Concept explainers
Interpretation:
The standard enthalpy of reaction has to be calculated and the missing products have to be identified.
Concept Introduction:
Standard enthalpy of reaction:
The change in enthalpy that is associated with the formation of one mole of a substance from its related elements being in standard state is called standard enthalpy of formation (
The standard enthalpy of reaction is the enthalpy of reaction that takes place under standard conditions.
The equation for determining the standard enthalpies of compound and element can be given by,
To calculate: The standard enthalpy of the reaction
Answer to Problem 9PPB
The enthalpy of change of the reaction is
Explanation of Solution
The thermochemical equation can be given as,
The first equation is reversed and divided by two.
The second equation remains the same.
The missing product can be identified using the reactions of 1 and 2
The second equation is divided by two, to get one of the products
Upon adding all the three equations,
Enthalpy of reaction is
Products were identified as Ammonia and Hydrogen chloride.
The enthalpy of the reaction and missing products were identified.
Want to see more full solutions like this?
Chapter 10 Solutions
Aleks 360 Access Card (1 Semester) For Chemistry: Atoms First
- The specific heat capacity of copper is 0.385 J g1 C1, whereas it is 0.128 J g1 C1 for gold. Assume you place 100. g of each metal, originally at 25 C, in a boiling water bath at 100 C. If energy is transferred to each metal at the same rate, determine which piece of metal will reach 100 C first.arrow_forwardGasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.arrow_forwardAnother reaction that is used to propel rockets is N2O4(l)+2N2H4(l)3N2(g)+4H2O(g) This reaction has the advantage that neither product is toxic, so no dangerous pollution is released. When the reaction consumes 10.0 g liquid N2O4, it releases 124 kJ of heat. (a) Is the sign of the enthalpy change positive or negative? (b) What is the value of H for the chemical equation if it is understood to be written in molar quantities?arrow_forward
- Assume 200. mL of 0.400 M HCl is mixed with 200. mL of 0.400 M NaOH in a coffee-cup calorimeter The temperature of the solutions before mixing was 25.10 C; after mixing and allowing the reaction to occur, the temperature is 27.78 C. What is the enthalpy change when one mole of acid is neutralized? (Assume that the densities of all solutions are 1.00 g/mL and their specific heat capacities are 4.20 J/g K.)arrow_forward9.35 A piece of titanium metal with a mass of 20.8 g is heated in boiling water to 99.5°C and then dropped into a coffee cup calorimeter containing 75.0 g of water at 2 1.7°C. When thermal equilibrium is reached, the final temperature is 24.3°C. Calculate the specific heat capacity of titanium.arrow_forwardAlloys When a 58.8-g piece of hot alloy is placed in125 g of cold water in a calorimeter, the temperature ofthe alloy decreases by 106.1°C, while the temperature ofthe water increases by 10.5°C. What is the specific heat ofthe alloy?arrow_forward
- A 0.470-g sample of magnesium reacts with 200 g dilute HCl in a coffee-cup calorimeter to form MgCl2(aq) and H2(g). The temperature increases by 10.9 C as the magnesium reacts. Assume that the mixture has the same specific heat as water and a mass of 200 g. (a) Calculate the enthalpy change for the reaction. Is the process exothermic or endothermic? (b) Write the chemical equation and evaluate H.arrow_forwardWhen solid iron burns in oxygen gas (at constant pressure) to produce Fe2O3(s), 1651 kJ of heat is released for every 4 mol of iron burned. How much heat is released when 10.3 g Fe2O3(s) is produced (at constant pressure)? What additional information would you need to calculate the heat released to produce this much Fe2O3(s) if you burned iron in ozone gas, O3(g), instead of O2(g)?arrow_forwardA typical fat in the body is glyceryl trioleate, C57H104O6. When it is metabolized in the body, it combines with oxygen to produce carbon dioxide, water, and 3.022104 kJ of heat per mole of fat. (a) Write a balanced thermochemical equation for the metabolism of fat. (b) How many kilojoules of energy must be evolved in the form of heat if you want to get rid of five pounds of this fat by combustion? (c) How many nutritional calories is this? (1 nutritional calories =1103 calories)arrow_forward
- Chemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningChemistry by OpenStax (2015-05-04)ChemistryISBN:9781938168390Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark BlaserPublisher:OpenStaxChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage Learning
- Chemistry: Principles and ReactionsChemistryISBN:9781305079373Author:William L. Masterton, Cecile N. HurleyPublisher:Cengage LearningGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage Learning