Concept explainers
(a)
Interpretation:
The balanced chemical equation for the oxidation of
Concept introduction:
In an
If oxidation takes place on an electrode, that electrode is called anode. The species in that electrode remove electrons and itself gets oxidized.
If reduction takes place on an electrode, that electrode is called cathode. The species in that electrode absorbs electrons and itself gets reduced.
The electrode potential of cell can be calculated as follows:
Nernst equation for a cell can be represented as follows:
Here,
z = number of moles of electrons transferred in the cell and Q is ratio of concentration of products to reactant in a cell.
If E cell is positive, a reaction occurs spontaneously in the forward direction for the stated conditions.
If E cell is negative, the reaction occurs spontaneously in the reverse direction for the stated conditions.
If the E cell = 0 reaction is at equilibrium for the stated conditions.
(b)
Interpretation:
The balanced chemical equation for the oxidation of
Concept introduction:
In an electrochemical cell, there are two electrodes that can be observed.
If oxidation takes place on an electrode, that electrode is called anode. The species in that electrode remove electrons and itself gets oxidized.
If reduction takes place on an electrode, that electrode is called cathode. The species in that electrode absorbs electrons and itself gets reduced.
The electrode potential of cell can be calculated as follows:
Nernst equation for a cell can be represented as follows:
Here,
z = number of moles of electrons transferred in the cell and Q is ratio of concentration of products to reactant in a cell.
If E cell is positive, a reaction occurs spontaneously in the forward direction for the stated conditions.
If E cell is negative, the reaction occurs spontaneously in the reverse direction for the stated conditions.
If the E cell = 0 reaction is at equilibrium for the stated conditions.
(c)
Interpretation:
The balanced chemical equation for the oxidation of
Concept introduction:
From pH of a solution, the concentration of hydrogen ion can be calculated as follows:
Here,
In an electrochemical cell, there are two electrodes that can be observed.
If oxidation takes place on an electrode, that electrode is called anode. The species in that electrode remove electrons and itself gets oxidized.
If reduction takes place on an electrode, that electrode is called cathode. The species in that electrode absorbs electrons and itself gets reduced.
The electrode potential of cell can be calculated as follows:
Nernst equation for a cell can be represented as follows:
Here,
z = number of moles of electrons transferred in the cell and Q is ratio of concentration of products to reactant in a cell.
If E cell is positive, a reaction occurs spontaneously in the forward direction for the stated conditions.
If E cell is negative, the reaction occurs spontaneously in the reverse direction for the stated conditions.
If the E cell = 0 reaction is at equilibrium for the stated conditions.
Want to see the full answer?
Check out a sample textbook solutionChapter 19 Solutions
General Chemistry: Principles and Modern Applications, Loose Leaf Version (11th Edition)
- The standard potential, E, for the reaction of Zn(s) and Cl2(g) is +2.12 V. What is the standard free energy change, rG, for the reaction?arrow_forwardActually, the carbon in CO2(g) is thermodynamically unstable with respect to the carbon in calcium carbonate(limestone). Verify this by determining the standardGibbs free energy change for the reaction of lime,CaO(s), with CO2(g) to make CaCO3(s).arrow_forwardFor each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Zn(s)+Fe2+(aq)Zn2+(aq)+Fe(s) (b) AgCl(s)+Fe2+(aq)Ag(s)+Fe3+(aq)+Cl(aq) (c) Br2(l)+2Cl(aq)Cl2(g)+2Br(aq)arrow_forward
- Calculate K at 25°C for each of the reactions referred to in Question 32. Assume smallest whole-number coefficients.arrow_forwardCalculate the standard cell potential of the cell corresponding to the oxidation of oxalic acid, H2C2O4, by permanganate ion. MnO4. 5H2C2O4(aq)+2MnO4(aq)+6H+(aq)10CO2(g)+2Mn2+(aq)+8H2O(l) See Appendix C for free energies of formation: Gf for H2C2O4(aq) is 698 kJ.arrow_forwardCalculate E°, G°, and K at 25°C for the reaction 3Mn2+(aq)+2MnO4(aq)+2H2O5MnO2(s)+4H+(aq)arrow_forward
- Calculate E°, G°, and K at 25°C for the reaction 3MnO4(aq)+4H+(aq)+Cl2(g)2Mn2+(aq)+2ClO3(aq)+2H2Oarrow_forwardCalculate G for the following reactions and state whether each reaction is spontaneous under standard conditions at 298 K. (a) 2Na(s) + H2SO4() Na2SO4(s) + H2(g) (b) Cu(s) + H2SO4() CuSO4(s) + H2(g)arrow_forwardCalcium metal can be obtained by the direct electrolysis of molten CaCl2, at a voltage of 3.2 V. (a) How many joules of electrical energy are required to obtain 12.0 1b of calcium? (b) What is the cost of the electrical energy obtained in (a) if electrical energy is sold at the rate of nine cents per kilowatt hour?arrow_forward
- At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.arrow_forwardFor each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mn(s)+Ni2+(aq)Mn2+(aq)+Ni(s) (b) 3Cu2+(aq)+2Al(s)2Al3+(aq)+3Cu(s) (c) Na(s)+LiNO3(aq)NaNO3(aq)+Li(s) (d) Ca(NO3)2(aq)+Ba(s)Ba(NO3)2(aq)+Ca(s)arrow_forwardWhat is the standard cell potential you would obtain from a cell at 25C using an electrode in which Hg22+(aq) is in contact with mercury metal and an electrode in which an aluminum strip dips into a solution of Al3+(aq)?arrow_forward
- Chemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningChemistry by OpenStax (2015-05-04)ChemistryISBN:9781938168390Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark BlaserPublisher:OpenStaxChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage Learning
- Chemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage Learning