Interpretation:
Whether the standard enthalpy of the reaction is equal to the standard enthalpy of formation or not is to be determined.
Concept introduction:
The standard enthalpy of a reaction is the amount of enthalpy to occur under standard conditions.
The standard enthalpy of a reaction can be determined using the equation given below:
Here, the
The value of enthalpy of the formation of an element is zero at its most stable state.
Answer to Problem 87AP
Solution:
(a)
(b)
(c)
(d)
Explanation of Solution
a)
The reaction is given as follows:
Hydrogen in its
For the given equation, the enthalpy of the reaction is as follows:
The enthalpy of formation is zero for
Hence, for the reaction
b)
The reaction is given as follows:
Oxygen in its
For the given equation, the enthalpy of the reaction is as follows:
The enthalpy of formation is zero for
Hence, for the reaction
c)
The reaction is given as follows:
Hydrogen in its
For the given equation, the enthalpy of the reaction is as follows:
The enthalpy of formation is zero for
Hence, for the reaction
d)
The reaction is given as follows:
Oxygen is in its diatomic form, that is,
For the given equation, the enthalpy of the reaction is as follows:
The enthalpy of formation is zero for
Hence, for the reaction
Want to see more full solutions like this?
Chapter 5 Solutions
Aleks 360 Access Card (1 Semester) For Chemistry
- You did an experiment in which you found that 59.8 J was required to raise the temperature of 25.0 g of ethylene glycol (a compound used as antifreeze in automobile engines) by 1.00 K. Calculate the specific heat capacity of ethylene glycol from these data.arrow_forwardEthylene glycol, HOCH2CH2OH, is used as antifreeze. It is produced from ethylene oxide, C2H4O, by the reaction C2H4O(g)+H2O(l)HOCH2CH2OH(l) Use Hesss law to obtain the enthalpy change for this reaction from the following enthalpy changes: 2C2H4O(g)+5O2(g)4CO2(g)+4H2O(l);H=2612.2kJHOCH2CH2OH(l)+52O2(g)2CO2(g)+3H2O(l);H=1189.8kJarrow_forwardThe enthalpy of combustion of diamond is -395.4 kJ/mol. C s, dia O2 g CO2 g Determine the fH of C s, dia.arrow_forward
- A sample of benzene, C6H6, weighing 3.51 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 37.18C. If the heat capacity of the calorimeter and contents was 12.05 kJ/C, what is the value of q for burning 1.00 mol of benzene at constant volume and 25.00C? The reaction is C6H6(l)+152O2(g)6CO2(g)+3H2O(l) Is q equal to U or H?arrow_forwardNitric acid, HNO3, can be prepared by the following sequence of reactions: 4NH3(g)+5O2(g)4NO(g)+6H2O(g)2NO(g)+O2(g)2NO2(g)3NO2(g)+H2O(l)2HNO3(l)+NO(g) How much heat is evolved when 1 mol of NH3(g) is converted to HNO3(l)? Assume standard states at 25 C.arrow_forwardNitrogen gas (2.75 L) is confined in a cylinder under constant atmospheric pressure (1.01 105 pascals). The volume of gas decreases to 2.10 L when 485 J of energy is transferred as heat to the surroundings. What is the change in internal energy of the gas?arrow_forward
- The formation of aluminum oxide from its elements is highly exothermic. If 2.70 g Al metal is burned in pure O2 to give A12O3, calculate how much thermal energy is evolved in the process (at constant pressure).arrow_forwardA sample of sucrose, C12H22O11, is contaminated by sodium chloride. When the contaminated sample is burned in a bomb calorimeter, sodium chloride does not burn. What is the percentage of sucrose in the sample if a temperature increase of 1.67C is observed when 3.000 g of the sample are burned in the calorimeter? Sucrose gives off 5.64103kJ/mol when burned. The heat capacity of the calorimeter and water is 22.51 kJ/C.arrow_forwardA sample of ethanol, C2H5OH, weighing 2.84 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 33.73C. If the heat capacity of the calorimeter and contents was 9.63 kJ/C, what is the value of q for burning 1.00 mol of ethanol at constant volume and 25.00C? The reaction is C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) Is q equal to U or H?arrow_forward
- When solid iron burns in oxygen gas (at constant pressure) to produce Fe2O3(s), 1651 kJ of heat is released for every 4 mol of iron burned. How much heat is released when 10.3 g Fe2O3(s) is produced (at constant pressure)? What additional information would you need to calculate the heat released to produce this much Fe2O3(s) if you burned iron in ozone gas, O3(g), instead of O2(g)?arrow_forwardThe complete combustion of acetylene, C2H2(g), produces 1300. kJ of energy per mole of acetylene consumed. How many grams of acetylene must be burned to produce enough heat to raise the temperature of 1.00 gal water by 10.0c if the process is 80.0% efficient? Assume the density of water is 1.00 g/cm3arrow_forwardCombustion of table sugar produces CO2(g) and H2O( l). When 1.46 g table sugar is combusted in a constant-volume (bomb) calorimeter, 24.00 kJ of heat is liberated. a. Assuming that table sugar is pure sucrose, C12H22O11 (s), write the balanced equation for the combustion reaction. b. Calculate E in kJ/mol C12H22O11 for the combustion reaction of sucrose.arrow_forward
- Chemistry by OpenStax (2015-05-04)ChemistryISBN:9781938168390Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark BlaserPublisher:OpenStaxChemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningPhysical ChemistryChemistryISBN:9781133958437Author:Ball, David W. (david Warren), BAER, TomasPublisher:Wadsworth Cengage Learning,
- General Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage Learning