Concept explainers
(a)
Interpretation:
The potential energy diagram for the given reaction has to be given with appropriate labels.
Concept introduction:
Activation energy
(b)
Interpretation:
The plausible structure for the transition state for the given reaction has to be drawn.
Concept introduction:
Transition state: Transition state is an intermediate state of a particular reaction with highest energy value. At the transition state it has a particular configuration where bond breaking and formation are showed by dashed lines.
Activation energy
Want to see the full answer?
Check out a sample textbook solutionChapter 12 Solutions
General Chemistry: Atoms First
- What is U for the following reaction at 25C? 2H2(g)+O2(g)2H2O(l)arrow_forwardFor the following reaction C(s)+2H2(g)CH4(g) K=0.26 at 1000C (3 significant figures). What is the equilibrium constant at 750C (3 significant figures)?arrow_forwardSilicon forms a series of compounds analogous to the al-kanes and having the general formula SinH2n+2. The first of these compounds is silane, SiH4, which is used in the electronics industry to produce thin ultrapure silicon films. SiH4(g) is somewhat difficult to work with because it is py-ropboric at room temperature—meaning that it bursts into flame spontaneously when exposed to air. (a) Write an equation for the combustion of SiH4(g). (The reaction is analogous to hydrocarbon combustion, and SiO2 is a solid under standard conditions. Assume the water produced will be a gas.) (b) Use the data from Appendix E to calculate ? for this reaction. (c) Calculate G and show that the reaction is spontaneous at 25°C. (d) Compare G for this reaction to the combustion of methane. (See the previous problem.) Are the reactions in these two exercises enthalpy or entropy driven? Explain.arrow_forward
- During polymerization, the system usually becomes more ordered as monomers link together. Could an endothermic polymerization reaction ever occur spontaneously? Explain.arrow_forward7-43 (Chemical Connections 7A and 7B) Why is a high fever dangerous? Why is a low body temperature dangerous?arrow_forwardMonochloroethane (C2H5Cl) can be produced by the direct reaction of ethane gas (C2H6) with chlorine gas or by the reaction of ethylene gas (C2H4) with hydrogen chloride gas. The second reaction gives almost a 100% yield of pure C2H5Cl at a rapid rate without catalysis. The first method requires light as an energy source or the reaction would not occur. Yet G for the first reaction is considerably more negative than G for the second reaction. Explain how this can be so.arrow_forward
- Cobalt(II) chloride hexahydrate, CoCl26H2O, is a bright pink compound, but in the presence of very dry air it loses water vapor to the air to produce the light blue anhydrous salt CoCl2. Calculate the standard free-energy change for the reaction at 25C: CoCl26H2O(s)CoCl2(s)+6H2O(g) Here are some thermodynamic data at 25C: What is the partial pressure of water vapor in equilibrium with the anhydrous salt and the hexahydrate at 25C? (Give the value in mmHg.) What is the relative humidity of air that has this partial pressure of water? The relative humidity of a sample of air is Relativehumidity=partialpressureofH2O(g)inairvaporpressureofwater100 What do you expect to happen to the equilibrium partial pressure over the hexahydrate as the temperature is raised? Explain.arrow_forward. The minimum energy required for molecules to react with each other is called the _______ energy.arrow_forwardCalculate the s value of the conversion of ozone to oxygen in the absence of Cl atom. Substance: O2(g) 205.0( j/mol.k) O3(g) 238.8(j/mol.k)arrow_forward
- 1. When determining the energy of a reaction where 0.250 mol of a substance with a ΔHcomb = -2250.0 kJ/mol reacts, we perform this calculation (attached): Why can’t we simply say that the energy of the reaction is -2250.0 kJ?arrow_forwardIn a hypothetical reaction of 2B + C ➡ D, the order of reaction for the given equation is??arrow_forwardchapter 12: 5) Calculate the ΔS° value for the conversion of ozone to oxygen in the absence of Cl atoms. 2O3(g)---> 3O2(g)arrow_forward
- Chemistry for Engineering StudentsChemistryISBN:9781337398909Author:Lawrence S. Brown, Tom HolmePublisher:Cengage LearningChemistry for Engineering StudentsChemistryISBN:9781285199023Author:Lawrence S. Brown, Tom HolmePublisher:Cengage LearningChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage Learning
- ChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning