(a)
Interpretation The dimensions species
Concept introduction:
Coordination compounds: The compounds having coordination covalent bonds which form when metal ions react with polar molecules or anions
Ligand field theory: It is used to explain the bonding between metal and ligand in a coordination complex. Ligand field theory is explained in terms of electrostatic interaction of between metal ion and ligands.
Electronic configuration shows the electrons distribution of atoms or molecule in its molecular or atomic orbitals. The electrons are distributed in orbitals by following three important rules, Aufbau's Principle, Pauli-exclusion principle, and Hund's Rule.
If the complex has minimum one unpaired electron, then they are paramagnetic and are attracted towards the magnetic field. If all the electrons are paired in a complex, then they are diamagnetic and are repelled from the magnetic field.
Equation for density is,
(b)
Interpretation The density of austenite unit cell has to be determined.
Concept introduction:
Coordination compounds: The compounds having coordination covalent bonds which form when metal ions react with polar molecules or anions
Ligand field theory: It is used to explain the bonding between metal and ligand in a coordination complex. Ligand field theory is explained in terms of electrostatic interaction of between metal ion and ligands.
Electronic configuration shows the electrons distribution of atoms or molecule in its molecular or atomic orbitals. The electrons are distributed in orbitals by following three important rules, Aufbau's Principle, Pauli-exclusion principle, and Hund's Rule.
If the complex has minimum one unpaired electron, then they are paramagnetic and are attracted towards the magnetic field. If all the electrons are paired in a complex, then they are diamagnetic and are repelled from the magnetic field.
Equation for density is,
(c)
Interpretation
Concept introduction:
Coordination compounds: The compounds having coordination covalent bonds which form when metal ions react with polar molecules or anions
Ligand field theory: It is used to explain the bonding between metal and ligand in a coordination complex. Ligand field theory is explained in terms of electrostatic interaction of between metal ion and ligands.
Electronic configuration shows the electrons distribution of atoms or molecule in its molecular or atomic orbitals. The electrons are distributed in orbitals by following three important rules, Aufbau's Principle, Pauli-exclusion principle, and Hund's Rule.
If the complex has minimum one unpaired electron, then they are paramagnetic and are attracted towards the magnetic field. If all the electrons are paired in a complex, then they are diamagnetic and are repelled from the magnetic field.
Equation for density is,
Trending nowThis is a popular solution!
Chapter 22 Solutions
Bundle: Chemistry & Chemical Reactivity, Loose-Leaf Version, 9th + OWLv2, 4 terms (24 Months) Printed Access Card
- Which Period 4 transition-metal ions are isoelectronic with (a) Zn2+ (b) Mn2+ (c) Cr3+ (d) Fe3+arrow_forwardIdentify, based on the position in the periodic table, the actinide elements among those in the following list: Co, Cm, Cd, Ce, Cf.arrow_forwardTourmaline is the most colorful of all gemstones. It neutralizes negative forces and offers emotional stability. It is crystalline boron silicates compounded with metals such as Mg, Fe, Al, Na and Li. The three most well-known minerals of tourmaline are: Elbaite Na(LiAl2)Al6Si6O18(BO3)3(OH)4 Schorl Na(Fe3)Al6(BO3)3Si6O18(OH)4 Dravite Na(Mg3)Al6(BO3)3Si6O18(OH)4 On a basis of 1000 kg of tourmaline rocks containing 25% Elbaite, 35% Schorl, 30% Dravite and 10% inerts, calculate the following: a) kg-mol Elbaite b) % by wt BO3 in tourmaline rocksarrow_forward
- Tourmaline is the most colorful of all gemstones. It neutralizes negative forces and offers emotional stability. It is crystalline boron silicates compounded with metals such as Mg, Fe, Al, Na and Li. The three most well-known minerals of tourmaline are: Elbaite Na(LiAl2)Al6Si6O18(BO3)3(OH)4 Schorl Na(Fe3)Al6(BO3)3Si6O18(OH)4 Dravite Na(Mg3)Al6(BO3)3Si6O18(OH)4 On a basis of 1000 kg of tourmaline rocks containing 25% Elbaite, 35% Schorl, 30% Dravite and 10% inerts, calculate the following: a) kg Fe b) total kg-atom O and kg-mol O2 in the three minerals c) total number of Mg atoms in the rocksarrow_forwardAn Al2O3 whisker is a small single crystal used to reinforce metal-matrix composites. Given a cylindrical shape for the whisker, calculate the number of O atoms in a whisker with a diameter of 1 μm and a length of 25 μm. The density of Al2O3 is 3.97 g/cm3.arrow_forwardWhat is a heterogeneous alloy?arrow_forward
- Potassium and Sulfide ions are isoelectronic. Explain the term isoelectronic with reference to these ions.arrow_forwardName the following: a) Na3[FeBr6] b) [Cr(CN)2(H2O)]2+ c) [CoCl2(NH3)(en)2]Cl Give formulas for the following: d) dihydroxotetraaquaaluminum (IV) ion e) lithium tetranitrodiaminozincate (II) Please use English names for metals, not Latin names.arrow_forwardMany ionic compounds are used as paint pigments. Name each of the following pigments. a. CdS (yellow)c. Cr 2O 3 (white) b. TiO 2 (white)d. Mn 3(PO 4) 2 (purple)arrow_forward
- Why does the reactivity of metals increase from right to left on the periodic table? Metals on the right have fewer protons, making it harder to attract electrons from other atoms. Metals on the right have fewer valence energy levels, so electrons are closer to the nucleus and harder to pull away. Metals on the right have more protons, causing valence electrons to be held more strongly. Metals on the right have more valence energy levels, so the ability of the nucleus to attract electrons is reduced.arrow_forwardSuggest two reasons why zinc and potassium are unlikely to form a solid solution alloyarrow_forward7)Which metal atom below cannot form cations of several different charges? Mn Fe Cr Ba nonearrow_forward
- Chemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage Learning
- General Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry: Principles and ReactionsChemistryISBN:9781305079373Author:William L. Masterton, Cecile N. HurleyPublisher:Cengage LearningChemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage Learning