Concept explainers
(a)
Interpretation:
The conversion of acetophenone into the given compound is to be done.
Concept introduction:
When only one carbonyl component has an alpha hydrogen atom, then a cross aldol reaction will occur. There will be formation of only one product. The yield of single cross aldol condensation reaction is enhanced if the electrophilic carbonyl compound is relatively unhindered.
(b)
Interpretation:
The conversion of acetophenone into the given compound is to be done.
Concept introduction:
When only one carbonyl component has an alpha hydrogen atom, then a cross aldol reaction will occur. There will be formation of only one product. The yield of single cross aldol condensation reaction is enhanced if the electrophilic carbonyl compound is relatively unhindered.
(c)
Interpretation:
The conversion of acetophenone into the given compound is to be done.
Concept introduction:
When only one carbonyl component has an alpha hydrogen atom, then a cross aldol reaction will occur. There will be formation of only one product. The yield of single cross aldol condensation reaction is enhanced if the electrophilic carbonyl compound is relatively unhindered.
(d)
Interpretation:
The conversion of acetophenone into the given compound is to be done.
Concept introduction:
When only one carbonyl component has an alpha hydrogen atom, then a cross aldol reaction will occur. There will be formation of only one product. The yield of single cross aldol condensation reaction is enhanced if the electrophilic carbonyl compound is relatively unhindered.
Want to see the full answer?
Check out a sample textbook solutionChapter 24 Solutions
Organic Chemistry
- Complete these reactions. (a) (b)arrow_forwardMaltose is a carbohydrate present in malt, the liquid obtained from barley and other grains. Although maltose has numerous functional groups, its reactions are explained by the same principles we have already encountered.a. Label the acetal and hemiacetal carbons.b. What products are formed when maltose is treated with each of these reagents: [1] H3O+; [2] CH3OH and HCl; [3] excess NaH, then excess CH3I?c. Draw the products formed when the compound formed in Reaction [3] of part (b) is treated with aqueous acid.The reactions in parts (b) and (c) are used to determine structural features of carbohydrates like maltose.arrow_forward(a) Give an acceptable name for each compound, (b) Draw the organic products formed when A or B is treated with each reagent: [1] H3O+; [2] −OH, H2O; [3] CH3CH2CH2MgBr (excess), then H2O; [4] LiAlH4, then H2O.arrow_forward
- 2. Draw the reaction scheme in ChemDraw depicting Strecker aldehyde starting from α-dicarbonyl. Include general reactants and by-products as necessary.arrow_forward1.1 Explain why phenols are more acidic than comparable cyclic and acyclic alcohol and why is it resistant to weak oxidizing agents? 1.2 What is the reason why tertiary alcohols cannot be oxidized?arrow_forwardDraw the products formed when phenol(C6H5OH) is treated with each reagent. Give an explanation. d. (CH3CH2)2CHCOCl, AlCl3 j. product in (d), then NH2NH2, – OHarrow_forward
- Draw the product formed when (CH3)2CHOH is treated with each reagent (a, b and c)arrow_forwardDetermine the product formed when compound A is treated with each reagent.arrow_forwardAnswer the following questions based on the reaction below: a) State reagent D. b) Draw the structural formula for compounds E, G, H and Jarrow_forward
- Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l). The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 8.50 gof butanoic acid and excess ethanol? Express your answer in grams to three significant figures.arrow_forwardEthyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.50 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%yield? Express your answer in grams to three significant figures.arrow_forwardEthyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) a) Given 7.70 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100% yield? b) A chemist ran the reaction and obtained 5.25 g of ethyl butyrate. What was the percent yield? c) The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.70 g of butanoic acid and excess ethanol?arrow_forward
- Organic ChemistryChemistryISBN:9781305580350Author:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. FootePublisher:Cengage Learning