Concept explainers
Interpretation:
The change in temperature for a reaction is to be determined.
Concept introduction:
Heat absorbed or released in a reaction is associated with the change in temperature in the reaction, which is determined as follows:
Where,
Specific heat is the heat required to increase the temperature of
The concentration (molarity) of a solution is determined by the following equation:
Where,
Answer to Problem 138AP
Solution: The change in temperature is
Explanation of Solution
Given information: A
The concentration (molarity) of a solution is determined by the following equation:
It can be rewritten as:
The equation for ionization of
From the reaction above, it is clear that the number of moles of HBr and H are equal.
So, the number of moles of
Substitute
The equation for ionization of
From the reaction, it is clear that the number of moles of
So, the number of moles of
Substitute
So,
Now, heat produced by the reaction is calculated as:
Substitute
As it is known that
So, heat is given by:
Mass of
Here,
Substitute
Now, substitute
Now, the change in temperature is determined by the following equation:
Here,
Equation
Substitute
The change in temperature for the given reaction is
Want to see more full solutions like this?
Chapter 5 Solutions
Chemistry - With Access (Looseleaf) (Custom)
- Insoluble PbBr2(s) precipitates when solutions of Pb(NO3)2(aq) and NaBr(aq) are mixed. Pb(NO3)2(aq) + 2 NaBr(aq) PbBr2(s) + 2 NaNO3(aq) rH = ? To measure the enthalpy change, 200. mL. of 0.75 M Pb(NO3)2(aq) and 200. mL of 1.5 M NaBr(aq) are mixed in a coffee-cup calorimeter. The temperature of the mixture rises by 2.44 C. Calculate the enthalpy change for the precipitation of PbBr2(s), in kJ/mol. (Assume the density of the solution is 1.0 g/mL., and its specific heat capacity is 4.2 J/g K.)arrow_forwardA 21.3-mL sample of 0.977 M NaOH is mixed with 29.5 mL of 0.918 M HCl in a coffee-cup calorimeter (see Section 6.6 of your text for a description of a coffee-cup calorimeter). The enthalpy of the reaction, written with the lowest whole-number coefficients, is 55.8 kJ. Both solutions are at 19.6C prior to mixing and reacting. What is the final temperature of the reaction mixture? When solving this problem, assume that no heat is lost from the calorimeter to the surroundings, the density of all solutions is 1.00 g/mL, the specific heat of all solutions is the same as that of water, and volumes are additive.arrow_forwardA 50-mL solution of a dilute AgNO3 solution is added to 100 mL of a base solution in a coffee-cup calorimeter. As Ag2O(s) precipitates, the temperature of the solution increases from 23.78 C to 25.19 C. Assuming that the mixture has the same specific heat as water and a mass of 150 g, calculate the heat q. Is the precipitation reaction exothermic or endothermic?arrow_forward
- When one mol of KOH is neutralized by sulfuric acid, q=56 kJ. (This is called the heat of neutralization.) At 23.7C, 25.0 mL of 0.475 M H2SO4 is neutralized by 0.613 M KOH in a coffee-cup calorimeter. Assume that the specific heat of all solutions is 4.18J/gC, that the density of all solutions is 1.00 g/mL, and that volumes are additive. (a) How many mL of KOH is required to neutralize H2SO4? (b) What is the final temperature of the solution?arrow_forwardA 29.1-mL sample of 1.05 M KOH is mixed with 20.9 mL of 1.07 M HBr in a coffee-cup calorimeter (see Section 6.6 of your text for a description of a coffee-cup calorimeter). The enthalpy of the reaction, written with the lowest whole-number coefficients, is 55.8 kJ. Both solutions are at 21.8C prior to mixing and reacting. What is the final temperature of the reaction mixture? When solving this problem, assume that no heat is lost from the calorimeter to the surroundings, the density of all solutions is 1.00 g/mL, and volumes are additive.arrow_forwardChlorine dioxide, ClO2, is a reddish yellow gas used in bleaching paper pulp. The average speed of a ClO2 molecule at 25C is 306 m/s. What is the kinetic energy (in joules) of a ClO2 molecule moving at this speed?arrow_forward
- In a coffee-cup calorimeter, 150.0 mL of 0.50 M HCI is added to 50.0 mL of 1.00 M NaOH to make 200.0 g solution at an initial temperature of 48.2C. If the enthalpy of neutralization for the reaction between a strong acid and a strong base is 56 kJ/mol, calculate the final temperature of the calorimeter contents. Assume the specific heat capacity of the solution is 4.184 J/g C and assume no heat Joss to the surroundings.arrow_forwardWhen lightning strikes, the energy can force atmospheric nitrogen and oxygen to react to make NO: N2(g)+O2(g)2NO(g)H=+181.8kJ (a) Is this reaction endothermic or exothermic? (b) What quantities of reactants and products are assumed if H = +181.8 kJ? (c) What is the enthalpy change when 3.50 g nitrogen is reacted with excess O2(g)?arrow_forwardWhen solid iron burns in oxygen gas (at constant pressure) to produce Fe2O3(s), 1651 kJ of heat is released for every 4 mol of iron burned. How much heat is released when 10.3 g Fe2O3(s) is produced (at constant pressure)? What additional information would you need to calculate the heat released to produce this much Fe2O3(s) if you burned iron in ozone gas, O3(g), instead of O2(g)?arrow_forward
- Gasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.arrow_forwardIn a bomb calorimeter, the reaction vessel is surrounded by water that must be added for each experiment. Since the amount of water is not constant from experiment to experiment, the mass of water must be measured in each case. The heat capacity of the calorimeter is broken down into two parts: the water and the calorimeter components. If a calorimeter contains 1.00 kg water and has a total heat capacity of 10.84 kJ/C, what is the heat capacity of the calorimeter components?arrow_forwardAcetic acid, HC2H3O2, is the sour constituent of vinegar (acetum is Latin for vinegar). In an experiment, 3.58 g of acetic acid was burned. HC2H3O2(l)+2O2(g)2CO2(g)+2H2O(l) If 52.0 kJ of heat evolved, what is H per mole of acetic acid?arrow_forward
- Chemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage Learning
- Chemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage LearningChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningWorld of Chemistry, 3rd editionChemistryISBN:9781133109655Author:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCostePublisher:Brooks / Cole / Cengage Learning