INTRODUCTION TO CHEMISTRY-ACCESS
5th Edition
ISBN: 9781260518542
Author: BAUER
Publisher: MCG
expand_more
expand_more
format_list_bulleted
Concept explainers
Question
Chapter 5, Problem 132QP
Interpretation Introduction
Interpretation:
The given reaction is to be classified on the basis of combination, decomposition, single displacement or double displacement reaction and the balanced chemical equation for the reaction are to be determined.
Concept Introduction:
A
The species initially present in the reaction are known as reactants and the species that form after the completion of the chemical reaction are known as products.
Expert Solution & Answer
Want to see the full answer?
Check out a sample textbook solutionChapter 5 Solutions
INTRODUCTION TO CHEMISTRY-ACCESS
Ch. 5 - Prob. 1QCCh. 5 - Prob. 2QCCh. 5 - Prob. 3QCCh. 5 - Prob. 4QCCh. 5 - Prob. 5QCCh. 5 - Prob. 1PPCh. 5 - Prob. 2PPCh. 5 - Prob. 3PPCh. 5 - Prob. 4PPCh. 5 - Prob. 5PP
Ch. 5 - Prob. 6PPCh. 5 - Prob. 7PPCh. 5 - Prob. 8PPCh. 5 - Prob. 9PPCh. 5 - Prob. 10PPCh. 5 - Prob. 11PPCh. 5 - Calcium oxide is the white powder, lime. When...Ch. 5 - Prob. 13PPCh. 5 - Prob. 14PPCh. 5 - Prob. 1QPCh. 5 - Prob. 2QPCh. 5 - Prob. 3QPCh. 5 - Prob. 4QPCh. 5 - Prob. 5QPCh. 5 - Prob. 6QPCh. 5 - Prob. 7QPCh. 5 - Prob. 8QPCh. 5 - Prob. 9QPCh. 5 - Prob. 10QPCh. 5 - Prob. 11QPCh. 5 - Prob. 12QPCh. 5 - Prob. 13QPCh. 5 - Prob. 14QPCh. 5 - Prob. 15QPCh. 5 - Prob. 16QPCh. 5 - Prob. 17QPCh. 5 - Prob. 18QPCh. 5 - Prob. 19QPCh. 5 - Prob. 20QPCh. 5 - Prob. 21QPCh. 5 - Prob. 22QPCh. 5 - Prob. 23QPCh. 5 - Prob. 24QPCh. 5 - Prob. 25QPCh. 5 - Prob. 26QPCh. 5 - Write complete, balanced equations for each of the...Ch. 5 - Prob. 28QPCh. 5 - Prob. 29QPCh. 5 - Prob. 30QPCh. 5 - Prob. 31QPCh. 5 - Prob. 32QPCh. 5 - Prob. 33QPCh. 5 - Prob. 34QPCh. 5 - Prob. 35QPCh. 5 - Prob. 36QPCh. 5 - Prob. 37QPCh. 5 - Prob. 38QPCh. 5 - Prob. 39QPCh. 5 - Prob. 40QPCh. 5 - Prob. 41QPCh. 5 - Prob. 42QPCh. 5 - Prob. 43QPCh. 5 - Prob. 44QPCh. 5 - Prob. 45QPCh. 5 - Prob. 46QPCh. 5 - Prob. 47QPCh. 5 - Prob. 48QPCh. 5 - Prob. 49QPCh. 5 - Prob. 50QPCh. 5 - Prob. 51QPCh. 5 - Prob. 52QPCh. 5 - Prob. 53QPCh. 5 - Prob. 54QPCh. 5 - Prob. 55QPCh. 5 - Prob. 56QPCh. 5 - Prob. 57QPCh. 5 - Prob. 58QPCh. 5 - Prob. 59QPCh. 5 - Prob. 60QPCh. 5 - Prob. 61QPCh. 5 - Prob. 62QPCh. 5 - Prob. 63QPCh. 5 - Prob. 64QPCh. 5 - Prob. 65QPCh. 5 - Prob. 66QPCh. 5 - Prob. 67QPCh. 5 - Prob. 68QPCh. 5 - Prob. 69QPCh. 5 - Prob. 70QPCh. 5 - Prob. 71QPCh. 5 - Prob. 72QPCh. 5 - Prob. 73QPCh. 5 - Prob. 74QPCh. 5 - Prob. 75QPCh. 5 - Prob. 76QPCh. 5 - Prob. 77QPCh. 5 - Prob. 78QPCh. 5 - Prob. 79QPCh. 5 - Consider the following double-displacement...Ch. 5 - Write a balanced equation to describe any...Ch. 5 - Write a balanced equation to describe any...Ch. 5 - Prob. 83QPCh. 5 - Prob. 84QPCh. 5 - Prob. 85QPCh. 5 - Prob. 86QPCh. 5 - Prob. 87QPCh. 5 - Prob. 88QPCh. 5 - Prob. 89QPCh. 5 - Prob. 90QPCh. 5 - Prob. 91QPCh. 5 - Prob. 92QPCh. 5 - Prob. 93QPCh. 5 - Prob. 94QPCh. 5 - Prob. 95QPCh. 5 - Prob. 96QPCh. 5 - Prob. 97QPCh. 5 - Why is it necessary to identify a substance as an...Ch. 5 - Prob. 99QPCh. 5 - Prob. 100QPCh. 5 - Prob. 101QPCh. 5 - Prob. 102QPCh. 5 - Prob. 103QPCh. 5 - Prob. 104QPCh. 5 - Prob. 105QPCh. 5 - Prob. 106QPCh. 5 - Prob. 107QPCh. 5 - Prob. 108QPCh. 5 - Prob. 109QPCh. 5 - Prob. 110QPCh. 5 - Predict whether reactions should occur between...Ch. 5 - Prob. 112QPCh. 5 - Prob. 113QPCh. 5 - Prob. 114QPCh. 5 - Prob. 115QPCh. 5 - Prob. 116QPCh. 5 - Prob. 117QPCh. 5 - Prob. 118QPCh. 5 - Prob. 119QPCh. 5 - Prob. 120QPCh. 5 - Prob. 121QPCh. 5 - Prob. 122QPCh. 5 - Prob. 123QPCh. 5 - Prob. 124QPCh. 5 - Prob. 125QPCh. 5 - Prob. 126QPCh. 5 - Prob. 127QPCh. 5 - Prob. 128QPCh. 5 - Prob. 129QPCh. 5 - Prob. 130QPCh. 5 - Prob. 131QPCh. 5 - Prob. 132QPCh. 5 - Prob. 133QPCh. 5 - Prob. 134QPCh. 5 - Prob. 135QPCh. 5 - Prob. 136QPCh. 5 - Prob. 137QPCh. 5 - Prob. 138QPCh. 5 - Prob. 139QPCh. 5 - Prob. 140QPCh. 5 - Prob. 141QPCh. 5 - Prob. 142QPCh. 5 - Prob. 143QPCh. 5 - Prob. 144QPCh. 5 - Prob. 145QPCh. 5 - Prob. 146QPCh. 5 - Prob. 147QPCh. 5 - Prob. 148QPCh. 5 - Prob. 149QPCh. 5 - Prob. 150QPCh. 5 - Prob. 151QP
Knowledge Booster
Learn more about
Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.Similar questions
- Thioridazine, C21H26N2S2, is a pharmaceutical agent used to regulate dopamine (Dopamine, a neurotransmitter, affects brain processes that control movement emotional response, and ability to experience pleasure and pain.) A chemist can analyze a sample of the pharmaceutical for the thioridazine content by decomposing it to convert the sulfur in the compound to sulfate ion. This is then trapped as water-insoluble barium sulfate (see Figure 4.4). SO42(aq, from thioridazine) + BaCl2(aq) BaSO4(s) + 2 Cl(aq) Suppose a 12-tablet sample of the drug yielded 0.301 g of BaSO4. What is the thioridazine content, in milligrams, of each tablet?arrow_forwardWrite a balanced equation for the reaction of hydroiodic acid, HI, with calcium hydroxide, Ca(OH)2. Then, write the balanced complete ionic equation and the net ionic equation for this neutralization reaction.arrow_forwardOne of the ways to remove nitrogen monoxide gas, a serious source of air pollution, from smokestack emissions is by reaction with ammonia gas, NH3. The products of the reaction, N2 and H2O, are not toxic. Write the balanced equation for this reaction. Assign an oxidation number to each element in the reactants and products, and indicate which element is oxidized and which is reduced.arrow_forward
- Classify each of the following reactions as a combination reaction, decomposition reaction, displacement reaction, or combustion reaction. a When solid calcium oxide, CaO, is exposed to gaseous sulfur trioxide, SO3, solid calcium sulfate, CaSO4, is formed. b Calcium metal (solid) reacts with water to produce a solution of calcium hydroxide, Ca(OH)2, and hydrogen gas. c When solid sodium hydrogen sulfite, NaHSO3, is heated, solid sodium sulfite, Na2SO3, sulfur dioxide gas, SO2, and water vapor are formed. d Magnesium reacts with bromine to give magnesium bromide, MgBr2.arrow_forwardBalance each of the following equations, and then write the net ionic equation. Show states for all reactants and products (s, . g, aq). (a) the reaction of sodium hydroxide and iron(II) chloride to give iron(II) hydroxide and sodium chloride (b) the reaction of barium chloride with sodium carbonate to give barium carbonate and sodium chloride (c) the reaction of ammonia with phosphoric acidarrow_forwardOne of relatively few reactions that takes place directly between two solids at room temperature is Ba(OH)2+8H2O(s)+NH4SCN(s)Ba(SCN)2(s)+H2O(l)+NH3(g) In this equation, the 8H2O in Ba(OH)2 8H2O indicates the presence of eight water molecules. This compound is called barium hydroxide octahydrate. a. Balance the equation. b. What mass of ammonium thiocyanate (NH4SCN) must be used if it is to react completely with 6.5 g barium hydroxide octahydrate?arrow_forward
- In each of the following cases, aqueous solutions containing the compounds indicated are mixed. Write balanced net ionic equations for the reactions that occur. (a) CaCl2 + Na3PO4 (b) iron(III) chloride and potassium hydroxide (c) lead(II) nitrate and potassium chloridearrow_forwardIn each of the following cases, does a precipitation reaction occur when solutions of the two water-soluble reactants are mixed? Give the formula of any precipitate that forms, and write a balanced chemical equation for the precipitation reactions that occur. (a) sodium carbonate and copper(11) chloride (b) potassium carbonate and sodium nitrate (c) nickel(11) chloride and potassium hydroxidearrow_forwardVitamin C is ascorbic acid, HC6H7O6, which can be titrated with a strong base. HC6H7O6(aq) + NaOH(aq) NaC6H7O6(aq) + H2O() A student dissolved a 500.0-mg vitamin C tablet in 200.0 mL water and then titrated it with 0.1250-M NaOH. It required 21.30 mL of the base to reach the equivalence point. Calculate the mass percentage of the tablet that is impurity.arrow_forward
- A noncarbonated soft drink contains an unknown amount of citric acid, H3C6H5O7. lf 100. mL of the soft drink requires 33.51 mL of 0.0102 M NaOH to neutralize the citric add completely, what mass of citric acid does the soft drink contain per 100. mL? The reaction of citric acid and NaOH is H3C6H5O7(aq) + 3 NaOH(aq) Na3C6H5O7(aq) + 3 H2O()arrow_forwardThe Behavior of Substances in Water Part 1: a Ammonia, NH3, is a weak electrolyte. It forms ions in solution by reacting with water molecules to form the ammonium ion and hydroxide ion. Write the balanced chemical reaction for this process, including state symbols. b From everyday experience you are probably aware that table sugar (sucrose), C12H22O11, is soluble in water. When sucrose dissolves in water, it doesnt form ions through any reaction with water. It just dissolves without forming ions, so it is a nonelectrolyte. Write the chemical equation for the dissolving of sucrose in water. c Both NH3 and C12H22O11 are soluble molecular compounds, yet they behave differently in aqueous solution. Briefly explain why one is a weak electrolyte and the other is a nonelectrolyte. d Hydrochloric acid, HCl, is a molecular compound that is a strong electrolyte. Write the chemical reaction of HCl with water. e Compare the ammonia reaction with that of hydrochloric acid. Why are both of these substances considered electrolytes? f Explain why HCl is a strong electrolyte and ammonia is a weak electrolyte. g Classify each of the following substances as either ionic or molecular. KCl NH3 CO2 MgBr2 HCl Ca(OH)2 PbS HC2H3O2 h For those compounds above that you classified as ionic, use the solubility rules to determine which are soluble. i The majority of ionic substances are solids at room temperature. Describe what you would observe if you placed a soluble ionic compound and an insoluble ionic compound in separate beakers of water. j Write the chemical equation(s), including state symbols, for what happens when each soluble ionic compound that you identified above is placed in water. Are these substances reacting with water when they are added to water? k How would you classify the soluble ionic compounds: strong electrolyte, weak electrolyte, or nonelectrolyte? Explain your answer. l Sodium chloride, NaCl, is a strong electrolyte, as is hydroiodic acid, HI. Write the chemical equations for what happens when these substances are added to water. m Are NaCl and HI strong electrolytes because they have similar behavior in aqueous solution? If not, describe, using words and equations, the different chemical process that takes place in each case. Part 2: You have two hypothetical molecular compounds, AX and AY. AX is a strong electrolyte and AY is a weak electrolyte. The compounds undergo the following chemical reactions when added to water. AX(aq)+H2O(l)AH2O+(aq)+X(aq)AY(aq)+H2O(l)AH2O+(aq)+Y(aq) a Explain how the relative amounts of AX(aq) and AY(aq) would compare if you had a beaker of water with AX and a beaker of water with AY. b How would the relative amounts of X(aq) and Y(aq) in the two beakers compare? Be sure to explain your answer.arrow_forward(a) Butane gas, C4H10, can burn completely in air [use O2(g) as the other reactant] to give carbon dioxide gas and water vapor. Write a balanced equation for this combustion reaction. (b) Write a balanced chemical equation for the complete combustion of C3H7BO3, a gasoline additive. The products of combustion are CO2(g), H2O(g), and B2O3(s).arrow_forward
arrow_back_ios
SEE MORE QUESTIONS
arrow_forward_ios
Recommended textbooks for you
- Chemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningIntroductory Chemistry: A FoundationChemistryISBN:9781337399425Author:Steven S. Zumdahl, Donald J. DeCostePublisher:Cengage Learning
- Chemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage LearningChemistry for Engineering StudentsChemistryISBN:9781337398909Author:Lawrence S. Brown, Tom HolmePublisher:Cengage Learning
Chemistry & Chemical Reactivity
Chemistry
ISBN:9781133949640
Author:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel
Publisher:Cengage Learning
Chemistry & Chemical Reactivity
Chemistry
ISBN:9781337399074
Author:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel
Publisher:Cengage Learning
Introductory Chemistry: A Foundation
Chemistry
ISBN:9781337399425
Author:Steven S. Zumdahl, Donald J. DeCoste
Publisher:Cengage Learning
Chemistry: The Molecular Science
Chemistry
ISBN:9781285199047
Author:John W. Moore, Conrad L. Stanitski
Publisher:Cengage Learning
Chemistry: An Atoms First Approach
Chemistry
ISBN:9781305079243
Author:Steven S. Zumdahl, Susan A. Zumdahl
Publisher:Cengage Learning
Chemistry for Engineering Students
Chemistry
ISBN:9781337398909
Author:Lawrence S. Brown, Tom Holme
Publisher:Cengage Learning
Types of Matter: Elements, Compounds and Mixtures; Author: Professor Dave Explains;https://www.youtube.com/watch?v=dggHWvFJ8Xs;License: Standard YouTube License, CC-BY