water in a flask, would you expect the flask to feel warm or cool?arrow_forwardNiagara Falls has a height of 167 ft (American Falls). What is the potential energy in joules of 1.00 lb of water at the top of the falls if we take water at the bottom to have a potential energy of zero? What would be the speed of this water at the bottom of the falls if we neglect friction during the descent of the water?arrow_forwardAs the gas trapped in a cylinder with a movable piston cools, 1.34 kJ of work is done on the gas by the surroundings. If the gas is at a constant pressure of 1.33 105 Pa, what is the change of volume (in L) of the gas?arrow_forward
- 9.41 Under what conditions does the enthalpy change equal the heat of a process?arrow_forward9.53 Using these reactions, find the standard enthalpy change for the formation of 1 mol of PhO(s) from lead metal and oxygen gas. PbO(s)+C(graphite)Pb(s)+CO(g) H = 106.8 kJ 2C(graphite)+O2(g)2CO(g) H= -221.0 kJ If 250 g of lead reacts with oxygen to form lead(II) oxide, what quantity of thermal energy (in kJ) is ahsorhed or evolved?arrow_forwardUnder what circumstances is the heat of a process equal to the enthalpy change for the process?arrow_forward
- Chlorine dioxide, ClO2, is a reddish yellow gas used in bleaching paper pulp. The average speed of a ClO2 molecule at 25C is 306 m/s. What is the kinetic energy (in joules) of a ClO2 molecule moving at this speed?arrow_forwardWhen solid iron burns in oxygen gas (at constant pressure) to produce Fe2O3(s), 1651 kJ of heat is released for every 4 mol of iron burned. How much heat is released when 10.3 g Fe2O3(s) is produced (at constant pressure)? What additional information would you need to calculate the heat released to produce this much Fe2O3(s) if you burned iron in ozone gas, O3(g), instead of O2(g)?arrow_forwardGiven the following thermochemical equations: 4B(s)+3O2(g)2B2O3(s)H=2543.8kJ H2(g)+12 O2(g)H2O(g)H=241.8kJ B2H6(s)+3O2B2O3(s)+3H2O(g)H=2032.9kJ Calculate H for the decomposition of B2H6 into its elements.arrow_forward
- General Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry for Engineering StudentsChemistryISBN:9781285199023Author:Lawrence S. Brown, Tom HolmePublisher:Cengage LearningChemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage Learning
- Chemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry: Principles and ReactionsChemistryISBN:9781305079373Author:William L. Masterton, Cecile N. HurleyPublisher:Cengage Learning