Interpretation:
Chemist is testing by running the reaction when different R groups on each alcohol carbons are used; the correct statement has to be identified.
Concept Introduction:
Pinacol rearrangement: For all glycols Pinacol rearrangement occurs. Unsymmetrical vicinal
Step 1: Add proton (protonation of Pinacol using acid catalyst).
Step 2: Break a bond to give a stable molecules or ions (formation of carbocation).
Step 3: 1, 2-shift (migration of substituent from
Step 4: deprotonation occurs (take a proton away).
![Check Mark](/static/check-mark.png)
Trending nowThis is a popular solution!
![Blurred answer](/static/blurred-answer.jpg)
Chapter 10 Solutions
OWL V2 with MindTap Reader and Student Solutions Manual eBook for Brown/Iverson/Anslyn/Foote's Organic Chemistry, 8th Edition
- Make sure you label everything as labeled as asked and make sure you explain everything is asked step by step.arrow_forwardComplete each acid-base reaction and predict whether the position of equilibrium lies toward the left or toward the right. (a) CH3CCH+CH3CH2ONa+CH3CH3OH (b) CH3CCCH2CH2OH+Na+NH2NH3(l)arrow_forwardAfter separating the acidic and neutral compounds in a mixture, how does one recover the neutral compound from the organic solution that it is in? O 1) Treat with HCl until acidic to precipitate the neutral compound as a solid. Heat the solution on a hot plate to evaporate the organic solvent and recover O 2) the neutral compound as a solid. Wave a magic wand and speak the spell of recovery to get the neutral O 3) compound as a solid. You don't need to recover the neutral compound as a soild, toss out the O4) organic solution and clean up the lab.arrow_forward
- Does alcohol, ketones, and aldehydes considered acidic or a basic?arrow_forwardConsider the reaction below to answer the following questions. HÇI HO H,0 HO a. The first nucleophile in the reaction is b. The catalyst in the reaction is c. The newly created functional group in the reaction is called a(n) d. The first step in the reaction mechanism is protonation of the group. e. The last step in the reaction mechanism is of the oxonium ion.arrow_forwardCF-3-NH-2-IS A WEAKER BASE THAN CH-3-NH-2-. Briefly explain why this is the case?arrow_forward
- 1. Simple ketones, like acetone, are often used as industrial solvents for many organically based products such as adhesives and paints. They are considered "universal solvents," because they dissolve so many diverse materials. Explain why these chemicals are good solvents.arrow_forwardGive answer all questions with some explanation. In one step.arrow_forwardOne source of the reactivity of the carbonyl group is its polarity. Click on the atom of the carbonyl group that carries a partial positive charge. carbonyl grouparrow_forward
- 1. What is the result when alcohol is mixed with cooking oil. 2. What is the result when acetone is mixed with cooking oilarrow_forwardWhat are 5 reactions that can create benzoic acid? Draw them outarrow_forward1. Answer Only True or False? Ketones can be oxidized by Tollen's reagent? True False Refer to the following mixtures: Mixture A: Liquid and solid mixture Mixture B. Liquid mixture whose boiling points are similar. Mixture C. Liquid mixture with high boiling point. Mixture D. Heat sensitive liquid mixture. Which of the following distillation can be applied for Mixture C? vacuum distillation fractional distillation simple distillation none of these In the experiment synthesis of acetyl salicylic acid, what is the purpose of adding water after salicylic acid and acetic anhydride reacted? the destroy the unreacted salicylic acid the destroy the unreacted acetic anhydride to increase the yield of the reaction to dilute the sulfuric acid ————— What smell/odor is expected for the complete reaction of benzyl alcohol and formic acid in the presence of catalytic amount of sulfuric acid? pineapple smell orange smell banana smell wintergreen smell finger nail polish smell…arrow_forward
- Organic ChemistryChemistryISBN:9781305580350Author:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. FootePublisher:Cengage LearningChemistry for Today: General, Organic, and Bioche...ChemistryISBN:9781305960060Author:Spencer L. Seager, Michael R. Slabaugh, Maren S. HansenPublisher:Cengage LearningIntroductory Chemistry: A FoundationChemistryISBN:9781337399425Author:Steven S. Zumdahl, Donald J. DeCostePublisher:Cengage Learning
![Text book image](https://www.bartleby.com/isbn_cover_images/9781305580350/9781305580350_smallCoverImage.gif)
![Text book image](https://www.bartleby.com/isbn_cover_images/9781305960060/9781305960060_smallCoverImage.gif)
![Text book image](https://www.bartleby.com/isbn_cover_images/9781337399425/9781337399425_smallCoverImage.gif)