In the gas phase, acetic acid exists as an equilibrium of monomer and dimer molecules. (The dimer consists of two molecules linked through hydrogen bonds.)
The equilibrium constant, Kc, at 25 °C for the monomer-dimer equilibrium
2 CH3CO2H ⇄ (CH3CO2H)2
has been determined to be 3.2 × 104. Assume that acetic acid is present initially at a concentration of 5.4 × 10−4 mol/L at 25 °C and that no dimer is present initially.
(a) What percentage of the acetic acid is converted to dimer?
(b) As the temperature increases, in which direction does the equilibrium shift? (Recall that hydrogen-bond formation is an exothermic process.)
Trending nowThis is a popular solution!
Chapter 15 Solutions
Bundle: Chemistry & Chemical Reactivity, Loose-Leaf Version, 9th + OWLv2, 4 terms (24 Months) Printed Access Card
Additional Science Textbook Solutions
Chemistry: Structure and Properties (2nd Edition)
Introductory Chemistry (6th Edition)
Organic Chemistry (8th Edition)
Chemistry by OpenStax (2015-05-04)
Elementary Principles of Chemical Processes, Binder Ready Version
Chemistry: The Central Science (13th Edition)
- The equilibrium constant for the dissociation of iodine molecules to iodine atoms I2(g) 2 I(g) is 3.76 103 at 1000 K. Suppose 0.105 mol of I2 is placed in a 12.3-L flask at 1000 K. What are the concentrations of I2 and I when the system comes to equilibrium?arrow_forwardAt 1 atm and 25 C, NO2 with an initial concentration of 1.00 M is 3.3103 decomposed into NO and O2. Calculate the value of the equilibrium constant for the reaction. 2NO2(g)2NO(g)+O2(g)arrow_forwardBecause calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?arrow_forward
- Consider the following equilibria involving SO2(g) and their corresponding equilibrium constants. SO2(g) + 12 O2(g) SO3(g) K1 2SO3(g) 2SO2(g) + O2(g) K2 Which of the following expressions relates K1 to K2? (a) K2=K12 (b) K22=K1 (c) K2 = K1 (d) K2 = 1/K1 (e) K2=1/K12arrow_forwardBecause carbonic acid undergoes a second ionization, the student in Exercise 12.39 is concerned that the hydrogen ion concentration she calculated is not correct. She looks up the equilibrium constant for the reaction HCO,-(aq) «=* H+(aq) + COf'(aq) Upon finding that the equilibrium constant for this reaction is 4.8 X 10“H, she decides that her answer in Exercise 12.39 is correct. Explain her reasoning. A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H,CO,(aq) 5=6 H+(aq) + HCO,'(aq) K = 4.4 X 10'7She starts with 0.1000 A1 carbonic acid. W hat are the concentrations of all species at equilibrium?arrow_forwardShow that the complete chemical equation, the total ionic equation, and the net ionic equation for the reaction represented by the equation KI(aq)+I2(aq)KI3(aq) give the same expression for the reaction quotient. KI3 is composed of the ions K+ and I3-.arrow_forward
- The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?arrow_forwardThe atmosphere consists of about 80% N2 and 20% O2, yet there are many oxides of nitrogen that are stable and can be isolated in the laboratory. (a) Is the atmosphere at chemical equilibrium with respect to forming NO? (b) If not, why doesnt NO form? If so, how is it that NO can be made and kept in the laboratory for long periods?arrow_forwardWrite the expression of the reaction quotient for the ionization of HOCN in water.arrow_forward
- Calculate the value of the equilibrium constant for the reaction N2(g)+2O2(g)2NO2(g) if the concentrations of the species at equilibrium are [N2] = 0.0013, [O2] = 0.0024, and [NO2] = 0.00065.arrow_forwardIn Table 12.1 (←Sec. 12-3a) the equilibrium constant for the reaction ⇋ is given as 4.2 × 1052. If this reaction is so product-favored, why can large piles of yellow sulfur exist in our environment (as they do in Louisiana and Texas)?arrow_forwardA 2.500-mol sample of phosphorus pentachloride, PCl5, decomposes at 160C and 1.00 atm to give 0.338 mol of phosphorus trichloride, PCl3, at equilibrium. PCl5(g)PCl3(g)+Cl2(g) What is the composition of the final reaction mixture?arrow_forward
- Chemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningIntroduction to General, Organic and BiochemistryChemistryISBN:9781285869759Author:Frederick A. Bettelheim, William H. Brown, Mary K. Campbell, Shawn O. Farrell, Omar TorresPublisher:Cengage Learning
- Chemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage Learning