Interpretation:
The standard enthalpy of reaction has to be calculated.
Concept Introduction:
Standard enthalpy of reaction:
The change in enthalpy that is associated with the formation of one mole of a substance from its related elements being in standard state is called standard enthalpy of formation (
The standard enthalpy of reaction is the enthalpy of reaction that takes place under standard conditions.
The equation for determining the standard enthalpies of compound and element can be given by,
To calculate: The standard enthalpy of reaction
Want to see the full answer?
Check out a sample textbook solutionChapter 10 Solutions
Aleks 360 Access Card (1 Semester) For Chemistry: Atoms First
- A 250-g sample of water at 20.0C is placed in a freezer that is held at a constant temperature of 20.0C. Considering the water as the system, answer the following questions: a What is the sign of qsys for the water after it is placed in the freezer? b After a few hours, what will be the state of the water? c How will the initial enthalpy for the water compare with the final enthalpy of the water after it has spent several hours in the freezer? d What will the temperature of the water be after several hours in the freezer?arrow_forwardThe head of a strike anywhere match contains tetraphosphorus trisulfide, P4S3. In an experiment, a student burned this compound in an excess of oxygen and found that it evolved 3651 kJ of heat per mole of P4S3 at a constant pressure of 1 atm. She wrote the following thermochemical equation: P4S3(s)+8O2(g)P4O10(s)+3SO2(g);H=3651kJ Calculate the standard enthalpy of formation of P4S3, using this students result and the following standard enthalpies of formation: P4O10(s), 3009.9 kJ/mol; SO2(g), 296.8 kJ/mol. How does this value compare with the value given in Appendix C?arrow_forwardAnother reaction that is used to propel rockets is N2O4(l)+2N2H4(l)3N2(g)+4H2O(g) This reaction has the advantage that neither product is toxic, so no dangerous pollution is released. When the reaction consumes 10.0 g liquid N2O4, it releases 124 kJ of heat. (a) Is the sign of the enthalpy change positive or negative? (b) What is the value of H for the chemical equation if it is understood to be written in molar quantities?arrow_forward
- 9.91 You want to heat the air in your house with natural gas (CH4). Assume your house has 275 m2(ahout 2800 ft2) of floor area and that the ceilings are 2.50 m from the floors. The air in the house has a molar heat capacity of 29.1 J mol-l K-l. (The number of moles of air in the house may he found by assuming that the average molar mass of air is 28.9 g/mol and that the density of air at these temperatures is 1.22 g/L.) What mass of methane do you have to burn to heat the air from 15.0 to 22.0°C?arrow_forwardUsing the data in Appendix G, calculate the standard enthalpy change for each of the following reactions: (a) N2(g)+O2(g)2NO(g) (b) Si(s)+2Cl2(g)SiCl4(g) (c) Fe2O3(s)+3H2(g)2Fe(s)+3H2O(l) (d) 2LiOH(s)+CO2(g)Li2CO3(s)+H2O(g)arrow_forwardGive the definition of the standard enthalpy of formation for a substance. Write separate reactions for the formation of NaCl, H2O , C6H12O6, and PbSO4 that have H values equal to Hf for each compound.arrow_forward
- 9.73 Without looking up any numerical data or doing calculations, predict whether the enthalpy change for each of the following reactions should he positive, negative, or zero. (a) H2O(l)H2O(s) (b) N2(g)2N(g) (c) CH4(g)+2O2(g)CO2(g)+2H2O(l) (d) CO2(s)CO2(g)arrow_forwardEthylene glycol, HOCH2CH2OH, is used as antifreeze. It is produced from ethylene oxide, C2H4O, by the reaction C2H4O(g)+H2O(l)HOCH2CH2OH(l) Use Hesss law to obtain the enthalpy change for this reaction from the following enthalpy changes: 2C2H4O(g)+5O2(g)4CO2(g)+4H2O(l);H=2612.2kJHOCH2CH2OH(l)+52O2(g)2CO2(g)+3H2O(l);H=1189.8kJarrow_forwardThe process of dissolving ammonium nitrate, NH4NO3, in water is an endothermic process. What is the sign of q? If you were to add some ammonium nitrate to water in a flask, would you expect the flask to feel warm or cool?arrow_forward
- Sodium carbonate, Na2CO3, is used to manufacture glass. It is obtained from sodium hydrogen carbonate, NaHCO3, by heating. 2NaHCO3(s)Na2CO3(s)+H2O(g)+CO2(g) Calculate the standard enthalpy of reaction, using enthalpies of formation (Table 6.2).arrow_forwardNitric acid, HNO3, can be prepared by the following sequence of reactions: 4NH3(g)+5O2(g)4NO(g)+6H2O(g)2NO(g)+O2(g)2NO2(g)3NO2(g)+H2O(l)2HNO3(l)+NO(g) How much heat is evolved when 1 mol of NH3(g) is converted to HNO3(l)? Assume standard states at 25 C.arrow_forwardIn a constant-volume calorimeter, 35.0g of H2cools from 75.3C to25.0C. Calculate w, q, U, and H for the process.arrow_forward
- Chemistry by OpenStax (2015-05-04)ChemistryISBN:9781938168390Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark BlaserPublisher:OpenStaxChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage Learning
- Chemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry for Engineering StudentsChemistryISBN:9781337398909Author:Lawrence S. Brown, Tom HolmePublisher:Cengage Learning