Concept explainers
A mercury battery uses the following electrode half-reactions:
(a) Write a balanced equation for the overall cell reaction.
(b) Calculate
(c) What is the effect on the cell voltage of a tenfold change in the concentration of KOH in the electrolyte? Explain.
Want to see the full answer?
Check out a sample textbook solutionChapter 19 Solutions
CHEMISTRY-MOD.MASTERING (18W)
- What is the standard cell potential you would obtain from a cell at 25C using an electrode in which Hg22+(aq) is in contact with mercury metal and an electrode in which an aluminum strip dips into a solution of Al3+(aq)?arrow_forwardAnother type of battery is the alkaline zinc-mercury cell, in which the cell reaction is Zn(s) + HgO(s) Hg() + ZnO(s) E = + 1.35 V (a) What is the standard free energy change for this reaction? (b) The standard free energy change in a voltaic cell is the maximum electrical energy that the cell can produce. If the reaction in a zinc-mercury cell consumes 1.00 g mercury oxide, what is the standard free energy change? (c) For how many hours could a mercury cell produce a 10-mA current if the limiting reactant is 3.50 g mercury oxide?arrow_forwardAt 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.arrow_forward
- A voltaic cell is constructed in which one half-cell consists of a silver wire in an aqueous solution of AgNO3.The other half cell consists of an inert platinum wire in an aqueous solution containing Fe2+(aq) and Fe3+(aq). (a) Calculate the cell potential, assuming standard conditions. (b) Write the net ionic equation for the reaction occurring in the cell. (c) Which electrode is the anode and which is the cathode? (d) If [Ag+] is 0.10 M, and [Fe2+] and [Fe3+] are both 1.0 M, what is the cell potential? Is the net cell reaction still that used in part (a)? If not, what is the net reaction under the new conditions?arrow_forwardAt 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.arrow_forwardAn electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?arrow_forward
- Consider the electrolysis of water in the presence of very dilute H2SO4. What species is produced at the anode? Atthe cathode? What are the relative amounts of the speciesproduced at the two electrodes?arrow_forward1. If you wish to convert 0.0100 mol of Au3+ (aq) ions into Au(s) in a “gold-plating” process, how long must you electrolyze a solution if the current passing through the circuit is 2.00 amps? 483 seconds 4.83 104 seconds 965 seconds 1450 secondsarrow_forwardFor the reaction Cu2+(aq) + Zn(s) → Cu(s) + Zn2+ (aq), why can’t you generate electric current by placing a piece of copper metal and a piece of zinc metal in a solution containing CuCl2(aq) and ZnCl2(aq)?arrow_forward
- You have 1.0 M solutions of Al(NO3)3 and AgNO3 along with Al and Ag electrodes to construct a voltaic cell. The salt bridge contains a saturated solution of KCl. Complete the picture associated with this problem by a writing the symbols of the elements and ions in the appropriate areas (both solutions and electrodes). b identifying the anode and cathode. c indicating the direction of electron flow through the external circuit. d indicating the cell potential (assume standard conditions, with no current flowing). e writing the appropriate half-reaction under each of the containers. f indicating the direction of ion flow in the salt bridge. g identifying the species undergoing oxidation and reduction. h writing the balanced overall reaction for the cell.arrow_forwardAt 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction potential of Ba2+(aq) to find the standard potential for the half-reaction Ba(IO3)2(s)+2eBa(s)+2IO3(aq)arrow_forwardA standard galvanic cell is constructed so that the overall cell reaction is 2A13++(aq)+3M(s)3M2+(aq)+2A1(s) Where M is an unknown metal. If G = 411 kJ for the overall cell reaction, identify the metal used to construct the standard cell.arrow_forward
- Chemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningChemistry: Principles and ReactionsChemistryISBN:9781305079373Author:William L. Masterton, Cecile N. HurleyPublisher:Cengage LearningGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage Learning
- ChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning